Backport 1ee712ab8687e5f4dec93d45da068d37d28feb8b from V8 upstream.
Original commit message:
Add SetAbortOnUncaughtExceptionCallback API
The --abort-on-uncaught-exception command line switch makes
Isolate::Throw abort if the error being thrown cannot be caught by a
try/catch block.
Embedders may want to use other mechanisms than try/catch blocks to
handle uncaught exceptions. For instance, Node.js has "domain" objects
that have error handlers that can handle uncaught exception like
following:
var d = domain.create();
d.on('error', function onError(err) {
console.log('Handling error');
});
d.run(function() {
throw new Error("boom");
});
These error handlers are called by isolates' message listeners.
If --abort-on-uncaught-exception is *not* used, the isolate's
message listener will be called, which will in turn call the domain's
error handler. The process will output 'Handling error' and will exit
successfully (not due to an uncaught exception). This is the behavior
that Node.js users expect.
However, if --abort-on-uncaught-exception is used and when throwing an
error within a domain that has an error handler, the process will abort
and the domain's error handler will not be called. This is not the
behavior that Node.js users expect.
Having a SetAbortOnUncaughtExceptionCallback API allows embedders to
determine when it's not appropriate to abort and instead handle the
exception via the isolate's message listener.
In the example above, Node.js would set a custom callback with
SetAbortOnUncaughtExceptionCallback that would be implemented as
following (the sample code has been simplified to remove what's not
relevant to this change):
bool ShouldAbortOnUncaughtException(Isolate* isolate) {
return !IsDomainActive();
}
Now when --abort-on-uncaught-exception is used, Isolate::Throw would
call that callback and determine that it should not abort if a domain
with an error handler is active. Instead, the isolate's message listener
would be called and the error would be handled by the domain's error
handler.
I believe this can also be useful for other embedders.
BUG=
R=bmeurer@chromium.org
Review URL: https://codereview.chromium.org/1375933003
Cr-Commit-Position: refs/heads/master@{#31111}
PR: #3036
PR-URL: https://github.com/nodejs/node/pull/3036
Reviewed-By: Ben Noordhuis <ben@strongloop.com>
8379 lines
264 KiB
C++
8379 lines
264 KiB
C++
// Copyright 2012 the V8 project authors. All rights reserved.
|
|
// Use of this source code is governed by a BSD-style license that can be
|
|
// found in the LICENSE file.
|
|
|
|
/** \mainpage V8 API Reference Guide
|
|
*
|
|
* V8 is Google's open source JavaScript engine.
|
|
*
|
|
* This set of documents provides reference material generated from the
|
|
* V8 header file, include/v8.h.
|
|
*
|
|
* For other documentation see http://code.google.com/apis/v8/
|
|
*/
|
|
|
|
#ifndef V8_H_
|
|
#define V8_H_
|
|
|
|
#include <stddef.h>
|
|
#include <stdint.h>
|
|
#include <stdio.h>
|
|
|
|
#include "v8-version.h"
|
|
#include "v8config.h"
|
|
|
|
// We reserve the V8_* prefix for macros defined in V8 public API and
|
|
// assume there are no name conflicts with the embedder's code.
|
|
|
|
#ifdef V8_OS_WIN
|
|
|
|
// Setup for Windows DLL export/import. When building the V8 DLL the
|
|
// BUILDING_V8_SHARED needs to be defined. When building a program which uses
|
|
// the V8 DLL USING_V8_SHARED needs to be defined. When either building the V8
|
|
// static library or building a program which uses the V8 static library neither
|
|
// BUILDING_V8_SHARED nor USING_V8_SHARED should be defined.
|
|
#if defined(BUILDING_V8_SHARED) && defined(USING_V8_SHARED)
|
|
#error both BUILDING_V8_SHARED and USING_V8_SHARED are set - please check the\
|
|
build configuration to ensure that at most one of these is set
|
|
#endif
|
|
|
|
#ifdef BUILDING_V8_SHARED
|
|
# define V8_EXPORT __declspec(dllexport)
|
|
#elif USING_V8_SHARED
|
|
# define V8_EXPORT __declspec(dllimport)
|
|
#else
|
|
# define V8_EXPORT
|
|
#endif // BUILDING_V8_SHARED
|
|
|
|
#else // V8_OS_WIN
|
|
|
|
// Setup for Linux shared library export.
|
|
#if V8_HAS_ATTRIBUTE_VISIBILITY && defined(V8_SHARED)
|
|
# ifdef BUILDING_V8_SHARED
|
|
# define V8_EXPORT __attribute__ ((visibility("default")))
|
|
# else
|
|
# define V8_EXPORT
|
|
# endif
|
|
#else
|
|
# define V8_EXPORT
|
|
#endif
|
|
|
|
#endif // V8_OS_WIN
|
|
|
|
/**
|
|
* The v8 JavaScript engine.
|
|
*/
|
|
namespace v8 {
|
|
|
|
class AccessorSignature;
|
|
class Array;
|
|
class Boolean;
|
|
class BooleanObject;
|
|
class Context;
|
|
class CpuProfiler;
|
|
class Data;
|
|
class Date;
|
|
class External;
|
|
class Function;
|
|
class FunctionTemplate;
|
|
class HeapProfiler;
|
|
class ImplementationUtilities;
|
|
class Int32;
|
|
class Integer;
|
|
class Isolate;
|
|
template <class T>
|
|
class Maybe;
|
|
class Name;
|
|
class Number;
|
|
class NumberObject;
|
|
class Object;
|
|
class ObjectOperationDescriptor;
|
|
class ObjectTemplate;
|
|
class Platform;
|
|
class Primitive;
|
|
class Promise;
|
|
class RawOperationDescriptor;
|
|
class Script;
|
|
class SharedArrayBuffer;
|
|
class Signature;
|
|
class StartupData;
|
|
class StackFrame;
|
|
class StackTrace;
|
|
class String;
|
|
class StringObject;
|
|
class Symbol;
|
|
class SymbolObject;
|
|
class Uint32;
|
|
class Utils;
|
|
class Value;
|
|
template <class T> class Local;
|
|
template <class T>
|
|
class MaybeLocal;
|
|
template <class T> class Eternal;
|
|
template<class T> class NonCopyablePersistentTraits;
|
|
template<class T> class PersistentBase;
|
|
template<class T,
|
|
class M = NonCopyablePersistentTraits<T> > class Persistent;
|
|
template <class T>
|
|
class Global;
|
|
template<class K, class V, class T> class PersistentValueMap;
|
|
template <class K, class V, class T>
|
|
class PersistentValueMapBase;
|
|
template <class K, class V, class T>
|
|
class GlobalValueMap;
|
|
template<class V, class T> class PersistentValueVector;
|
|
template<class T, class P> class WeakCallbackObject;
|
|
class FunctionTemplate;
|
|
class ObjectTemplate;
|
|
class Data;
|
|
template<typename T> class FunctionCallbackInfo;
|
|
template<typename T> class PropertyCallbackInfo;
|
|
class StackTrace;
|
|
class StackFrame;
|
|
class Isolate;
|
|
class CallHandlerHelper;
|
|
class EscapableHandleScope;
|
|
template<typename T> class ReturnValue;
|
|
|
|
namespace internal {
|
|
class Arguments;
|
|
class Heap;
|
|
class HeapObject;
|
|
class Isolate;
|
|
class Object;
|
|
struct StreamedSource;
|
|
template<typename T> class CustomArguments;
|
|
class PropertyCallbackArguments;
|
|
class FunctionCallbackArguments;
|
|
class GlobalHandles;
|
|
}
|
|
|
|
|
|
/**
|
|
* General purpose unique identifier.
|
|
*/
|
|
class UniqueId {
|
|
public:
|
|
explicit UniqueId(intptr_t data)
|
|
: data_(data) {}
|
|
|
|
bool operator==(const UniqueId& other) const {
|
|
return data_ == other.data_;
|
|
}
|
|
|
|
bool operator!=(const UniqueId& other) const {
|
|
return data_ != other.data_;
|
|
}
|
|
|
|
bool operator<(const UniqueId& other) const {
|
|
return data_ < other.data_;
|
|
}
|
|
|
|
private:
|
|
intptr_t data_;
|
|
};
|
|
|
|
// --- Handles ---
|
|
|
|
#define TYPE_CHECK(T, S) \
|
|
while (false) { \
|
|
*(static_cast<T* volatile*>(0)) = static_cast<S*>(0); \
|
|
}
|
|
|
|
|
|
/**
|
|
* An object reference managed by the v8 garbage collector.
|
|
*
|
|
* All objects returned from v8 have to be tracked by the garbage
|
|
* collector so that it knows that the objects are still alive. Also,
|
|
* because the garbage collector may move objects, it is unsafe to
|
|
* point directly to an object. Instead, all objects are stored in
|
|
* handles which are known by the garbage collector and updated
|
|
* whenever an object moves. Handles should always be passed by value
|
|
* (except in cases like out-parameters) and they should never be
|
|
* allocated on the heap.
|
|
*
|
|
* There are two types of handles: local and persistent handles.
|
|
* Local handles are light-weight and transient and typically used in
|
|
* local operations. They are managed by HandleScopes. Persistent
|
|
* handles can be used when storing objects across several independent
|
|
* operations and have to be explicitly deallocated when they're no
|
|
* longer used.
|
|
*
|
|
* It is safe to extract the object stored in the handle by
|
|
* dereferencing the handle (for instance, to extract the Object* from
|
|
* a Local<Object>); the value will still be governed by a handle
|
|
* behind the scenes and the same rules apply to these values as to
|
|
* their handles.
|
|
*/
|
|
template <class T>
|
|
class Local {
|
|
public:
|
|
V8_INLINE Local() : val_(0) {}
|
|
template <class S>
|
|
V8_INLINE Local(Local<S> that)
|
|
: val_(reinterpret_cast<T*>(*that)) {
|
|
/**
|
|
* This check fails when trying to convert between incompatible
|
|
* handles. For example, converting from a Local<String> to a
|
|
* Local<Number>.
|
|
*/
|
|
TYPE_CHECK(T, S);
|
|
}
|
|
|
|
/**
|
|
* Returns true if the handle is empty.
|
|
*/
|
|
V8_INLINE bool IsEmpty() const { return val_ == 0; }
|
|
|
|
/**
|
|
* Sets the handle to be empty. IsEmpty() will then return true.
|
|
*/
|
|
V8_INLINE void Clear() { val_ = 0; }
|
|
|
|
V8_INLINE T* operator->() const { return val_; }
|
|
|
|
V8_INLINE T* operator*() const { return val_; }
|
|
|
|
/**
|
|
* Checks whether two handles are the same.
|
|
* Returns true if both are empty, or if the objects
|
|
* to which they refer are identical.
|
|
* The handles' references are not checked.
|
|
*/
|
|
template <class S>
|
|
V8_INLINE bool operator==(const Local<S>& that) const {
|
|
internal::Object** a = reinterpret_cast<internal::Object**>(this->val_);
|
|
internal::Object** b = reinterpret_cast<internal::Object**>(that.val_);
|
|
if (a == 0) return b == 0;
|
|
if (b == 0) return false;
|
|
return *a == *b;
|
|
}
|
|
|
|
template <class S> V8_INLINE bool operator==(
|
|
const PersistentBase<S>& that) const {
|
|
internal::Object** a = reinterpret_cast<internal::Object**>(this->val_);
|
|
internal::Object** b = reinterpret_cast<internal::Object**>(that.val_);
|
|
if (a == 0) return b == 0;
|
|
if (b == 0) return false;
|
|
return *a == *b;
|
|
}
|
|
|
|
/**
|
|
* Checks whether two handles are different.
|
|
* Returns true if only one of the handles is empty, or if
|
|
* the objects to which they refer are different.
|
|
* The handles' references are not checked.
|
|
*/
|
|
template <class S>
|
|
V8_INLINE bool operator!=(const Local<S>& that) const {
|
|
return !operator==(that);
|
|
}
|
|
|
|
template <class S> V8_INLINE bool operator!=(
|
|
const Persistent<S>& that) const {
|
|
return !operator==(that);
|
|
}
|
|
|
|
template <class S> V8_INLINE static Local<T> Cast(Local<S> that) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
// If we're going to perform the type check then we have to check
|
|
// that the handle isn't empty before doing the checked cast.
|
|
if (that.IsEmpty()) return Local<T>();
|
|
#endif
|
|
return Local<T>(T::Cast(*that));
|
|
}
|
|
|
|
|
|
template <class S> V8_INLINE Local<S> As() {
|
|
return Local<S>::Cast(*this);
|
|
}
|
|
|
|
/**
|
|
* Create a local handle for the content of another handle.
|
|
* The referee is kept alive by the local handle even when
|
|
* the original handle is destroyed/disposed.
|
|
*/
|
|
V8_INLINE static Local<T> New(Isolate* isolate, Local<T> that);
|
|
V8_INLINE static Local<T> New(Isolate* isolate,
|
|
const PersistentBase<T>& that);
|
|
|
|
private:
|
|
friend class Utils;
|
|
template<class F> friend class Eternal;
|
|
template<class F> friend class PersistentBase;
|
|
template<class F, class M> friend class Persistent;
|
|
template<class F> friend class Local;
|
|
template <class F>
|
|
friend class MaybeLocal;
|
|
template<class F> friend class FunctionCallbackInfo;
|
|
template<class F> friend class PropertyCallbackInfo;
|
|
friend class String;
|
|
friend class Object;
|
|
friend class Context;
|
|
template<class F> friend class internal::CustomArguments;
|
|
friend Local<Primitive> Undefined(Isolate* isolate);
|
|
friend Local<Primitive> Null(Isolate* isolate);
|
|
friend Local<Boolean> True(Isolate* isolate);
|
|
friend Local<Boolean> False(Isolate* isolate);
|
|
friend class HandleScope;
|
|
friend class EscapableHandleScope;
|
|
template <class F1, class F2, class F3>
|
|
friend class PersistentValueMapBase;
|
|
template<class F1, class F2> friend class PersistentValueVector;
|
|
|
|
template <class S>
|
|
V8_INLINE Local(S* that)
|
|
: val_(that) {}
|
|
V8_INLINE static Local<T> New(Isolate* isolate, T* that);
|
|
T* val_;
|
|
};
|
|
|
|
|
|
#if !defined(V8_IMMINENT_DEPRECATION_WARNINGS)
|
|
// Local is an alias for Local for historical reasons.
|
|
template <class T>
|
|
using Handle = Local<T>;
|
|
#endif
|
|
|
|
|
|
/**
|
|
* A MaybeLocal<> is a wrapper around Local<> that enforces a check whether
|
|
* the Local<> is empty before it can be used.
|
|
*
|
|
* If an API method returns a MaybeLocal<>, the API method can potentially fail
|
|
* either because an exception is thrown, or because an exception is pending,
|
|
* e.g. because a previous API call threw an exception that hasn't been caught
|
|
* yet, or because a TerminateExecution exception was thrown. In that case, an
|
|
* empty MaybeLocal is returned.
|
|
*/
|
|
template <class T>
|
|
class MaybeLocal {
|
|
public:
|
|
V8_INLINE MaybeLocal() : val_(nullptr) {}
|
|
template <class S>
|
|
V8_INLINE MaybeLocal(Local<S> that)
|
|
: val_(reinterpret_cast<T*>(*that)) {
|
|
TYPE_CHECK(T, S);
|
|
}
|
|
|
|
V8_INLINE bool IsEmpty() const { return val_ == nullptr; }
|
|
|
|
template <class S>
|
|
V8_WARN_UNUSED_RESULT V8_INLINE bool ToLocal(Local<S>* out) const {
|
|
out->val_ = IsEmpty() ? nullptr : this->val_;
|
|
return !IsEmpty();
|
|
}
|
|
|
|
// Will crash if the MaybeLocal<> is empty.
|
|
V8_INLINE Local<T> ToLocalChecked();
|
|
|
|
template <class S>
|
|
V8_INLINE Local<S> FromMaybe(Local<S> default_value) const {
|
|
return IsEmpty() ? default_value : Local<S>(val_);
|
|
}
|
|
|
|
private:
|
|
T* val_;
|
|
};
|
|
|
|
|
|
// Eternal handles are set-once handles that live for the life of the isolate.
|
|
template <class T> class Eternal {
|
|
public:
|
|
V8_INLINE Eternal() : index_(kInitialValue) { }
|
|
template<class S>
|
|
V8_INLINE Eternal(Isolate* isolate, Local<S> handle) : index_(kInitialValue) {
|
|
Set(isolate, handle);
|
|
}
|
|
// Can only be safely called if already set.
|
|
V8_INLINE Local<T> Get(Isolate* isolate);
|
|
V8_INLINE bool IsEmpty() { return index_ == kInitialValue; }
|
|
template<class S> V8_INLINE void Set(Isolate* isolate, Local<S> handle);
|
|
|
|
private:
|
|
static const int kInitialValue = -1;
|
|
int index_;
|
|
};
|
|
|
|
|
|
static const int kInternalFieldsInWeakCallback = 2;
|
|
|
|
|
|
template <typename T>
|
|
class WeakCallbackInfo {
|
|
public:
|
|
typedef void (*Callback)(const WeakCallbackInfo<T>& data);
|
|
|
|
WeakCallbackInfo(Isolate* isolate, T* parameter,
|
|
void* internal_fields[kInternalFieldsInWeakCallback],
|
|
Callback* callback)
|
|
: isolate_(isolate), parameter_(parameter), callback_(callback) {
|
|
for (int i = 0; i < kInternalFieldsInWeakCallback; ++i) {
|
|
internal_fields_[i] = internal_fields[i];
|
|
}
|
|
}
|
|
|
|
V8_INLINE Isolate* GetIsolate() const { return isolate_; }
|
|
V8_INLINE T* GetParameter() const { return parameter_; }
|
|
V8_INLINE void* GetInternalField(int index) const;
|
|
|
|
V8_INLINE V8_DEPRECATE_SOON("use indexed version",
|
|
void* GetInternalField1() const) {
|
|
return internal_fields_[0];
|
|
}
|
|
V8_INLINE V8_DEPRECATE_SOON("use indexed version",
|
|
void* GetInternalField2() const) {
|
|
return internal_fields_[1];
|
|
}
|
|
|
|
bool IsFirstPass() const { return callback_ != nullptr; }
|
|
|
|
// When first called, the embedder MUST Reset() the Global which triggered the
|
|
// callback. The Global itself is unusable for anything else. No v8 other api
|
|
// calls may be called in the first callback. Should additional work be
|
|
// required, the embedder must set a second pass callback, which will be
|
|
// called after all the initial callbacks are processed.
|
|
// Calling SetSecondPassCallback on the second pass will immediately crash.
|
|
void SetSecondPassCallback(Callback callback) const { *callback_ = callback; }
|
|
|
|
private:
|
|
Isolate* isolate_;
|
|
T* parameter_;
|
|
Callback* callback_;
|
|
void* internal_fields_[kInternalFieldsInWeakCallback];
|
|
};
|
|
|
|
|
|
template <class T, class P>
|
|
class WeakCallbackData {
|
|
public:
|
|
typedef void (*Callback)(const WeakCallbackData<T, P>& data);
|
|
|
|
WeakCallbackData(Isolate* isolate, P* parameter, Local<T> handle)
|
|
: isolate_(isolate), parameter_(parameter), handle_(handle) {}
|
|
|
|
V8_INLINE Isolate* GetIsolate() const { return isolate_; }
|
|
V8_INLINE P* GetParameter() const { return parameter_; }
|
|
V8_INLINE Local<T> GetValue() const { return handle_; }
|
|
|
|
private:
|
|
Isolate* isolate_;
|
|
P* parameter_;
|
|
Local<T> handle_;
|
|
};
|
|
|
|
|
|
// TODO(dcarney): delete this with WeakCallbackData
|
|
template <class T>
|
|
using PhantomCallbackData = WeakCallbackInfo<T>;
|
|
|
|
|
|
enum class WeakCallbackType { kParameter, kInternalFields };
|
|
|
|
|
|
/**
|
|
* An object reference that is independent of any handle scope. Where
|
|
* a Local handle only lives as long as the HandleScope in which it was
|
|
* allocated, a PersistentBase handle remains valid until it is explicitly
|
|
* disposed.
|
|
*
|
|
* A persistent handle contains a reference to a storage cell within
|
|
* the v8 engine which holds an object value and which is updated by
|
|
* the garbage collector whenever the object is moved. A new storage
|
|
* cell can be created using the constructor or PersistentBase::Reset and
|
|
* existing handles can be disposed using PersistentBase::Reset.
|
|
*
|
|
*/
|
|
template <class T> class PersistentBase {
|
|
public:
|
|
/**
|
|
* If non-empty, destroy the underlying storage cell
|
|
* IsEmpty() will return true after this call.
|
|
*/
|
|
V8_INLINE void Reset();
|
|
/**
|
|
* If non-empty, destroy the underlying storage cell
|
|
* and create a new one with the contents of other if other is non empty
|
|
*/
|
|
template <class S>
|
|
V8_INLINE void Reset(Isolate* isolate, const Local<S>& other);
|
|
|
|
/**
|
|
* If non-empty, destroy the underlying storage cell
|
|
* and create a new one with the contents of other if other is non empty
|
|
*/
|
|
template <class S>
|
|
V8_INLINE void Reset(Isolate* isolate, const PersistentBase<S>& other);
|
|
|
|
V8_INLINE bool IsEmpty() const { return val_ == NULL; }
|
|
V8_INLINE void Empty() { val_ = 0; }
|
|
|
|
template <class S>
|
|
V8_INLINE bool operator==(const PersistentBase<S>& that) const {
|
|
internal::Object** a = reinterpret_cast<internal::Object**>(this->val_);
|
|
internal::Object** b = reinterpret_cast<internal::Object**>(that.val_);
|
|
if (a == NULL) return b == NULL;
|
|
if (b == NULL) return false;
|
|
return *a == *b;
|
|
}
|
|
|
|
template <class S>
|
|
V8_INLINE bool operator==(const Local<S>& that) const {
|
|
internal::Object** a = reinterpret_cast<internal::Object**>(this->val_);
|
|
internal::Object** b = reinterpret_cast<internal::Object**>(that.val_);
|
|
if (a == NULL) return b == NULL;
|
|
if (b == NULL) return false;
|
|
return *a == *b;
|
|
}
|
|
|
|
template <class S>
|
|
V8_INLINE bool operator!=(const PersistentBase<S>& that) const {
|
|
return !operator==(that);
|
|
}
|
|
|
|
template <class S>
|
|
V8_INLINE bool operator!=(const Local<S>& that) const {
|
|
return !operator==(that);
|
|
}
|
|
|
|
/**
|
|
* Install a finalization callback on this object.
|
|
* NOTE: There is no guarantee as to *when* or even *if* the callback is
|
|
* invoked. The invocation is performed solely on a best effort basis.
|
|
* As always, GC-based finalization should *not* be relied upon for any
|
|
* critical form of resource management!
|
|
*/
|
|
template <typename P>
|
|
V8_INLINE V8_DEPRECATE_SOON(
|
|
"use WeakCallbackInfo version",
|
|
void SetWeak(P* parameter,
|
|
typename WeakCallbackData<T, P>::Callback callback));
|
|
|
|
template <typename S, typename P>
|
|
V8_INLINE V8_DEPRECATE_SOON(
|
|
"use WeakCallbackInfo version",
|
|
void SetWeak(P* parameter,
|
|
typename WeakCallbackData<S, P>::Callback callback));
|
|
|
|
// Phantom persistents work like weak persistents, except that the pointer to
|
|
// the object being collected is not available in the finalization callback.
|
|
// This enables the garbage collector to collect the object and any objects
|
|
// it references transitively in one GC cycle. At the moment you can either
|
|
// specify a parameter for the callback or the location of two internal
|
|
// fields in the dying object.
|
|
template <typename P>
|
|
V8_INLINE V8_DEPRECATE_SOON(
|
|
"use SetWeak",
|
|
void SetPhantom(P* parameter,
|
|
typename WeakCallbackInfo<P>::Callback callback,
|
|
int internal_field_index1 = -1,
|
|
int internal_field_index2 = -1));
|
|
|
|
template <typename P>
|
|
V8_INLINE void SetWeak(P* parameter,
|
|
typename WeakCallbackInfo<P>::Callback callback,
|
|
WeakCallbackType type);
|
|
|
|
template<typename P>
|
|
V8_INLINE P* ClearWeak();
|
|
|
|
// TODO(dcarney): remove this.
|
|
V8_INLINE void ClearWeak() { ClearWeak<void>(); }
|
|
|
|
/**
|
|
* Marks the reference to this object independent. Garbage collector is free
|
|
* to ignore any object groups containing this object. Weak callback for an
|
|
* independent handle should not assume that it will be preceded by a global
|
|
* GC prologue callback or followed by a global GC epilogue callback.
|
|
*/
|
|
V8_INLINE void MarkIndependent();
|
|
|
|
/**
|
|
* Marks the reference to this object partially dependent. Partially dependent
|
|
* handles only depend on other partially dependent handles and these
|
|
* dependencies are provided through object groups. It provides a way to build
|
|
* smaller object groups for young objects that represent only a subset of all
|
|
* external dependencies. This mark is automatically cleared after each
|
|
* garbage collection.
|
|
*/
|
|
V8_INLINE void MarkPartiallyDependent();
|
|
|
|
V8_INLINE bool IsIndependent() const;
|
|
|
|
/** Checks if the handle holds the only reference to an object. */
|
|
V8_INLINE bool IsNearDeath() const;
|
|
|
|
/** Returns true if the handle's reference is weak. */
|
|
V8_INLINE bool IsWeak() const;
|
|
|
|
/**
|
|
* Assigns a wrapper class ID to the handle. See RetainedObjectInfo interface
|
|
* description in v8-profiler.h for details.
|
|
*/
|
|
V8_INLINE void SetWrapperClassId(uint16_t class_id);
|
|
|
|
/**
|
|
* Returns the class ID previously assigned to this handle or 0 if no class ID
|
|
* was previously assigned.
|
|
*/
|
|
V8_INLINE uint16_t WrapperClassId() const;
|
|
|
|
private:
|
|
friend class Isolate;
|
|
friend class Utils;
|
|
template<class F> friend class Local;
|
|
template<class F1, class F2> friend class Persistent;
|
|
template <class F>
|
|
friend class Global;
|
|
template<class F> friend class PersistentBase;
|
|
template<class F> friend class ReturnValue;
|
|
template <class F1, class F2, class F3>
|
|
friend class PersistentValueMapBase;
|
|
template<class F1, class F2> friend class PersistentValueVector;
|
|
friend class Object;
|
|
|
|
explicit V8_INLINE PersistentBase(T* val) : val_(val) {}
|
|
PersistentBase(PersistentBase& other) = delete; // NOLINT
|
|
void operator=(PersistentBase&) = delete;
|
|
V8_INLINE static T* New(Isolate* isolate, T* that);
|
|
|
|
T* val_;
|
|
};
|
|
|
|
|
|
/**
|
|
* Default traits for Persistent. This class does not allow
|
|
* use of the copy constructor or assignment operator.
|
|
* At present kResetInDestructor is not set, but that will change in a future
|
|
* version.
|
|
*/
|
|
template<class T>
|
|
class NonCopyablePersistentTraits {
|
|
public:
|
|
typedef Persistent<T, NonCopyablePersistentTraits<T> > NonCopyablePersistent;
|
|
static const bool kResetInDestructor = false;
|
|
template<class S, class M>
|
|
V8_INLINE static void Copy(const Persistent<S, M>& source,
|
|
NonCopyablePersistent* dest) {
|
|
Uncompilable<Object>();
|
|
}
|
|
// TODO(dcarney): come up with a good compile error here.
|
|
template<class O> V8_INLINE static void Uncompilable() {
|
|
TYPE_CHECK(O, Primitive);
|
|
}
|
|
};
|
|
|
|
|
|
/**
|
|
* Helper class traits to allow copying and assignment of Persistent.
|
|
* This will clone the contents of storage cell, but not any of the flags, etc.
|
|
*/
|
|
template<class T>
|
|
struct CopyablePersistentTraits {
|
|
typedef Persistent<T, CopyablePersistentTraits<T> > CopyablePersistent;
|
|
static const bool kResetInDestructor = true;
|
|
template<class S, class M>
|
|
static V8_INLINE void Copy(const Persistent<S, M>& source,
|
|
CopyablePersistent* dest) {
|
|
// do nothing, just allow copy
|
|
}
|
|
};
|
|
|
|
|
|
/**
|
|
* A PersistentBase which allows copy and assignment.
|
|
*
|
|
* Copy, assignment and destructor bevavior is controlled by the traits
|
|
* class M.
|
|
*
|
|
* Note: Persistent class hierarchy is subject to future changes.
|
|
*/
|
|
template <class T, class M> class Persistent : public PersistentBase<T> {
|
|
public:
|
|
/**
|
|
* A Persistent with no storage cell.
|
|
*/
|
|
V8_INLINE Persistent() : PersistentBase<T>(0) { }
|
|
/**
|
|
* Construct a Persistent from a Local.
|
|
* When the Local is non-empty, a new storage cell is created
|
|
* pointing to the same object, and no flags are set.
|
|
*/
|
|
template <class S>
|
|
V8_INLINE Persistent(Isolate* isolate, Local<S> that)
|
|
: PersistentBase<T>(PersistentBase<T>::New(isolate, *that)) {
|
|
TYPE_CHECK(T, S);
|
|
}
|
|
/**
|
|
* Construct a Persistent from a Persistent.
|
|
* When the Persistent is non-empty, a new storage cell is created
|
|
* pointing to the same object, and no flags are set.
|
|
*/
|
|
template <class S, class M2>
|
|
V8_INLINE Persistent(Isolate* isolate, const Persistent<S, M2>& that)
|
|
: PersistentBase<T>(PersistentBase<T>::New(isolate, *that)) {
|
|
TYPE_CHECK(T, S);
|
|
}
|
|
/**
|
|
* The copy constructors and assignment operator create a Persistent
|
|
* exactly as the Persistent constructor, but the Copy function from the
|
|
* traits class is called, allowing the setting of flags based on the
|
|
* copied Persistent.
|
|
*/
|
|
V8_INLINE Persistent(const Persistent& that) : PersistentBase<T>(0) {
|
|
Copy(that);
|
|
}
|
|
template <class S, class M2>
|
|
V8_INLINE Persistent(const Persistent<S, M2>& that) : PersistentBase<T>(0) {
|
|
Copy(that);
|
|
}
|
|
V8_INLINE Persistent& operator=(const Persistent& that) { // NOLINT
|
|
Copy(that);
|
|
return *this;
|
|
}
|
|
template <class S, class M2>
|
|
V8_INLINE Persistent& operator=(const Persistent<S, M2>& that) { // NOLINT
|
|
Copy(that);
|
|
return *this;
|
|
}
|
|
/**
|
|
* The destructor will dispose the Persistent based on the
|
|
* kResetInDestructor flags in the traits class. Since not calling dispose
|
|
* can result in a memory leak, it is recommended to always set this flag.
|
|
*/
|
|
V8_INLINE ~Persistent() {
|
|
if (M::kResetInDestructor) this->Reset();
|
|
}
|
|
|
|
// TODO(dcarney): this is pretty useless, fix or remove
|
|
template <class S>
|
|
V8_INLINE static Persistent<T>& Cast(Persistent<S>& that) { // NOLINT
|
|
#ifdef V8_ENABLE_CHECKS
|
|
// If we're going to perform the type check then we have to check
|
|
// that the handle isn't empty before doing the checked cast.
|
|
if (!that.IsEmpty()) T::Cast(*that);
|
|
#endif
|
|
return reinterpret_cast<Persistent<T>&>(that);
|
|
}
|
|
|
|
// TODO(dcarney): this is pretty useless, fix or remove
|
|
template <class S> V8_INLINE Persistent<S>& As() { // NOLINT
|
|
return Persistent<S>::Cast(*this);
|
|
}
|
|
|
|
private:
|
|
friend class Isolate;
|
|
friend class Utils;
|
|
template<class F> friend class Local;
|
|
template<class F1, class F2> friend class Persistent;
|
|
template<class F> friend class ReturnValue;
|
|
|
|
template <class S> V8_INLINE Persistent(S* that) : PersistentBase<T>(that) { }
|
|
V8_INLINE T* operator*() const { return this->val_; }
|
|
template<class S, class M2>
|
|
V8_INLINE void Copy(const Persistent<S, M2>& that);
|
|
};
|
|
|
|
|
|
/**
|
|
* A PersistentBase which has move semantics.
|
|
*
|
|
* Note: Persistent class hierarchy is subject to future changes.
|
|
*/
|
|
template <class T>
|
|
class Global : public PersistentBase<T> {
|
|
public:
|
|
/**
|
|
* A Global with no storage cell.
|
|
*/
|
|
V8_INLINE Global() : PersistentBase<T>(nullptr) {}
|
|
/**
|
|
* Construct a Global from a Local.
|
|
* When the Local is non-empty, a new storage cell is created
|
|
* pointing to the same object, and no flags are set.
|
|
*/
|
|
template <class S>
|
|
V8_INLINE Global(Isolate* isolate, Local<S> that)
|
|
: PersistentBase<T>(PersistentBase<T>::New(isolate, *that)) {
|
|
TYPE_CHECK(T, S);
|
|
}
|
|
/**
|
|
* Construct a Global from a PersistentBase.
|
|
* When the Persistent is non-empty, a new storage cell is created
|
|
* pointing to the same object, and no flags are set.
|
|
*/
|
|
template <class S>
|
|
V8_INLINE Global(Isolate* isolate, const PersistentBase<S>& that)
|
|
: PersistentBase<T>(PersistentBase<T>::New(isolate, that.val_)) {
|
|
TYPE_CHECK(T, S);
|
|
}
|
|
/**
|
|
* Move constructor.
|
|
*/
|
|
V8_INLINE Global(Global&& other) : PersistentBase<T>(other.val_) {
|
|
other.val_ = nullptr;
|
|
}
|
|
V8_INLINE ~Global() { this->Reset(); }
|
|
/**
|
|
* Move via assignment.
|
|
*/
|
|
template <class S>
|
|
V8_INLINE Global& operator=(Global<S>&& rhs) {
|
|
TYPE_CHECK(T, S);
|
|
if (this != &rhs) {
|
|
this->Reset();
|
|
this->val_ = rhs.val_;
|
|
rhs.val_ = nullptr;
|
|
}
|
|
return *this;
|
|
}
|
|
/**
|
|
* Pass allows returning uniques from functions, etc.
|
|
*/
|
|
Global Pass() { return static_cast<Global&&>(*this); }
|
|
|
|
/*
|
|
* For compatibility with Chromium's base::Bind (base::Passed).
|
|
*/
|
|
typedef void MoveOnlyTypeForCPP03;
|
|
|
|
private:
|
|
template <class F>
|
|
friend class ReturnValue;
|
|
Global(Global&) = delete;
|
|
void operator=(Global&) = delete;
|
|
V8_INLINE T* operator*() const { return this->val_; }
|
|
};
|
|
|
|
|
|
// UniquePersistent is an alias for Global for historical reason.
|
|
template <class T>
|
|
using UniquePersistent = Global<T>;
|
|
|
|
|
|
/**
|
|
* A stack-allocated class that governs a number of local handles.
|
|
* After a handle scope has been created, all local handles will be
|
|
* allocated within that handle scope until either the handle scope is
|
|
* deleted or another handle scope is created. If there is already a
|
|
* handle scope and a new one is created, all allocations will take
|
|
* place in the new handle scope until it is deleted. After that,
|
|
* new handles will again be allocated in the original handle scope.
|
|
*
|
|
* After the handle scope of a local handle has been deleted the
|
|
* garbage collector will no longer track the object stored in the
|
|
* handle and may deallocate it. The behavior of accessing a handle
|
|
* for which the handle scope has been deleted is undefined.
|
|
*/
|
|
class V8_EXPORT HandleScope {
|
|
public:
|
|
HandleScope(Isolate* isolate);
|
|
|
|
~HandleScope();
|
|
|
|
/**
|
|
* Counts the number of allocated handles.
|
|
*/
|
|
static int NumberOfHandles(Isolate* isolate);
|
|
|
|
V8_INLINE Isolate* GetIsolate() const {
|
|
return reinterpret_cast<Isolate*>(isolate_);
|
|
}
|
|
|
|
protected:
|
|
V8_INLINE HandleScope() {}
|
|
|
|
void Initialize(Isolate* isolate);
|
|
|
|
static internal::Object** CreateHandle(internal::Isolate* isolate,
|
|
internal::Object* value);
|
|
|
|
private:
|
|
// Uses heap_object to obtain the current Isolate.
|
|
static internal::Object** CreateHandle(internal::HeapObject* heap_object,
|
|
internal::Object* value);
|
|
|
|
// Make it hard to create heap-allocated or illegal handle scopes by
|
|
// disallowing certain operations.
|
|
HandleScope(const HandleScope&);
|
|
void operator=(const HandleScope&);
|
|
void* operator new(size_t size);
|
|
void operator delete(void*, size_t);
|
|
|
|
internal::Isolate* isolate_;
|
|
internal::Object** prev_next_;
|
|
internal::Object** prev_limit_;
|
|
|
|
// Local::New uses CreateHandle with an Isolate* parameter.
|
|
template<class F> friend class Local;
|
|
|
|
// Object::GetInternalField and Context::GetEmbedderData use CreateHandle with
|
|
// a HeapObject* in their shortcuts.
|
|
friend class Object;
|
|
friend class Context;
|
|
};
|
|
|
|
|
|
/**
|
|
* A HandleScope which first allocates a handle in the current scope
|
|
* which will be later filled with the escape value.
|
|
*/
|
|
class V8_EXPORT EscapableHandleScope : public HandleScope {
|
|
public:
|
|
EscapableHandleScope(Isolate* isolate);
|
|
V8_INLINE ~EscapableHandleScope() {}
|
|
|
|
/**
|
|
* Pushes the value into the previous scope and returns a handle to it.
|
|
* Cannot be called twice.
|
|
*/
|
|
template <class T>
|
|
V8_INLINE Local<T> Escape(Local<T> value) {
|
|
internal::Object** slot =
|
|
Escape(reinterpret_cast<internal::Object**>(*value));
|
|
return Local<T>(reinterpret_cast<T*>(slot));
|
|
}
|
|
|
|
private:
|
|
internal::Object** Escape(internal::Object** escape_value);
|
|
|
|
// Make it hard to create heap-allocated or illegal handle scopes by
|
|
// disallowing certain operations.
|
|
EscapableHandleScope(const EscapableHandleScope&);
|
|
void operator=(const EscapableHandleScope&);
|
|
void* operator new(size_t size);
|
|
void operator delete(void*, size_t);
|
|
|
|
internal::Object** escape_slot_;
|
|
};
|
|
|
|
class V8_EXPORT SealHandleScope {
|
|
public:
|
|
SealHandleScope(Isolate* isolate);
|
|
~SealHandleScope();
|
|
|
|
private:
|
|
// Make it hard to create heap-allocated or illegal handle scopes by
|
|
// disallowing certain operations.
|
|
SealHandleScope(const SealHandleScope&);
|
|
void operator=(const SealHandleScope&);
|
|
void* operator new(size_t size);
|
|
void operator delete(void*, size_t);
|
|
|
|
internal::Isolate* isolate_;
|
|
int prev_level_;
|
|
internal::Object** prev_limit_;
|
|
};
|
|
|
|
|
|
// --- Special objects ---
|
|
|
|
|
|
/**
|
|
* The superclass of values and API object templates.
|
|
*/
|
|
class V8_EXPORT Data {
|
|
private:
|
|
Data();
|
|
};
|
|
|
|
|
|
/**
|
|
* The optional attributes of ScriptOrigin.
|
|
*/
|
|
class ScriptOriginOptions {
|
|
public:
|
|
V8_INLINE ScriptOriginOptions(bool is_embedder_debug_script = false,
|
|
bool is_shared_cross_origin = false,
|
|
bool is_opaque = false)
|
|
: flags_((is_embedder_debug_script ? kIsEmbedderDebugScript : 0) |
|
|
(is_shared_cross_origin ? kIsSharedCrossOrigin : 0) |
|
|
(is_opaque ? kIsOpaque : 0)) {}
|
|
V8_INLINE ScriptOriginOptions(int flags)
|
|
: flags_(flags &
|
|
(kIsEmbedderDebugScript | kIsSharedCrossOrigin | kIsOpaque)) {}
|
|
bool IsEmbedderDebugScript() const {
|
|
return (flags_ & kIsEmbedderDebugScript) != 0;
|
|
}
|
|
bool IsSharedCrossOrigin() const {
|
|
return (flags_ & kIsSharedCrossOrigin) != 0;
|
|
}
|
|
bool IsOpaque() const { return (flags_ & kIsOpaque) != 0; }
|
|
int Flags() const { return flags_; }
|
|
|
|
private:
|
|
enum {
|
|
kIsEmbedderDebugScript = 1,
|
|
kIsSharedCrossOrigin = 1 << 1,
|
|
kIsOpaque = 1 << 2
|
|
};
|
|
const int flags_;
|
|
};
|
|
|
|
/**
|
|
* The origin, within a file, of a script.
|
|
*/
|
|
class ScriptOrigin {
|
|
public:
|
|
V8_INLINE ScriptOrigin(
|
|
Local<Value> resource_name,
|
|
Local<Integer> resource_line_offset = Local<Integer>(),
|
|
Local<Integer> resource_column_offset = Local<Integer>(),
|
|
Local<Boolean> resource_is_shared_cross_origin = Local<Boolean>(),
|
|
Local<Integer> script_id = Local<Integer>(),
|
|
Local<Boolean> resource_is_embedder_debug_script = Local<Boolean>(),
|
|
Local<Value> source_map_url = Local<Value>(),
|
|
Local<Boolean> resource_is_opaque = Local<Boolean>());
|
|
V8_INLINE Local<Value> ResourceName() const;
|
|
V8_INLINE Local<Integer> ResourceLineOffset() const;
|
|
V8_INLINE Local<Integer> ResourceColumnOffset() const;
|
|
/**
|
|
* Returns true for embedder's debugger scripts
|
|
*/
|
|
V8_INLINE Local<Integer> ScriptID() const;
|
|
V8_INLINE Local<Value> SourceMapUrl() const;
|
|
V8_INLINE ScriptOriginOptions Options() const { return options_; }
|
|
|
|
private:
|
|
Local<Value> resource_name_;
|
|
Local<Integer> resource_line_offset_;
|
|
Local<Integer> resource_column_offset_;
|
|
ScriptOriginOptions options_;
|
|
Local<Integer> script_id_;
|
|
Local<Value> source_map_url_;
|
|
};
|
|
|
|
|
|
/**
|
|
* A compiled JavaScript script, not yet tied to a Context.
|
|
*/
|
|
class V8_EXPORT UnboundScript {
|
|
public:
|
|
/**
|
|
* Binds the script to the currently entered context.
|
|
*/
|
|
Local<Script> BindToCurrentContext();
|
|
|
|
int GetId();
|
|
Local<Value> GetScriptName();
|
|
|
|
/**
|
|
* Data read from magic sourceURL comments.
|
|
*/
|
|
Local<Value> GetSourceURL();
|
|
/**
|
|
* Data read from magic sourceMappingURL comments.
|
|
*/
|
|
Local<Value> GetSourceMappingURL();
|
|
|
|
/**
|
|
* Returns zero based line number of the code_pos location in the script.
|
|
* -1 will be returned if no information available.
|
|
*/
|
|
int GetLineNumber(int code_pos);
|
|
|
|
static const int kNoScriptId = 0;
|
|
};
|
|
|
|
|
|
/**
|
|
* A compiled JavaScript script, tied to a Context which was active when the
|
|
* script was compiled.
|
|
*/
|
|
class V8_EXPORT Script {
|
|
public:
|
|
/**
|
|
* A shorthand for ScriptCompiler::Compile().
|
|
*/
|
|
static V8_DEPRECATE_SOON(
|
|
"Use maybe version",
|
|
Local<Script> Compile(Local<String> source,
|
|
ScriptOrigin* origin = nullptr));
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile(
|
|
Local<Context> context, Local<String> source,
|
|
ScriptOrigin* origin = nullptr);
|
|
|
|
static Local<Script> V8_DEPRECATE_SOON("Use maybe version",
|
|
Compile(Local<String> source,
|
|
Local<String> file_name));
|
|
|
|
/**
|
|
* Runs the script returning the resulting value. It will be run in the
|
|
* context in which it was created (ScriptCompiler::CompileBound or
|
|
* UnboundScript::BindToCurrentContext()).
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version", Local<Value> Run());
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> Run(Local<Context> context);
|
|
|
|
/**
|
|
* Returns the corresponding context-unbound script.
|
|
*/
|
|
Local<UnboundScript> GetUnboundScript();
|
|
|
|
V8_DEPRECATED("Use GetUnboundScript()->GetId()",
|
|
int GetId()) {
|
|
return GetUnboundScript()->GetId();
|
|
}
|
|
};
|
|
|
|
|
|
/**
|
|
* For compiling scripts.
|
|
*/
|
|
class V8_EXPORT ScriptCompiler {
|
|
public:
|
|
/**
|
|
* Compilation data that the embedder can cache and pass back to speed up
|
|
* future compilations. The data is produced if the CompilerOptions passed to
|
|
* the compilation functions in ScriptCompiler contains produce_data_to_cache
|
|
* = true. The data to cache can then can be retrieved from
|
|
* UnboundScript.
|
|
*/
|
|
struct V8_EXPORT CachedData {
|
|
enum BufferPolicy {
|
|
BufferNotOwned,
|
|
BufferOwned
|
|
};
|
|
|
|
CachedData()
|
|
: data(NULL),
|
|
length(0),
|
|
rejected(false),
|
|
buffer_policy(BufferNotOwned) {}
|
|
|
|
// If buffer_policy is BufferNotOwned, the caller keeps the ownership of
|
|
// data and guarantees that it stays alive until the CachedData object is
|
|
// destroyed. If the policy is BufferOwned, the given data will be deleted
|
|
// (with delete[]) when the CachedData object is destroyed.
|
|
CachedData(const uint8_t* data, int length,
|
|
BufferPolicy buffer_policy = BufferNotOwned);
|
|
~CachedData();
|
|
// TODO(marja): Async compilation; add constructors which take a callback
|
|
// which will be called when V8 no longer needs the data.
|
|
const uint8_t* data;
|
|
int length;
|
|
bool rejected;
|
|
BufferPolicy buffer_policy;
|
|
|
|
private:
|
|
// Prevent copying. Not implemented.
|
|
CachedData(const CachedData&);
|
|
CachedData& operator=(const CachedData&);
|
|
};
|
|
|
|
/**
|
|
* Source code which can be then compiled to a UnboundScript or Script.
|
|
*/
|
|
class Source {
|
|
public:
|
|
// Source takes ownership of CachedData.
|
|
V8_INLINE Source(Local<String> source_string, const ScriptOrigin& origin,
|
|
CachedData* cached_data = NULL);
|
|
V8_INLINE Source(Local<String> source_string,
|
|
CachedData* cached_data = NULL);
|
|
V8_INLINE ~Source();
|
|
|
|
// Ownership of the CachedData or its buffers is *not* transferred to the
|
|
// caller. The CachedData object is alive as long as the Source object is
|
|
// alive.
|
|
V8_INLINE const CachedData* GetCachedData() const;
|
|
|
|
private:
|
|
friend class ScriptCompiler;
|
|
// Prevent copying. Not implemented.
|
|
Source(const Source&);
|
|
Source& operator=(const Source&);
|
|
|
|
Local<String> source_string;
|
|
|
|
// Origin information
|
|
Local<Value> resource_name;
|
|
Local<Integer> resource_line_offset;
|
|
Local<Integer> resource_column_offset;
|
|
ScriptOriginOptions resource_options;
|
|
Local<Value> source_map_url;
|
|
|
|
// Cached data from previous compilation (if a kConsume*Cache flag is
|
|
// set), or hold newly generated cache data (kProduce*Cache flags) are
|
|
// set when calling a compile method.
|
|
CachedData* cached_data;
|
|
};
|
|
|
|
/**
|
|
* For streaming incomplete script data to V8. The embedder should implement a
|
|
* subclass of this class.
|
|
*/
|
|
class V8_EXPORT ExternalSourceStream {
|
|
public:
|
|
virtual ~ExternalSourceStream() {}
|
|
|
|
/**
|
|
* V8 calls this to request the next chunk of data from the embedder. This
|
|
* function will be called on a background thread, so it's OK to block and
|
|
* wait for the data, if the embedder doesn't have data yet. Returns the
|
|
* length of the data returned. When the data ends, GetMoreData should
|
|
* return 0. Caller takes ownership of the data.
|
|
*
|
|
* When streaming UTF-8 data, V8 handles multi-byte characters split between
|
|
* two data chunks, but doesn't handle multi-byte characters split between
|
|
* more than two data chunks. The embedder can avoid this problem by always
|
|
* returning at least 2 bytes of data.
|
|
*
|
|
* If the embedder wants to cancel the streaming, they should make the next
|
|
* GetMoreData call return 0. V8 will interpret it as end of data (and most
|
|
* probably, parsing will fail). The streaming task will return as soon as
|
|
* V8 has parsed the data it received so far.
|
|
*/
|
|
virtual size_t GetMoreData(const uint8_t** src) = 0;
|
|
|
|
/**
|
|
* V8 calls this method to set a 'bookmark' at the current position in
|
|
* the source stream, for the purpose of (maybe) later calling
|
|
* ResetToBookmark. If ResetToBookmark is called later, then subsequent
|
|
* calls to GetMoreData should return the same data as they did when
|
|
* SetBookmark was called earlier.
|
|
*
|
|
* The embedder may return 'false' to indicate it cannot provide this
|
|
* functionality.
|
|
*/
|
|
virtual bool SetBookmark();
|
|
|
|
/**
|
|
* V8 calls this to return to a previously set bookmark.
|
|
*/
|
|
virtual void ResetToBookmark();
|
|
};
|
|
|
|
|
|
/**
|
|
* Source code which can be streamed into V8 in pieces. It will be parsed
|
|
* while streaming. It can be compiled after the streaming is complete.
|
|
* StreamedSource must be kept alive while the streaming task is ran (see
|
|
* ScriptStreamingTask below).
|
|
*/
|
|
class V8_EXPORT StreamedSource {
|
|
public:
|
|
enum Encoding { ONE_BYTE, TWO_BYTE, UTF8 };
|
|
|
|
StreamedSource(ExternalSourceStream* source_stream, Encoding encoding);
|
|
~StreamedSource();
|
|
|
|
// Ownership of the CachedData or its buffers is *not* transferred to the
|
|
// caller. The CachedData object is alive as long as the StreamedSource
|
|
// object is alive.
|
|
const CachedData* GetCachedData() const;
|
|
|
|
internal::StreamedSource* impl() const { return impl_; }
|
|
|
|
private:
|
|
// Prevent copying. Not implemented.
|
|
StreamedSource(const StreamedSource&);
|
|
StreamedSource& operator=(const StreamedSource&);
|
|
|
|
internal::StreamedSource* impl_;
|
|
};
|
|
|
|
/**
|
|
* A streaming task which the embedder must run on a background thread to
|
|
* stream scripts into V8. Returned by ScriptCompiler::StartStreamingScript.
|
|
*/
|
|
class ScriptStreamingTask {
|
|
public:
|
|
virtual ~ScriptStreamingTask() {}
|
|
virtual void Run() = 0;
|
|
};
|
|
|
|
enum CompileOptions {
|
|
kNoCompileOptions = 0,
|
|
kProduceParserCache,
|
|
kConsumeParserCache,
|
|
kProduceCodeCache,
|
|
kConsumeCodeCache
|
|
};
|
|
|
|
/**
|
|
* Compiles the specified script (context-independent).
|
|
* Cached data as part of the source object can be optionally produced to be
|
|
* consumed later to speed up compilation of identical source scripts.
|
|
*
|
|
* Note that when producing cached data, the source must point to NULL for
|
|
* cached data. When consuming cached data, the cached data must have been
|
|
* produced by the same version of V8.
|
|
*
|
|
* \param source Script source code.
|
|
* \return Compiled script object (context independent; for running it must be
|
|
* bound to a context).
|
|
*/
|
|
static V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<UnboundScript> CompileUnbound(
|
|
Isolate* isolate, Source* source,
|
|
CompileOptions options = kNoCompileOptions));
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<UnboundScript> CompileUnboundScript(
|
|
Isolate* isolate, Source* source,
|
|
CompileOptions options = kNoCompileOptions);
|
|
|
|
/**
|
|
* Compiles the specified script (bound to current context).
|
|
*
|
|
* \param source Script source code.
|
|
* \param pre_data Pre-parsing data, as obtained by ScriptData::PreCompile()
|
|
* using pre_data speeds compilation if it's done multiple times.
|
|
* Owned by caller, no references are kept when this function returns.
|
|
* \return Compiled script object, bound to the context that was active
|
|
* when this function was called. When run it will always use this
|
|
* context.
|
|
*/
|
|
static V8_DEPRECATE_SOON(
|
|
"Use maybe version",
|
|
Local<Script> Compile(Isolate* isolate, Source* source,
|
|
CompileOptions options = kNoCompileOptions));
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile(
|
|
Local<Context> context, Source* source,
|
|
CompileOptions options = kNoCompileOptions);
|
|
|
|
/**
|
|
* Returns a task which streams script data into V8, or NULL if the script
|
|
* cannot be streamed. The user is responsible for running the task on a
|
|
* background thread and deleting it. When ran, the task starts parsing the
|
|
* script, and it will request data from the StreamedSource as needed. When
|
|
* ScriptStreamingTask::Run exits, all data has been streamed and the script
|
|
* can be compiled (see Compile below).
|
|
*
|
|
* This API allows to start the streaming with as little data as possible, and
|
|
* the remaining data (for example, the ScriptOrigin) is passed to Compile.
|
|
*/
|
|
static ScriptStreamingTask* StartStreamingScript(
|
|
Isolate* isolate, StreamedSource* source,
|
|
CompileOptions options = kNoCompileOptions);
|
|
|
|
/**
|
|
* Compiles a streamed script (bound to current context).
|
|
*
|
|
* This can only be called after the streaming has finished
|
|
* (ScriptStreamingTask has been run). V8 doesn't construct the source string
|
|
* during streaming, so the embedder needs to pass the full source here.
|
|
*/
|
|
static V8_DEPRECATE_SOON(
|
|
"Use maybe version",
|
|
Local<Script> Compile(Isolate* isolate, StreamedSource* source,
|
|
Local<String> full_source_string,
|
|
const ScriptOrigin& origin));
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile(
|
|
Local<Context> context, StreamedSource* source,
|
|
Local<String> full_source_string, const ScriptOrigin& origin);
|
|
|
|
/**
|
|
* Return a version tag for CachedData for the current V8 version & flags.
|
|
*
|
|
* This value is meant only for determining whether a previously generated
|
|
* CachedData instance is still valid; the tag has no other meaing.
|
|
*
|
|
* Background: The data carried by CachedData may depend on the exact
|
|
* V8 version number or currently compiler flags. This means when
|
|
* persisting CachedData, the embedder must take care to not pass in
|
|
* data from another V8 version, or the same version with different
|
|
* features enabled.
|
|
*
|
|
* The easiest way to do so is to clear the embedder's cache on any
|
|
* such change.
|
|
*
|
|
* Alternatively, this tag can be stored alongside the cached data and
|
|
* compared when it is being used.
|
|
*/
|
|
static uint32_t CachedDataVersionTag();
|
|
|
|
/**
|
|
* Compile an ES6 module.
|
|
*
|
|
* This is an experimental feature.
|
|
*
|
|
* TODO(adamk): Script is likely the wrong return value for this;
|
|
* should return some new Module type.
|
|
*/
|
|
static V8_DEPRECATE_SOON(
|
|
"Use maybe version",
|
|
Local<Script> CompileModule(Isolate* isolate, Source* source,
|
|
CompileOptions options = kNoCompileOptions));
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<Script> CompileModule(
|
|
Local<Context> context, Source* source,
|
|
CompileOptions options = kNoCompileOptions);
|
|
|
|
/**
|
|
* Compile a function for a given context. This is equivalent to running
|
|
*
|
|
* with (obj) {
|
|
* return function(args) { ... }
|
|
* }
|
|
*
|
|
* It is possible to specify multiple context extensions (obj in the above
|
|
* example).
|
|
*/
|
|
static V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Function> CompileFunctionInContext(
|
|
Isolate* isolate, Source* source,
|
|
Local<Context> context, size_t arguments_count,
|
|
Local<String> arguments[],
|
|
size_t context_extension_count,
|
|
Local<Object> context_extensions[]));
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<Function> CompileFunctionInContext(
|
|
Local<Context> context, Source* source, size_t arguments_count,
|
|
Local<String> arguments[], size_t context_extension_count,
|
|
Local<Object> context_extensions[]);
|
|
|
|
private:
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<UnboundScript> CompileUnboundInternal(
|
|
Isolate* isolate, Source* source, CompileOptions options, bool is_module);
|
|
};
|
|
|
|
|
|
/**
|
|
* An error message.
|
|
*/
|
|
class V8_EXPORT Message {
|
|
public:
|
|
Local<String> Get() const;
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version", Local<String> GetSourceLine() const);
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<String> GetSourceLine(
|
|
Local<Context> context) const;
|
|
|
|
/**
|
|
* Returns the origin for the script from where the function causing the
|
|
* error originates.
|
|
*/
|
|
ScriptOrigin GetScriptOrigin() const;
|
|
|
|
/**
|
|
* Returns the resource name for the script from where the function causing
|
|
* the error originates.
|
|
*/
|
|
Local<Value> GetScriptResourceName() const;
|
|
|
|
/**
|
|
* Exception stack trace. By default stack traces are not captured for
|
|
* uncaught exceptions. SetCaptureStackTraceForUncaughtExceptions allows
|
|
* to change this option.
|
|
*/
|
|
Local<StackTrace> GetStackTrace() const;
|
|
|
|
/**
|
|
* Returns the number, 1-based, of the line where the error occurred.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version", int GetLineNumber() const);
|
|
V8_WARN_UNUSED_RESULT Maybe<int> GetLineNumber(Local<Context> context) const;
|
|
|
|
/**
|
|
* Returns the index within the script of the first character where
|
|
* the error occurred.
|
|
*/
|
|
int GetStartPosition() const;
|
|
|
|
/**
|
|
* Returns the index within the script of the last character where
|
|
* the error occurred.
|
|
*/
|
|
int GetEndPosition() const;
|
|
|
|
/**
|
|
* Returns the index within the line of the first character where
|
|
* the error occurred.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version", int GetStartColumn() const);
|
|
V8_WARN_UNUSED_RESULT Maybe<int> GetStartColumn(Local<Context> context) const;
|
|
|
|
/**
|
|
* Returns the index within the line of the last character where
|
|
* the error occurred.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version", int GetEndColumn() const);
|
|
V8_WARN_UNUSED_RESULT Maybe<int> GetEndColumn(Local<Context> context) const;
|
|
|
|
/**
|
|
* Passes on the value set by the embedder when it fed the script from which
|
|
* this Message was generated to V8.
|
|
*/
|
|
bool IsSharedCrossOrigin() const;
|
|
bool IsOpaque() const;
|
|
|
|
// TODO(1245381): Print to a string instead of on a FILE.
|
|
static void PrintCurrentStackTrace(Isolate* isolate, FILE* out);
|
|
|
|
static const int kNoLineNumberInfo = 0;
|
|
static const int kNoColumnInfo = 0;
|
|
static const int kNoScriptIdInfo = 0;
|
|
};
|
|
|
|
|
|
/**
|
|
* Representation of a JavaScript stack trace. The information collected is a
|
|
* snapshot of the execution stack and the information remains valid after
|
|
* execution continues.
|
|
*/
|
|
class V8_EXPORT StackTrace {
|
|
public:
|
|
/**
|
|
* Flags that determine what information is placed captured for each
|
|
* StackFrame when grabbing the current stack trace.
|
|
*/
|
|
enum StackTraceOptions {
|
|
kLineNumber = 1,
|
|
kColumnOffset = 1 << 1 | kLineNumber,
|
|
kScriptName = 1 << 2,
|
|
kFunctionName = 1 << 3,
|
|
kIsEval = 1 << 4,
|
|
kIsConstructor = 1 << 5,
|
|
kScriptNameOrSourceURL = 1 << 6,
|
|
kScriptId = 1 << 7,
|
|
kExposeFramesAcrossSecurityOrigins = 1 << 8,
|
|
kOverview = kLineNumber | kColumnOffset | kScriptName | kFunctionName,
|
|
kDetailed = kOverview | kIsEval | kIsConstructor | kScriptNameOrSourceURL
|
|
};
|
|
|
|
/**
|
|
* Returns a StackFrame at a particular index.
|
|
*/
|
|
Local<StackFrame> GetFrame(uint32_t index) const;
|
|
|
|
/**
|
|
* Returns the number of StackFrames.
|
|
*/
|
|
int GetFrameCount() const;
|
|
|
|
/**
|
|
* Returns StackTrace as a v8::Array that contains StackFrame objects.
|
|
*/
|
|
Local<Array> AsArray();
|
|
|
|
/**
|
|
* Grab a snapshot of the current JavaScript execution stack.
|
|
*
|
|
* \param frame_limit The maximum number of stack frames we want to capture.
|
|
* \param options Enumerates the set of things we will capture for each
|
|
* StackFrame.
|
|
*/
|
|
static Local<StackTrace> CurrentStackTrace(
|
|
Isolate* isolate,
|
|
int frame_limit,
|
|
StackTraceOptions options = kOverview);
|
|
};
|
|
|
|
|
|
/**
|
|
* A single JavaScript stack frame.
|
|
*/
|
|
class V8_EXPORT StackFrame {
|
|
public:
|
|
/**
|
|
* Returns the number, 1-based, of the line for the associate function call.
|
|
* This method will return Message::kNoLineNumberInfo if it is unable to
|
|
* retrieve the line number, or if kLineNumber was not passed as an option
|
|
* when capturing the StackTrace.
|
|
*/
|
|
int GetLineNumber() const;
|
|
|
|
/**
|
|
* Returns the 1-based column offset on the line for the associated function
|
|
* call.
|
|
* This method will return Message::kNoColumnInfo if it is unable to retrieve
|
|
* the column number, or if kColumnOffset was not passed as an option when
|
|
* capturing the StackTrace.
|
|
*/
|
|
int GetColumn() const;
|
|
|
|
/**
|
|
* Returns the id of the script for the function for this StackFrame.
|
|
* This method will return Message::kNoScriptIdInfo if it is unable to
|
|
* retrieve the script id, or if kScriptId was not passed as an option when
|
|
* capturing the StackTrace.
|
|
*/
|
|
int GetScriptId() const;
|
|
|
|
/**
|
|
* Returns the name of the resource that contains the script for the
|
|
* function for this StackFrame.
|
|
*/
|
|
Local<String> GetScriptName() const;
|
|
|
|
/**
|
|
* Returns the name of the resource that contains the script for the
|
|
* function for this StackFrame or sourceURL value if the script name
|
|
* is undefined and its source ends with //# sourceURL=... string or
|
|
* deprecated //@ sourceURL=... string.
|
|
*/
|
|
Local<String> GetScriptNameOrSourceURL() const;
|
|
|
|
/**
|
|
* Returns the name of the function associated with this stack frame.
|
|
*/
|
|
Local<String> GetFunctionName() const;
|
|
|
|
/**
|
|
* Returns whether or not the associated function is compiled via a call to
|
|
* eval().
|
|
*/
|
|
bool IsEval() const;
|
|
|
|
/**
|
|
* Returns whether or not the associated function is called as a
|
|
* constructor via "new".
|
|
*/
|
|
bool IsConstructor() const;
|
|
};
|
|
|
|
|
|
// A StateTag represents a possible state of the VM.
|
|
enum StateTag { JS, GC, COMPILER, OTHER, EXTERNAL, IDLE };
|
|
|
|
|
|
// A RegisterState represents the current state of registers used
|
|
// by the sampling profiler API.
|
|
struct RegisterState {
|
|
RegisterState() : pc(NULL), sp(NULL), fp(NULL) {}
|
|
void* pc; // Instruction pointer.
|
|
void* sp; // Stack pointer.
|
|
void* fp; // Frame pointer.
|
|
};
|
|
|
|
|
|
// The output structure filled up by GetStackSample API function.
|
|
struct SampleInfo {
|
|
size_t frames_count;
|
|
StateTag vm_state;
|
|
};
|
|
|
|
|
|
/**
|
|
* A JSON Parser.
|
|
*/
|
|
class V8_EXPORT JSON {
|
|
public:
|
|
/**
|
|
* Tries to parse the string |json_string| and returns it as value if
|
|
* successful.
|
|
*
|
|
* \param json_string The string to parse.
|
|
* \return The corresponding value if successfully parsed.
|
|
*/
|
|
static V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Value> Parse(Local<String> json_string));
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<Value> Parse(
|
|
Isolate* isolate, Local<String> json_string);
|
|
};
|
|
|
|
|
|
/**
|
|
* A map whose keys are referenced weakly. It is similar to JavaScript WeakMap
|
|
* but can be created without entering a v8::Context and hence shouldn't
|
|
* escape to JavaScript.
|
|
*/
|
|
class V8_EXPORT NativeWeakMap : public Data {
|
|
public:
|
|
static Local<NativeWeakMap> New(Isolate* isolate);
|
|
void Set(Local<Value> key, Local<Value> value);
|
|
Local<Value> Get(Local<Value> key);
|
|
bool Has(Local<Value> key);
|
|
bool Delete(Local<Value> key);
|
|
};
|
|
|
|
|
|
// --- Value ---
|
|
|
|
|
|
/**
|
|
* The superclass of all JavaScript values and objects.
|
|
*/
|
|
class V8_EXPORT Value : public Data {
|
|
public:
|
|
/**
|
|
* Returns true if this value is the undefined value. See ECMA-262
|
|
* 4.3.10.
|
|
*/
|
|
V8_INLINE bool IsUndefined() const;
|
|
|
|
/**
|
|
* Returns true if this value is the null value. See ECMA-262
|
|
* 4.3.11.
|
|
*/
|
|
V8_INLINE bool IsNull() const;
|
|
|
|
/**
|
|
* Returns true if this value is true.
|
|
*/
|
|
bool IsTrue() const;
|
|
|
|
/**
|
|
* Returns true if this value is false.
|
|
*/
|
|
bool IsFalse() const;
|
|
|
|
/**
|
|
* Returns true if this value is a symbol or a string.
|
|
* This is an experimental feature.
|
|
*/
|
|
bool IsName() const;
|
|
|
|
/**
|
|
* Returns true if this value is an instance of the String type.
|
|
* See ECMA-262 8.4.
|
|
*/
|
|
V8_INLINE bool IsString() const;
|
|
|
|
/**
|
|
* Returns true if this value is a symbol.
|
|
* This is an experimental feature.
|
|
*/
|
|
bool IsSymbol() const;
|
|
|
|
/**
|
|
* Returns true if this value is a function.
|
|
*/
|
|
bool IsFunction() const;
|
|
|
|
/**
|
|
* Returns true if this value is an array.
|
|
*/
|
|
bool IsArray() const;
|
|
|
|
/**
|
|
* Returns true if this value is an object.
|
|
*/
|
|
bool IsObject() const;
|
|
|
|
/**
|
|
* Returns true if this value is boolean.
|
|
*/
|
|
bool IsBoolean() const;
|
|
|
|
/**
|
|
* Returns true if this value is a number.
|
|
*/
|
|
bool IsNumber() const;
|
|
|
|
/**
|
|
* Returns true if this value is external.
|
|
*/
|
|
bool IsExternal() const;
|
|
|
|
/**
|
|
* Returns true if this value is a 32-bit signed integer.
|
|
*/
|
|
bool IsInt32() const;
|
|
|
|
/**
|
|
* Returns true if this value is a 32-bit unsigned integer.
|
|
*/
|
|
bool IsUint32() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Date.
|
|
*/
|
|
bool IsDate() const;
|
|
|
|
/**
|
|
* Returns true if this value is an Arguments object.
|
|
*/
|
|
bool IsArgumentsObject() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Boolean object.
|
|
*/
|
|
bool IsBooleanObject() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Number object.
|
|
*/
|
|
bool IsNumberObject() const;
|
|
|
|
/**
|
|
* Returns true if this value is a String object.
|
|
*/
|
|
bool IsStringObject() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Symbol object.
|
|
* This is an experimental feature.
|
|
*/
|
|
bool IsSymbolObject() const;
|
|
|
|
/**
|
|
* Returns true if this value is a NativeError.
|
|
*/
|
|
bool IsNativeError() const;
|
|
|
|
/**
|
|
* Returns true if this value is a RegExp.
|
|
*/
|
|
bool IsRegExp() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Generator function.
|
|
* This is an experimental feature.
|
|
*/
|
|
bool IsGeneratorFunction() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Generator object (iterator).
|
|
* This is an experimental feature.
|
|
*/
|
|
bool IsGeneratorObject() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Promise.
|
|
* This is an experimental feature.
|
|
*/
|
|
bool IsPromise() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Map.
|
|
*/
|
|
bool IsMap() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Set.
|
|
*/
|
|
bool IsSet() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Map Iterator.
|
|
*/
|
|
bool IsMapIterator() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Set Iterator.
|
|
*/
|
|
bool IsSetIterator() const;
|
|
|
|
/**
|
|
* Returns true if this value is a WeakMap.
|
|
*/
|
|
bool IsWeakMap() const;
|
|
|
|
/**
|
|
* Returns true if this value is a WeakSet.
|
|
*/
|
|
bool IsWeakSet() const;
|
|
|
|
/**
|
|
* Returns true if this value is an ArrayBuffer.
|
|
* This is an experimental feature.
|
|
*/
|
|
bool IsArrayBuffer() const;
|
|
|
|
/**
|
|
* Returns true if this value is an ArrayBufferView.
|
|
* This is an experimental feature.
|
|
*/
|
|
bool IsArrayBufferView() const;
|
|
|
|
/**
|
|
* Returns true if this value is one of TypedArrays.
|
|
* This is an experimental feature.
|
|
*/
|
|
bool IsTypedArray() const;
|
|
|
|
/**
|
|
* Returns true if this value is an Uint8Array.
|
|
* This is an experimental feature.
|
|
*/
|
|
bool IsUint8Array() const;
|
|
|
|
/**
|
|
* Returns true if this value is an Uint8ClampedArray.
|
|
* This is an experimental feature.
|
|
*/
|
|
bool IsUint8ClampedArray() const;
|
|
|
|
/**
|
|
* Returns true if this value is an Int8Array.
|
|
* This is an experimental feature.
|
|
*/
|
|
bool IsInt8Array() const;
|
|
|
|
/**
|
|
* Returns true if this value is an Uint16Array.
|
|
* This is an experimental feature.
|
|
*/
|
|
bool IsUint16Array() const;
|
|
|
|
/**
|
|
* Returns true if this value is an Int16Array.
|
|
* This is an experimental feature.
|
|
*/
|
|
bool IsInt16Array() const;
|
|
|
|
/**
|
|
* Returns true if this value is an Uint32Array.
|
|
* This is an experimental feature.
|
|
*/
|
|
bool IsUint32Array() const;
|
|
|
|
/**
|
|
* Returns true if this value is an Int32Array.
|
|
* This is an experimental feature.
|
|
*/
|
|
bool IsInt32Array() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Float32Array.
|
|
* This is an experimental feature.
|
|
*/
|
|
bool IsFloat32Array() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Float64Array.
|
|
* This is an experimental feature.
|
|
*/
|
|
bool IsFloat64Array() const;
|
|
|
|
/**
|
|
* Returns true if this value is a SIMD Float32x4.
|
|
* This is an experimental feature.
|
|
*/
|
|
bool IsFloat32x4() const;
|
|
|
|
/**
|
|
* Returns true if this value is a DataView.
|
|
* This is an experimental feature.
|
|
*/
|
|
bool IsDataView() const;
|
|
|
|
/**
|
|
* Returns true if this value is a SharedArrayBuffer.
|
|
* This is an experimental feature.
|
|
*/
|
|
bool IsSharedArrayBuffer() const;
|
|
|
|
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Boolean> ToBoolean(
|
|
Local<Context> context) const;
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Number> ToNumber(
|
|
Local<Context> context) const;
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<String> ToString(
|
|
Local<Context> context) const;
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<String> ToDetailString(
|
|
Local<Context> context) const;
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Object> ToObject(
|
|
Local<Context> context) const;
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Integer> ToInteger(
|
|
Local<Context> context) const;
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Uint32> ToUint32(
|
|
Local<Context> context) const;
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Int32> ToInt32(Local<Context> context) const;
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Boolean> ToBoolean(Isolate* isolate) const);
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Number> ToNumber(Isolate* isolate) const);
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<String> ToString(Isolate* isolate) const);
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<String> ToDetailString(Isolate* isolate) const);
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Object> ToObject(Isolate* isolate) const);
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Integer> ToInteger(Isolate* isolate) const);
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Uint32> ToUint32(Isolate* isolate) const);
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Int32> ToInt32(Isolate* isolate) const);
|
|
|
|
inline V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Boolean> ToBoolean() const);
|
|
inline V8_DEPRECATE_SOON("Use maybe version", Local<Number> ToNumber() const);
|
|
inline V8_DEPRECATE_SOON("Use maybe version", Local<String> ToString() const);
|
|
inline V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<String> ToDetailString() const);
|
|
inline V8_DEPRECATE_SOON("Use maybe version", Local<Object> ToObject() const);
|
|
inline V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Integer> ToInteger() const);
|
|
inline V8_DEPRECATE_SOON("Use maybe version", Local<Uint32> ToUint32() const);
|
|
inline V8_DEPRECATE_SOON("Use maybe version", Local<Int32> ToInt32() const);
|
|
|
|
/**
|
|
* Attempts to convert a string to an array index.
|
|
* Returns an empty handle if the conversion fails.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version", Local<Uint32> ToArrayIndex() const);
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Uint32> ToArrayIndex(
|
|
Local<Context> context) const;
|
|
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> BooleanValue(Local<Context> context) const;
|
|
V8_WARN_UNUSED_RESULT Maybe<double> NumberValue(Local<Context> context) const;
|
|
V8_WARN_UNUSED_RESULT Maybe<int64_t> IntegerValue(
|
|
Local<Context> context) const;
|
|
V8_WARN_UNUSED_RESULT Maybe<uint32_t> Uint32Value(
|
|
Local<Context> context) const;
|
|
V8_WARN_UNUSED_RESULT Maybe<int32_t> Int32Value(Local<Context> context) const;
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version", bool BooleanValue() const);
|
|
V8_DEPRECATE_SOON("Use maybe version", double NumberValue() const);
|
|
V8_DEPRECATE_SOON("Use maybe version", int64_t IntegerValue() const);
|
|
V8_DEPRECATE_SOON("Use maybe version", uint32_t Uint32Value() const);
|
|
V8_DEPRECATE_SOON("Use maybe version", int32_t Int32Value() const);
|
|
|
|
/** JS == */
|
|
V8_DEPRECATE_SOON("Use maybe version", bool Equals(Local<Value> that) const);
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> Equals(Local<Context> context,
|
|
Local<Value> that) const;
|
|
bool StrictEquals(Local<Value> that) const;
|
|
bool SameValue(Local<Value> that) const;
|
|
|
|
template <class T> V8_INLINE static Value* Cast(T* value);
|
|
|
|
private:
|
|
V8_INLINE bool QuickIsUndefined() const;
|
|
V8_INLINE bool QuickIsNull() const;
|
|
V8_INLINE bool QuickIsString() const;
|
|
bool FullIsUndefined() const;
|
|
bool FullIsNull() const;
|
|
bool FullIsString() const;
|
|
};
|
|
|
|
|
|
/**
|
|
* The superclass of primitive values. See ECMA-262 4.3.2.
|
|
*/
|
|
class V8_EXPORT Primitive : public Value { };
|
|
|
|
|
|
/**
|
|
* A primitive boolean value (ECMA-262, 4.3.14). Either the true
|
|
* or false value.
|
|
*/
|
|
class V8_EXPORT Boolean : public Primitive {
|
|
public:
|
|
bool Value() const;
|
|
V8_INLINE static Boolean* Cast(v8::Value* obj);
|
|
V8_INLINE static Local<Boolean> New(Isolate* isolate, bool value);
|
|
|
|
private:
|
|
static void CheckCast(v8::Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A superclass for symbols and strings.
|
|
*/
|
|
class V8_EXPORT Name : public Primitive {
|
|
public:
|
|
/**
|
|
* Returns the identity hash for this object. The current implementation
|
|
* uses an inline property on the object to store the identity hash.
|
|
*
|
|
* The return value will never be 0. Also, it is not guaranteed to be
|
|
* unique.
|
|
*/
|
|
int GetIdentityHash();
|
|
|
|
V8_INLINE static Name* Cast(v8::Value* obj);
|
|
private:
|
|
static void CheckCast(v8::Value* obj);
|
|
};
|
|
|
|
|
|
enum class NewStringType { kNormal, kInternalized };
|
|
|
|
|
|
/**
|
|
* A JavaScript string value (ECMA-262, 4.3.17).
|
|
*/
|
|
class V8_EXPORT String : public Name {
|
|
public:
|
|
static const int kMaxLength = (1 << 28) - 16;
|
|
|
|
enum Encoding {
|
|
UNKNOWN_ENCODING = 0x1,
|
|
TWO_BYTE_ENCODING = 0x0,
|
|
ONE_BYTE_ENCODING = 0x4
|
|
};
|
|
/**
|
|
* Returns the number of characters in this string.
|
|
*/
|
|
int Length() const;
|
|
|
|
/**
|
|
* Returns the number of bytes in the UTF-8 encoded
|
|
* representation of this string.
|
|
*/
|
|
int Utf8Length() const;
|
|
|
|
/**
|
|
* Returns whether this string is known to contain only one byte data.
|
|
* Does not read the string.
|
|
* False negatives are possible.
|
|
*/
|
|
bool IsOneByte() const;
|
|
|
|
/**
|
|
* Returns whether this string contain only one byte data.
|
|
* Will read the entire string in some cases.
|
|
*/
|
|
bool ContainsOnlyOneByte() const;
|
|
|
|
/**
|
|
* Write the contents of the string to an external buffer.
|
|
* If no arguments are given, expects the buffer to be large
|
|
* enough to hold the entire string and NULL terminator. Copies
|
|
* the contents of the string and the NULL terminator into the
|
|
* buffer.
|
|
*
|
|
* WriteUtf8 will not write partial UTF-8 sequences, preferring to stop
|
|
* before the end of the buffer.
|
|
*
|
|
* Copies up to length characters into the output buffer.
|
|
* Only null-terminates if there is enough space in the buffer.
|
|
*
|
|
* \param buffer The buffer into which the string will be copied.
|
|
* \param start The starting position within the string at which
|
|
* copying begins.
|
|
* \param length The number of characters to copy from the string. For
|
|
* WriteUtf8 the number of bytes in the buffer.
|
|
* \param nchars_ref The number of characters written, can be NULL.
|
|
* \param options Various options that might affect performance of this or
|
|
* subsequent operations.
|
|
* \return The number of characters copied to the buffer excluding the null
|
|
* terminator. For WriteUtf8: The number of bytes copied to the buffer
|
|
* including the null terminator (if written).
|
|
*/
|
|
enum WriteOptions {
|
|
NO_OPTIONS = 0,
|
|
HINT_MANY_WRITES_EXPECTED = 1,
|
|
NO_NULL_TERMINATION = 2,
|
|
PRESERVE_ONE_BYTE_NULL = 4,
|
|
// Used by WriteUtf8 to replace orphan surrogate code units with the
|
|
// unicode replacement character. Needs to be set to guarantee valid UTF-8
|
|
// output.
|
|
REPLACE_INVALID_UTF8 = 8
|
|
};
|
|
|
|
// 16-bit character codes.
|
|
int Write(uint16_t* buffer,
|
|
int start = 0,
|
|
int length = -1,
|
|
int options = NO_OPTIONS) const;
|
|
// One byte characters.
|
|
int WriteOneByte(uint8_t* buffer,
|
|
int start = 0,
|
|
int length = -1,
|
|
int options = NO_OPTIONS) const;
|
|
// UTF-8 encoded characters.
|
|
int WriteUtf8(char* buffer,
|
|
int length = -1,
|
|
int* nchars_ref = NULL,
|
|
int options = NO_OPTIONS) const;
|
|
|
|
/**
|
|
* A zero length string.
|
|
*/
|
|
V8_INLINE static v8::Local<v8::String> Empty(Isolate* isolate);
|
|
|
|
/**
|
|
* Returns true if the string is external
|
|
*/
|
|
bool IsExternal() const;
|
|
|
|
/**
|
|
* Returns true if the string is both external and one-byte.
|
|
*/
|
|
bool IsExternalOneByte() const;
|
|
|
|
class V8_EXPORT ExternalStringResourceBase { // NOLINT
|
|
public:
|
|
virtual ~ExternalStringResourceBase() {}
|
|
|
|
protected:
|
|
ExternalStringResourceBase() {}
|
|
|
|
/**
|
|
* Internally V8 will call this Dispose method when the external string
|
|
* resource is no longer needed. The default implementation will use the
|
|
* delete operator. This method can be overridden in subclasses to
|
|
* control how allocated external string resources are disposed.
|
|
*/
|
|
virtual void Dispose() { delete this; }
|
|
|
|
private:
|
|
// Disallow copying and assigning.
|
|
ExternalStringResourceBase(const ExternalStringResourceBase&);
|
|
void operator=(const ExternalStringResourceBase&);
|
|
|
|
friend class v8::internal::Heap;
|
|
};
|
|
|
|
/**
|
|
* An ExternalStringResource is a wrapper around a two-byte string
|
|
* buffer that resides outside V8's heap. Implement an
|
|
* ExternalStringResource to manage the life cycle of the underlying
|
|
* buffer. Note that the string data must be immutable.
|
|
*/
|
|
class V8_EXPORT ExternalStringResource
|
|
: public ExternalStringResourceBase {
|
|
public:
|
|
/**
|
|
* Override the destructor to manage the life cycle of the underlying
|
|
* buffer.
|
|
*/
|
|
virtual ~ExternalStringResource() {}
|
|
|
|
/**
|
|
* The string data from the underlying buffer.
|
|
*/
|
|
virtual const uint16_t* data() const = 0;
|
|
|
|
/**
|
|
* The length of the string. That is, the number of two-byte characters.
|
|
*/
|
|
virtual size_t length() const = 0;
|
|
|
|
protected:
|
|
ExternalStringResource() {}
|
|
};
|
|
|
|
/**
|
|
* An ExternalOneByteStringResource is a wrapper around an one-byte
|
|
* string buffer that resides outside V8's heap. Implement an
|
|
* ExternalOneByteStringResource to manage the life cycle of the
|
|
* underlying buffer. Note that the string data must be immutable
|
|
* and that the data must be Latin-1 and not UTF-8, which would require
|
|
* special treatment internally in the engine and do not allow efficient
|
|
* indexing. Use String::New or convert to 16 bit data for non-Latin1.
|
|
*/
|
|
|
|
class V8_EXPORT ExternalOneByteStringResource
|
|
: public ExternalStringResourceBase {
|
|
public:
|
|
/**
|
|
* Override the destructor to manage the life cycle of the underlying
|
|
* buffer.
|
|
*/
|
|
virtual ~ExternalOneByteStringResource() {}
|
|
/** The string data from the underlying buffer.*/
|
|
virtual const char* data() const = 0;
|
|
/** The number of Latin-1 characters in the string.*/
|
|
virtual size_t length() const = 0;
|
|
protected:
|
|
ExternalOneByteStringResource() {}
|
|
};
|
|
|
|
/**
|
|
* If the string is an external string, return the ExternalStringResourceBase
|
|
* regardless of the encoding, otherwise return NULL. The encoding of the
|
|
* string is returned in encoding_out.
|
|
*/
|
|
V8_INLINE ExternalStringResourceBase* GetExternalStringResourceBase(
|
|
Encoding* encoding_out) const;
|
|
|
|
/**
|
|
* Get the ExternalStringResource for an external string. Returns
|
|
* NULL if IsExternal() doesn't return true.
|
|
*/
|
|
V8_INLINE ExternalStringResource* GetExternalStringResource() const;
|
|
|
|
/**
|
|
* Get the ExternalOneByteStringResource for an external one-byte string.
|
|
* Returns NULL if IsExternalOneByte() doesn't return true.
|
|
*/
|
|
const ExternalOneByteStringResource* GetExternalOneByteStringResource() const;
|
|
|
|
V8_INLINE static String* Cast(v8::Value* obj);
|
|
|
|
// TODO(dcarney): remove with deprecation of New functions.
|
|
enum NewStringType {
|
|
kNormalString = static_cast<int>(v8::NewStringType::kNormal),
|
|
kInternalizedString = static_cast<int>(v8::NewStringType::kInternalized)
|
|
};
|
|
|
|
/** Allocates a new string from UTF-8 data.*/
|
|
static V8_DEPRECATE_SOON(
|
|
"Use maybe version",
|
|
Local<String> NewFromUtf8(Isolate* isolate, const char* data,
|
|
NewStringType type = kNormalString,
|
|
int length = -1));
|
|
|
|
/** Allocates a new string from UTF-8 data. Only returns an empty value when
|
|
* length > kMaxLength. **/
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewFromUtf8(
|
|
Isolate* isolate, const char* data, v8::NewStringType type,
|
|
int length = -1);
|
|
|
|
/** Allocates a new string from Latin-1 data.*/
|
|
static V8_DEPRECATE_SOON(
|
|
"Use maybe version",
|
|
Local<String> NewFromOneByte(Isolate* isolate, const uint8_t* data,
|
|
NewStringType type = kNormalString,
|
|
int length = -1));
|
|
|
|
/** Allocates a new string from Latin-1 data. Only returns an empty value
|
|
* when length > kMaxLength. **/
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewFromOneByte(
|
|
Isolate* isolate, const uint8_t* data, v8::NewStringType type,
|
|
int length = -1);
|
|
|
|
/** Allocates a new string from UTF-16 data.*/
|
|
static V8_DEPRECATE_SOON(
|
|
"Use maybe version",
|
|
Local<String> NewFromTwoByte(Isolate* isolate, const uint16_t* data,
|
|
NewStringType type = kNormalString,
|
|
int length = -1));
|
|
|
|
/** Allocates a new string from UTF-16 data. Only returns an empty value when
|
|
* length > kMaxLength. **/
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewFromTwoByte(
|
|
Isolate* isolate, const uint16_t* data, v8::NewStringType type,
|
|
int length = -1);
|
|
|
|
/**
|
|
* Creates a new string by concatenating the left and the right strings
|
|
* passed in as parameters.
|
|
*/
|
|
static Local<String> Concat(Local<String> left, Local<String> right);
|
|
|
|
/**
|
|
* Creates a new external string using the data defined in the given
|
|
* resource. When the external string is no longer live on V8's heap the
|
|
* resource will be disposed by calling its Dispose method. The caller of
|
|
* this function should not otherwise delete or modify the resource. Neither
|
|
* should the underlying buffer be deallocated or modified except through the
|
|
* destructor of the external string resource.
|
|
*/
|
|
static V8_DEPRECATE_SOON(
|
|
"Use maybe version",
|
|
Local<String> NewExternal(Isolate* isolate,
|
|
ExternalStringResource* resource));
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewExternalTwoByte(
|
|
Isolate* isolate, ExternalStringResource* resource);
|
|
|
|
/**
|
|
* Associate an external string resource with this string by transforming it
|
|
* in place so that existing references to this string in the JavaScript heap
|
|
* will use the external string resource. The external string resource's
|
|
* character contents need to be equivalent to this string.
|
|
* Returns true if the string has been changed to be an external string.
|
|
* The string is not modified if the operation fails. See NewExternal for
|
|
* information on the lifetime of the resource.
|
|
*/
|
|
bool MakeExternal(ExternalStringResource* resource);
|
|
|
|
/**
|
|
* Creates a new external string using the one-byte data defined in the given
|
|
* resource. When the external string is no longer live on V8's heap the
|
|
* resource will be disposed by calling its Dispose method. The caller of
|
|
* this function should not otherwise delete or modify the resource. Neither
|
|
* should the underlying buffer be deallocated or modified except through the
|
|
* destructor of the external string resource.
|
|
*/
|
|
static V8_DEPRECATE_SOON(
|
|
"Use maybe version",
|
|
Local<String> NewExternal(Isolate* isolate,
|
|
ExternalOneByteStringResource* resource));
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewExternalOneByte(
|
|
Isolate* isolate, ExternalOneByteStringResource* resource);
|
|
|
|
/**
|
|
* Associate an external string resource with this string by transforming it
|
|
* in place so that existing references to this string in the JavaScript heap
|
|
* will use the external string resource. The external string resource's
|
|
* character contents need to be equivalent to this string.
|
|
* Returns true if the string has been changed to be an external string.
|
|
* The string is not modified if the operation fails. See NewExternal for
|
|
* information on the lifetime of the resource.
|
|
*/
|
|
bool MakeExternal(ExternalOneByteStringResource* resource);
|
|
|
|
/**
|
|
* Returns true if this string can be made external.
|
|
*/
|
|
bool CanMakeExternal();
|
|
|
|
/**
|
|
* Converts an object to a UTF-8-encoded character array. Useful if
|
|
* you want to print the object. If conversion to a string fails
|
|
* (e.g. due to an exception in the toString() method of the object)
|
|
* then the length() method returns 0 and the * operator returns
|
|
* NULL.
|
|
*/
|
|
class V8_EXPORT Utf8Value {
|
|
public:
|
|
explicit Utf8Value(Local<v8::Value> obj);
|
|
~Utf8Value();
|
|
char* operator*() { return str_; }
|
|
const char* operator*() const { return str_; }
|
|
int length() const { return length_; }
|
|
private:
|
|
char* str_;
|
|
int length_;
|
|
|
|
// Disallow copying and assigning.
|
|
Utf8Value(const Utf8Value&);
|
|
void operator=(const Utf8Value&);
|
|
};
|
|
|
|
/**
|
|
* Converts an object to a two-byte string.
|
|
* If conversion to a string fails (eg. due to an exception in the toString()
|
|
* method of the object) then the length() method returns 0 and the * operator
|
|
* returns NULL.
|
|
*/
|
|
class V8_EXPORT Value {
|
|
public:
|
|
explicit Value(Local<v8::Value> obj);
|
|
~Value();
|
|
uint16_t* operator*() { return str_; }
|
|
const uint16_t* operator*() const { return str_; }
|
|
int length() const { return length_; }
|
|
private:
|
|
uint16_t* str_;
|
|
int length_;
|
|
|
|
// Disallow copying and assigning.
|
|
Value(const Value&);
|
|
void operator=(const Value&);
|
|
};
|
|
|
|
private:
|
|
void VerifyExternalStringResourceBase(ExternalStringResourceBase* v,
|
|
Encoding encoding) const;
|
|
void VerifyExternalStringResource(ExternalStringResource* val) const;
|
|
static void CheckCast(v8::Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A JavaScript symbol (ECMA-262 edition 6)
|
|
*
|
|
* This is an experimental feature. Use at your own risk.
|
|
*/
|
|
class V8_EXPORT Symbol : public Name {
|
|
public:
|
|
// Returns the print name string of the symbol, or undefined if none.
|
|
Local<Value> Name() const;
|
|
|
|
// Create a symbol. If name is not empty, it will be used as the description.
|
|
static Local<Symbol> New(
|
|
Isolate *isolate, Local<String> name = Local<String>());
|
|
|
|
// Access global symbol registry.
|
|
// Note that symbols created this way are never collected, so
|
|
// they should only be used for statically fixed properties.
|
|
// Also, there is only one global name space for the names used as keys.
|
|
// To minimize the potential for clashes, use qualified names as keys.
|
|
static Local<Symbol> For(Isolate *isolate, Local<String> name);
|
|
|
|
// Retrieve a global symbol. Similar to |For|, but using a separate
|
|
// registry that is not accessible by (and cannot clash with) JavaScript code.
|
|
static Local<Symbol> ForApi(Isolate *isolate, Local<String> name);
|
|
|
|
// Well-known symbols
|
|
static Local<Symbol> GetIterator(Isolate* isolate);
|
|
static Local<Symbol> GetUnscopables(Isolate* isolate);
|
|
static Local<Symbol> GetToStringTag(Isolate* isolate);
|
|
|
|
V8_INLINE static Symbol* Cast(v8::Value* obj);
|
|
|
|
private:
|
|
Symbol();
|
|
static void CheckCast(v8::Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A JavaScript number value (ECMA-262, 4.3.20)
|
|
*/
|
|
class V8_EXPORT Number : public Primitive {
|
|
public:
|
|
double Value() const;
|
|
static Local<Number> New(Isolate* isolate, double value);
|
|
V8_INLINE static Number* Cast(v8::Value* obj);
|
|
private:
|
|
Number();
|
|
static void CheckCast(v8::Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A JavaScript value representing a signed integer.
|
|
*/
|
|
class V8_EXPORT Integer : public Number {
|
|
public:
|
|
static Local<Integer> New(Isolate* isolate, int32_t value);
|
|
static Local<Integer> NewFromUnsigned(Isolate* isolate, uint32_t value);
|
|
int64_t Value() const;
|
|
V8_INLINE static Integer* Cast(v8::Value* obj);
|
|
private:
|
|
Integer();
|
|
static void CheckCast(v8::Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A JavaScript value representing a 32-bit signed integer.
|
|
*/
|
|
class V8_EXPORT Int32 : public Integer {
|
|
public:
|
|
int32_t Value() const;
|
|
V8_INLINE static Int32* Cast(v8::Value* obj);
|
|
|
|
private:
|
|
Int32();
|
|
static void CheckCast(v8::Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A JavaScript value representing a 32-bit unsigned integer.
|
|
*/
|
|
class V8_EXPORT Uint32 : public Integer {
|
|
public:
|
|
uint32_t Value() const;
|
|
V8_INLINE static Uint32* Cast(v8::Value* obj);
|
|
|
|
private:
|
|
Uint32();
|
|
static void CheckCast(v8::Value* obj);
|
|
};
|
|
|
|
|
|
enum PropertyAttribute {
|
|
None = 0,
|
|
ReadOnly = 1 << 0,
|
|
DontEnum = 1 << 1,
|
|
DontDelete = 1 << 2
|
|
};
|
|
|
|
/**
|
|
* Accessor[Getter|Setter] are used as callback functions when
|
|
* setting|getting a particular property. See Object and ObjectTemplate's
|
|
* method SetAccessor.
|
|
*/
|
|
typedef void (*AccessorGetterCallback)(
|
|
Local<String> property,
|
|
const PropertyCallbackInfo<Value>& info);
|
|
typedef void (*AccessorNameGetterCallback)(
|
|
Local<Name> property,
|
|
const PropertyCallbackInfo<Value>& info);
|
|
|
|
|
|
typedef void (*AccessorSetterCallback)(
|
|
Local<String> property,
|
|
Local<Value> value,
|
|
const PropertyCallbackInfo<void>& info);
|
|
typedef void (*AccessorNameSetterCallback)(
|
|
Local<Name> property,
|
|
Local<Value> value,
|
|
const PropertyCallbackInfo<void>& info);
|
|
|
|
|
|
/**
|
|
* Access control specifications.
|
|
*
|
|
* Some accessors should be accessible across contexts. These
|
|
* accessors have an explicit access control parameter which specifies
|
|
* the kind of cross-context access that should be allowed.
|
|
*
|
|
* TODO(dcarney): Remove PROHIBITS_OVERWRITING as it is now unused.
|
|
*/
|
|
enum AccessControl {
|
|
DEFAULT = 0,
|
|
ALL_CAN_READ = 1,
|
|
ALL_CAN_WRITE = 1 << 1,
|
|
PROHIBITS_OVERWRITING = 1 << 2
|
|
};
|
|
|
|
|
|
/**
|
|
* A JavaScript object (ECMA-262, 4.3.3)
|
|
*/
|
|
class V8_EXPORT Object : public Value {
|
|
public:
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
bool Set(Local<Value> key, Local<Value> value));
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> Set(Local<Context> context,
|
|
Local<Value> key, Local<Value> value);
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
bool Set(uint32_t index, Local<Value> value));
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> Set(Local<Context> context, uint32_t index,
|
|
Local<Value> value);
|
|
|
|
// Implements CreateDataProperty (ECMA-262, 7.3.4).
|
|
//
|
|
// Defines a configurable, writable, enumerable property with the given value
|
|
// on the object unless the property already exists and is not configurable
|
|
// or the object is not extensible.
|
|
//
|
|
// Returns true on success.
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> CreateDataProperty(Local<Context> context,
|
|
Local<Name> key,
|
|
Local<Value> value);
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> CreateDataProperty(Local<Context> context,
|
|
uint32_t index,
|
|
Local<Value> value);
|
|
|
|
// Implements DefineOwnProperty.
|
|
//
|
|
// In general, CreateDataProperty will be faster, however, does not allow
|
|
// for specifying attributes.
|
|
//
|
|
// Returns true on success.
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> DefineOwnProperty(
|
|
Local<Context> context, Local<Name> key, Local<Value> value,
|
|
PropertyAttribute attributes = None);
|
|
|
|
// Sets an own property on this object bypassing interceptors and
|
|
// overriding accessors or read-only properties.
|
|
//
|
|
// Note that if the object has an interceptor the property will be set
|
|
// locally, but since the interceptor takes precedence the local property
|
|
// will only be returned if the interceptor doesn't return a value.
|
|
//
|
|
// Note also that this only works for named properties.
|
|
V8_DEPRECATE_SOON("Use CreateDataProperty",
|
|
bool ForceSet(Local<Value> key, Local<Value> value,
|
|
PropertyAttribute attribs = None));
|
|
V8_DEPRECATE_SOON("Use CreateDataProperty",
|
|
Maybe<bool> ForceSet(Local<Context> context,
|
|
Local<Value> key, Local<Value> value,
|
|
PropertyAttribute attribs = None));
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version", Local<Value> Get(Local<Value> key));
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> Get(Local<Context> context,
|
|
Local<Value> key);
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version", Local<Value> Get(uint32_t index));
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> Get(Local<Context> context,
|
|
uint32_t index);
|
|
|
|
/**
|
|
* Gets the property attributes of a property which can be None or
|
|
* any combination of ReadOnly, DontEnum and DontDelete. Returns
|
|
* None when the property doesn't exist.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
PropertyAttribute GetPropertyAttributes(Local<Value> key));
|
|
V8_WARN_UNUSED_RESULT Maybe<PropertyAttribute> GetPropertyAttributes(
|
|
Local<Context> context, Local<Value> key);
|
|
|
|
/**
|
|
* Returns Object.getOwnPropertyDescriptor as per ES5 section 15.2.3.3.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Value> GetOwnPropertyDescriptor(Local<String> key));
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> GetOwnPropertyDescriptor(
|
|
Local<Context> context, Local<String> key);
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version", bool Has(Local<Value> key));
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context,
|
|
Local<Value> key);
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version", bool Delete(Local<Value> key));
|
|
// TODO(dcarney): mark V8_WARN_UNUSED_RESULT
|
|
Maybe<bool> Delete(Local<Context> context, Local<Value> key);
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version", bool Has(uint32_t index));
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context, uint32_t index);
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version", bool Delete(uint32_t index));
|
|
// TODO(dcarney): mark V8_WARN_UNUSED_RESULT
|
|
Maybe<bool> Delete(Local<Context> context, uint32_t index);
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
bool SetAccessor(Local<String> name,
|
|
AccessorGetterCallback getter,
|
|
AccessorSetterCallback setter = 0,
|
|
Local<Value> data = Local<Value>(),
|
|
AccessControl settings = DEFAULT,
|
|
PropertyAttribute attribute = None));
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
bool SetAccessor(Local<Name> name,
|
|
AccessorNameGetterCallback getter,
|
|
AccessorNameSetterCallback setter = 0,
|
|
Local<Value> data = Local<Value>(),
|
|
AccessControl settings = DEFAULT,
|
|
PropertyAttribute attribute = None));
|
|
// TODO(dcarney): mark V8_WARN_UNUSED_RESULT
|
|
Maybe<bool> SetAccessor(Local<Context> context, Local<Name> name,
|
|
AccessorNameGetterCallback getter,
|
|
AccessorNameSetterCallback setter = 0,
|
|
MaybeLocal<Value> data = MaybeLocal<Value>(),
|
|
AccessControl settings = DEFAULT,
|
|
PropertyAttribute attribute = None);
|
|
|
|
void SetAccessorProperty(Local<Name> name, Local<Function> getter,
|
|
Local<Function> setter = Local<Function>(),
|
|
PropertyAttribute attribute = None,
|
|
AccessControl settings = DEFAULT);
|
|
|
|
/**
|
|
* Returns an array containing the names of the enumerable properties
|
|
* of this object, including properties from prototype objects. The
|
|
* array returned by this method contains the same values as would
|
|
* be enumerated by a for-in statement over this object.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version", Local<Array> GetPropertyNames());
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Array> GetPropertyNames(
|
|
Local<Context> context);
|
|
|
|
/**
|
|
* This function has the same functionality as GetPropertyNames but
|
|
* the returned array doesn't contain the names of properties from
|
|
* prototype objects.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version", Local<Array> GetOwnPropertyNames());
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Array> GetOwnPropertyNames(
|
|
Local<Context> context);
|
|
|
|
/**
|
|
* Get the prototype object. This does not skip objects marked to
|
|
* be skipped by __proto__ and it does not consult the security
|
|
* handler.
|
|
*/
|
|
Local<Value> GetPrototype();
|
|
|
|
/**
|
|
* Set the prototype object. This does not skip objects marked to
|
|
* be skipped by __proto__ and it does not consult the security
|
|
* handler.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
bool SetPrototype(Local<Value> prototype));
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> SetPrototype(Local<Context> context,
|
|
Local<Value> prototype);
|
|
|
|
/**
|
|
* Finds an instance of the given function template in the prototype
|
|
* chain.
|
|
*/
|
|
Local<Object> FindInstanceInPrototypeChain(Local<FunctionTemplate> tmpl);
|
|
|
|
/**
|
|
* Call builtin Object.prototype.toString on this object.
|
|
* This is different from Value::ToString() that may call
|
|
* user-defined toString function. This one does not.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version", Local<String> ObjectProtoToString());
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<String> ObjectProtoToString(
|
|
Local<Context> context);
|
|
|
|
/**
|
|
* Returns the name of the function invoked as a constructor for this object.
|
|
*/
|
|
Local<String> GetConstructorName();
|
|
|
|
/** Gets the number of internal fields for this Object. */
|
|
int InternalFieldCount();
|
|
|
|
/** Same as above, but works for Persistents */
|
|
V8_INLINE static int InternalFieldCount(
|
|
const PersistentBase<Object>& object) {
|
|
return object.val_->InternalFieldCount();
|
|
}
|
|
|
|
/** Gets the value from an internal field. */
|
|
V8_INLINE Local<Value> GetInternalField(int index);
|
|
|
|
/** Sets the value in an internal field. */
|
|
void SetInternalField(int index, Local<Value> value);
|
|
|
|
/**
|
|
* Gets a 2-byte-aligned native pointer from an internal field. This field
|
|
* must have been set by SetAlignedPointerInInternalField, everything else
|
|
* leads to undefined behavior.
|
|
*/
|
|
V8_INLINE void* GetAlignedPointerFromInternalField(int index);
|
|
|
|
/** Same as above, but works for Persistents */
|
|
V8_INLINE static void* GetAlignedPointerFromInternalField(
|
|
const PersistentBase<Object>& object, int index) {
|
|
return object.val_->GetAlignedPointerFromInternalField(index);
|
|
}
|
|
|
|
/**
|
|
* Sets a 2-byte-aligned native pointer in an internal field. To retrieve such
|
|
* a field, GetAlignedPointerFromInternalField must be used, everything else
|
|
* leads to undefined behavior.
|
|
*/
|
|
void SetAlignedPointerInInternalField(int index, void* value);
|
|
|
|
// Testers for local properties.
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
bool HasOwnProperty(Local<String> key));
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> HasOwnProperty(Local<Context> context,
|
|
Local<Name> key);
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
bool HasRealNamedProperty(Local<String> key));
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> HasRealNamedProperty(Local<Context> context,
|
|
Local<Name> key);
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
bool HasRealIndexedProperty(uint32_t index));
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> HasRealIndexedProperty(
|
|
Local<Context> context, uint32_t index);
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
bool HasRealNamedCallbackProperty(Local<String> key));
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> HasRealNamedCallbackProperty(
|
|
Local<Context> context, Local<Name> key);
|
|
|
|
/**
|
|
* If result.IsEmpty() no real property was located in the prototype chain.
|
|
* This means interceptors in the prototype chain are not called.
|
|
*/
|
|
V8_DEPRECATE_SOON(
|
|
"Use maybe version",
|
|
Local<Value> GetRealNamedPropertyInPrototypeChain(Local<String> key));
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> GetRealNamedPropertyInPrototypeChain(
|
|
Local<Context> context, Local<Name> key);
|
|
|
|
/**
|
|
* Gets the property attributes of a real property in the prototype chain,
|
|
* which can be None or any combination of ReadOnly, DontEnum and DontDelete.
|
|
* Interceptors in the prototype chain are not called.
|
|
*/
|
|
V8_DEPRECATE_SOON(
|
|
"Use maybe version",
|
|
Maybe<PropertyAttribute> GetRealNamedPropertyAttributesInPrototypeChain(
|
|
Local<String> key));
|
|
V8_WARN_UNUSED_RESULT Maybe<PropertyAttribute>
|
|
GetRealNamedPropertyAttributesInPrototypeChain(Local<Context> context,
|
|
Local<Name> key);
|
|
|
|
/**
|
|
* If result.IsEmpty() no real property was located on the object or
|
|
* in the prototype chain.
|
|
* This means interceptors in the prototype chain are not called.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Value> GetRealNamedProperty(Local<String> key));
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> GetRealNamedProperty(
|
|
Local<Context> context, Local<Name> key);
|
|
|
|
/**
|
|
* Gets the property attributes of a real property which can be
|
|
* None or any combination of ReadOnly, DontEnum and DontDelete.
|
|
* Interceptors in the prototype chain are not called.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Maybe<PropertyAttribute> GetRealNamedPropertyAttributes(
|
|
Local<String> key));
|
|
V8_WARN_UNUSED_RESULT Maybe<PropertyAttribute> GetRealNamedPropertyAttributes(
|
|
Local<Context> context, Local<Name> key);
|
|
|
|
/** Tests for a named lookup interceptor.*/
|
|
bool HasNamedLookupInterceptor();
|
|
|
|
/** Tests for an index lookup interceptor.*/
|
|
bool HasIndexedLookupInterceptor();
|
|
|
|
/**
|
|
* Returns the identity hash for this object. The current implementation
|
|
* uses a hidden property on the object to store the identity hash.
|
|
*
|
|
* The return value will never be 0. Also, it is not guaranteed to be
|
|
* unique.
|
|
*/
|
|
int GetIdentityHash();
|
|
|
|
/**
|
|
* Access hidden properties on JavaScript objects. These properties are
|
|
* hidden from the executing JavaScript and only accessible through the V8
|
|
* C++ API. Hidden properties introduced by V8 internally (for example the
|
|
* identity hash) are prefixed with "v8::".
|
|
*/
|
|
// TODO(dcarney): convert these to take a isolate and optionally bailout?
|
|
bool SetHiddenValue(Local<String> key, Local<Value> value);
|
|
Local<Value> GetHiddenValue(Local<String> key);
|
|
bool DeleteHiddenValue(Local<String> key);
|
|
|
|
/**
|
|
* Clone this object with a fast but shallow copy. Values will point
|
|
* to the same values as the original object.
|
|
*/
|
|
// TODO(dcarney): take an isolate and optionally bail out?
|
|
Local<Object> Clone();
|
|
|
|
/**
|
|
* Returns the context in which the object was created.
|
|
*/
|
|
Local<Context> CreationContext();
|
|
|
|
/**
|
|
* Checks whether a callback is set by the
|
|
* ObjectTemplate::SetCallAsFunctionHandler method.
|
|
* When an Object is callable this method returns true.
|
|
*/
|
|
bool IsCallable();
|
|
|
|
/**
|
|
* Call an Object as a function if a callback is set by the
|
|
* ObjectTemplate::SetCallAsFunctionHandler method.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Value> CallAsFunction(Local<Value> recv, int argc,
|
|
Local<Value> argv[]));
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> CallAsFunction(Local<Context> context,
|
|
Local<Value> recv,
|
|
int argc,
|
|
Local<Value> argv[]);
|
|
|
|
/**
|
|
* Call an Object as a constructor if a callback is set by the
|
|
* ObjectTemplate::SetCallAsFunctionHandler method.
|
|
* Note: This method behaves like the Function::NewInstance method.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Value> CallAsConstructor(int argc,
|
|
Local<Value> argv[]));
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> CallAsConstructor(
|
|
Local<Context> context, int argc, Local<Value> argv[]);
|
|
|
|
/**
|
|
* Return the isolate to which the Object belongs to.
|
|
*/
|
|
V8_DEPRECATE_SOON("Keep track of isolate correctly", Isolate* GetIsolate());
|
|
|
|
static Local<Object> New(Isolate* isolate);
|
|
|
|
V8_INLINE static Object* Cast(Value* obj);
|
|
|
|
private:
|
|
Object();
|
|
static void CheckCast(Value* obj);
|
|
Local<Value> SlowGetInternalField(int index);
|
|
void* SlowGetAlignedPointerFromInternalField(int index);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of the built-in array constructor (ECMA-262, 15.4.2).
|
|
*/
|
|
class V8_EXPORT Array : public Object {
|
|
public:
|
|
uint32_t Length() const;
|
|
|
|
/**
|
|
* Clones an element at index |index|. Returns an empty
|
|
* handle if cloning fails (for any reason).
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Object> CloneElementAt(uint32_t index));
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Object> CloneElementAt(
|
|
Local<Context> context, uint32_t index);
|
|
|
|
/**
|
|
* Creates a JavaScript array with the given length. If the length
|
|
* is negative the returned array will have length 0.
|
|
*/
|
|
static Local<Array> New(Isolate* isolate, int length = 0);
|
|
|
|
V8_INLINE static Array* Cast(Value* obj);
|
|
private:
|
|
Array();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of the built-in Map constructor (ECMA-262, 6th Edition, 23.1.1).
|
|
*/
|
|
class V8_EXPORT Map : public Object {
|
|
public:
|
|
size_t Size() const;
|
|
void Clear();
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> Get(Local<Context> context,
|
|
Local<Value> key);
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Map> Set(Local<Context> context,
|
|
Local<Value> key,
|
|
Local<Value> value);
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context,
|
|
Local<Value> key);
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> Delete(Local<Context> context,
|
|
Local<Value> key);
|
|
|
|
/**
|
|
* Returns an array of length Size() * 2, where index N is the Nth key and
|
|
* index N + 1 is the Nth value.
|
|
*/
|
|
Local<Array> AsArray() const;
|
|
|
|
/**
|
|
* Creates a new empty Map.
|
|
*/
|
|
static Local<Map> New(Isolate* isolate);
|
|
|
|
/**
|
|
* Creates a new Map containing the elements of array, which must be formatted
|
|
* in the same manner as the array returned from AsArray().
|
|
* Guaranteed to be side-effect free if the array contains no holes.
|
|
*/
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<Map> FromArray(Local<Context> context,
|
|
Local<Array> array);
|
|
|
|
V8_INLINE static Map* Cast(Value* obj);
|
|
|
|
private:
|
|
Map();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of the built-in Set constructor (ECMA-262, 6th Edition, 23.2.1).
|
|
*/
|
|
class V8_EXPORT Set : public Object {
|
|
public:
|
|
size_t Size() const;
|
|
void Clear();
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Set> Add(Local<Context> context,
|
|
Local<Value> key);
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context,
|
|
Local<Value> key);
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> Delete(Local<Context> context,
|
|
Local<Value> key);
|
|
|
|
/**
|
|
* Returns an array of the keys in this Set.
|
|
*/
|
|
Local<Array> AsArray() const;
|
|
|
|
/**
|
|
* Creates a new empty Set.
|
|
*/
|
|
static Local<Set> New(Isolate* isolate);
|
|
|
|
/**
|
|
* Creates a new Set containing the items in array.
|
|
* Guaranteed to be side-effect free if the array contains no holes.
|
|
*/
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<Set> FromArray(Local<Context> context,
|
|
Local<Array> array);
|
|
|
|
V8_INLINE static Set* Cast(Value* obj);
|
|
|
|
private:
|
|
Set();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
template<typename T>
|
|
class ReturnValue {
|
|
public:
|
|
template <class S> V8_INLINE ReturnValue(const ReturnValue<S>& that)
|
|
: value_(that.value_) {
|
|
TYPE_CHECK(T, S);
|
|
}
|
|
// Local setters
|
|
template <typename S>
|
|
V8_INLINE V8_DEPRECATE_SOON("Use Global<> instead",
|
|
void Set(const Persistent<S>& handle));
|
|
template <typename S>
|
|
V8_INLINE void Set(const Global<S>& handle);
|
|
template <typename S>
|
|
V8_INLINE void Set(const Local<S> handle);
|
|
// Fast primitive setters
|
|
V8_INLINE void Set(bool value);
|
|
V8_INLINE void Set(double i);
|
|
V8_INLINE void Set(int32_t i);
|
|
V8_INLINE void Set(uint32_t i);
|
|
// Fast JS primitive setters
|
|
V8_INLINE void SetNull();
|
|
V8_INLINE void SetUndefined();
|
|
V8_INLINE void SetEmptyString();
|
|
// Convenience getter for Isolate
|
|
V8_INLINE Isolate* GetIsolate();
|
|
|
|
// Pointer setter: Uncompilable to prevent inadvertent misuse.
|
|
template <typename S>
|
|
V8_INLINE void Set(S* whatever);
|
|
|
|
private:
|
|
template<class F> friend class ReturnValue;
|
|
template<class F> friend class FunctionCallbackInfo;
|
|
template<class F> friend class PropertyCallbackInfo;
|
|
template <class F, class G, class H>
|
|
friend class PersistentValueMapBase;
|
|
V8_INLINE void SetInternal(internal::Object* value) { *value_ = value; }
|
|
V8_INLINE internal::Object* GetDefaultValue();
|
|
V8_INLINE explicit ReturnValue(internal::Object** slot);
|
|
internal::Object** value_;
|
|
};
|
|
|
|
|
|
/**
|
|
* The argument information given to function call callbacks. This
|
|
* class provides access to information about the context of the call,
|
|
* including the receiver, the number and values of arguments, and
|
|
* the holder of the function.
|
|
*/
|
|
template<typename T>
|
|
class FunctionCallbackInfo {
|
|
public:
|
|
V8_INLINE int Length() const;
|
|
V8_INLINE Local<Value> operator[](int i) const;
|
|
V8_INLINE Local<Function> Callee() const;
|
|
V8_INLINE Local<Object> This() const;
|
|
V8_INLINE Local<Object> Holder() const;
|
|
V8_INLINE bool IsConstructCall() const;
|
|
V8_INLINE Local<Value> Data() const;
|
|
V8_INLINE Isolate* GetIsolate() const;
|
|
V8_INLINE ReturnValue<T> GetReturnValue() const;
|
|
// This shouldn't be public, but the arm compiler needs it.
|
|
static const int kArgsLength = 7;
|
|
|
|
protected:
|
|
friend class internal::FunctionCallbackArguments;
|
|
friend class internal::CustomArguments<FunctionCallbackInfo>;
|
|
static const int kHolderIndex = 0;
|
|
static const int kIsolateIndex = 1;
|
|
static const int kReturnValueDefaultValueIndex = 2;
|
|
static const int kReturnValueIndex = 3;
|
|
static const int kDataIndex = 4;
|
|
static const int kCalleeIndex = 5;
|
|
static const int kContextSaveIndex = 6;
|
|
|
|
V8_INLINE FunctionCallbackInfo(internal::Object** implicit_args,
|
|
internal::Object** values,
|
|
int length,
|
|
bool is_construct_call);
|
|
internal::Object** implicit_args_;
|
|
internal::Object** values_;
|
|
int length_;
|
|
int is_construct_call_;
|
|
};
|
|
|
|
|
|
/**
|
|
* The information passed to a property callback about the context
|
|
* of the property access.
|
|
*/
|
|
template<typename T>
|
|
class PropertyCallbackInfo {
|
|
public:
|
|
V8_INLINE Isolate* GetIsolate() const;
|
|
V8_INLINE Local<Value> Data() const;
|
|
V8_INLINE Local<Object> This() const;
|
|
V8_INLINE Local<Object> Holder() const;
|
|
V8_INLINE ReturnValue<T> GetReturnValue() const;
|
|
// This shouldn't be public, but the arm compiler needs it.
|
|
static const int kArgsLength = 6;
|
|
|
|
protected:
|
|
friend class MacroAssembler;
|
|
friend class internal::PropertyCallbackArguments;
|
|
friend class internal::CustomArguments<PropertyCallbackInfo>;
|
|
static const int kHolderIndex = 0;
|
|
static const int kIsolateIndex = 1;
|
|
static const int kReturnValueDefaultValueIndex = 2;
|
|
static const int kReturnValueIndex = 3;
|
|
static const int kDataIndex = 4;
|
|
static const int kThisIndex = 5;
|
|
|
|
V8_INLINE PropertyCallbackInfo(internal::Object** args) : args_(args) {}
|
|
internal::Object** args_;
|
|
};
|
|
|
|
|
|
typedef void (*FunctionCallback)(const FunctionCallbackInfo<Value>& info);
|
|
|
|
|
|
/**
|
|
* A JavaScript function object (ECMA-262, 15.3).
|
|
*/
|
|
class V8_EXPORT Function : public Object {
|
|
public:
|
|
/**
|
|
* Create a function in the current execution context
|
|
* for a given FunctionCallback.
|
|
*/
|
|
static MaybeLocal<Function> New(Local<Context> context,
|
|
FunctionCallback callback,
|
|
Local<Value> data = Local<Value>(),
|
|
int length = 0);
|
|
static V8_DEPRECATE_SOON(
|
|
"Use maybe version",
|
|
Local<Function> New(Isolate* isolate, FunctionCallback callback,
|
|
Local<Value> data = Local<Value>(), int length = 0));
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Object> NewInstance(int argc, Local<Value> argv[])
|
|
const);
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Object> NewInstance(
|
|
Local<Context> context, int argc, Local<Value> argv[]) const;
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version", Local<Object> NewInstance() const);
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Object> NewInstance(
|
|
Local<Context> context) const {
|
|
return NewInstance(context, 0, nullptr);
|
|
}
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Value> Call(Local<Value> recv, int argc,
|
|
Local<Value> argv[]));
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> Call(Local<Context> context,
|
|
Local<Value> recv, int argc,
|
|
Local<Value> argv[]);
|
|
|
|
void SetName(Local<String> name);
|
|
Local<Value> GetName() const;
|
|
|
|
/**
|
|
* Name inferred from variable or property assignment of this function.
|
|
* Used to facilitate debugging and profiling of JavaScript code written
|
|
* in an OO style, where many functions are anonymous but are assigned
|
|
* to object properties.
|
|
*/
|
|
Local<Value> GetInferredName() const;
|
|
|
|
/**
|
|
* User-defined name assigned to the "displayName" property of this function.
|
|
* Used to facilitate debugging and profiling of JavaScript code.
|
|
*/
|
|
Local<Value> GetDisplayName() const;
|
|
|
|
/**
|
|
* Returns zero based line number of function body and
|
|
* kLineOffsetNotFound if no information available.
|
|
*/
|
|
int GetScriptLineNumber() const;
|
|
/**
|
|
* Returns zero based column number of function body and
|
|
* kLineOffsetNotFound if no information available.
|
|
*/
|
|
int GetScriptColumnNumber() const;
|
|
|
|
/**
|
|
* Tells whether this function is builtin.
|
|
*/
|
|
bool IsBuiltin() const;
|
|
|
|
/**
|
|
* Returns scriptId.
|
|
*/
|
|
int ScriptId() const;
|
|
|
|
/**
|
|
* Returns the original function if this function is bound, else returns
|
|
* v8::Undefined.
|
|
*/
|
|
Local<Value> GetBoundFunction() const;
|
|
|
|
ScriptOrigin GetScriptOrigin() const;
|
|
V8_INLINE static Function* Cast(Value* obj);
|
|
static const int kLineOffsetNotFound;
|
|
|
|
private:
|
|
Function();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of the built-in Promise constructor (ES6 draft).
|
|
* This API is experimental. Only works with --harmony flag.
|
|
*/
|
|
class V8_EXPORT Promise : public Object {
|
|
public:
|
|
class V8_EXPORT Resolver : public Object {
|
|
public:
|
|
/**
|
|
* Create a new resolver, along with an associated promise in pending state.
|
|
*/
|
|
static V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Resolver> New(Isolate* isolate));
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<Resolver> New(
|
|
Local<Context> context);
|
|
|
|
/**
|
|
* Extract the associated promise.
|
|
*/
|
|
Local<Promise> GetPromise();
|
|
|
|
/**
|
|
* Resolve/reject the associated promise with a given value.
|
|
* Ignored if the promise is no longer pending.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version", void Resolve(Local<Value> value));
|
|
// TODO(dcarney): mark V8_WARN_UNUSED_RESULT
|
|
Maybe<bool> Resolve(Local<Context> context, Local<Value> value);
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version", void Reject(Local<Value> value));
|
|
// TODO(dcarney): mark V8_WARN_UNUSED_RESULT
|
|
Maybe<bool> Reject(Local<Context> context, Local<Value> value);
|
|
|
|
V8_INLINE static Resolver* Cast(Value* obj);
|
|
|
|
private:
|
|
Resolver();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
/**
|
|
* Register a resolution/rejection handler with a promise.
|
|
* The handler is given the respective resolution/rejection value as
|
|
* an argument. If the promise is already resolved/rejected, the handler is
|
|
* invoked at the end of turn.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Promise> Chain(Local<Function> handler));
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Promise> Chain(Local<Context> context,
|
|
Local<Function> handler);
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Promise> Catch(Local<Function> handler));
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Promise> Catch(Local<Context> context,
|
|
Local<Function> handler);
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Promise> Then(Local<Function> handler));
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Promise> Then(Local<Context> context,
|
|
Local<Function> handler);
|
|
|
|
/**
|
|
* Returns true if the promise has at least one derived promise, and
|
|
* therefore resolve/reject handlers (including default handler).
|
|
*/
|
|
bool HasHandler();
|
|
|
|
V8_INLINE static Promise* Cast(Value* obj);
|
|
|
|
private:
|
|
Promise();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
#ifndef V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT
|
|
// The number of required internal fields can be defined by embedder.
|
|
#define V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT 2
|
|
#endif
|
|
|
|
|
|
enum class ArrayBufferCreationMode { kInternalized, kExternalized };
|
|
|
|
|
|
/**
|
|
* An instance of the built-in ArrayBuffer constructor (ES6 draft 15.13.5).
|
|
* This API is experimental and may change significantly.
|
|
*/
|
|
class V8_EXPORT ArrayBuffer : public Object {
|
|
public:
|
|
/**
|
|
* Allocator that V8 uses to allocate |ArrayBuffer|'s memory.
|
|
* The allocator is a global V8 setting. It has to be set via
|
|
* Isolate::CreateParams.
|
|
*
|
|
* This API is experimental and may change significantly.
|
|
*/
|
|
class V8_EXPORT Allocator { // NOLINT
|
|
public:
|
|
virtual ~Allocator() {}
|
|
|
|
/**
|
|
* Allocate |length| bytes. Return NULL if allocation is not successful.
|
|
* Memory should be initialized to zeroes.
|
|
*/
|
|
virtual void* Allocate(size_t length) = 0;
|
|
|
|
/**
|
|
* Allocate |length| bytes. Return NULL if allocation is not successful.
|
|
* Memory does not have to be initialized.
|
|
*/
|
|
virtual void* AllocateUninitialized(size_t length) = 0;
|
|
/**
|
|
* Free the memory block of size |length|, pointed to by |data|.
|
|
* That memory is guaranteed to be previously allocated by |Allocate|.
|
|
*/
|
|
virtual void Free(void* data, size_t length) = 0;
|
|
};
|
|
|
|
/**
|
|
* The contents of an |ArrayBuffer|. Externalization of |ArrayBuffer|
|
|
* returns an instance of this class, populated, with a pointer to data
|
|
* and byte length.
|
|
*
|
|
* The Data pointer of ArrayBuffer::Contents is always allocated with
|
|
* Allocator::Allocate that is set via Isolate::CreateParams.
|
|
*
|
|
* This API is experimental and may change significantly.
|
|
*/
|
|
class V8_EXPORT Contents { // NOLINT
|
|
public:
|
|
Contents() : data_(NULL), byte_length_(0) {}
|
|
|
|
void* Data() const { return data_; }
|
|
size_t ByteLength() const { return byte_length_; }
|
|
|
|
private:
|
|
void* data_;
|
|
size_t byte_length_;
|
|
|
|
friend class ArrayBuffer;
|
|
};
|
|
|
|
|
|
/**
|
|
* Data length in bytes.
|
|
*/
|
|
size_t ByteLength() const;
|
|
|
|
/**
|
|
* Create a new ArrayBuffer. Allocate |byte_length| bytes.
|
|
* Allocated memory will be owned by a created ArrayBuffer and
|
|
* will be deallocated when it is garbage-collected,
|
|
* unless the object is externalized.
|
|
*/
|
|
static Local<ArrayBuffer> New(Isolate* isolate, size_t byte_length);
|
|
|
|
/**
|
|
* Create a new ArrayBuffer over an existing memory block.
|
|
* The created array buffer is by default immediately in externalized state.
|
|
* The memory block will not be reclaimed when a created ArrayBuffer
|
|
* is garbage-collected.
|
|
*/
|
|
static Local<ArrayBuffer> New(
|
|
Isolate* isolate, void* data, size_t byte_length,
|
|
ArrayBufferCreationMode mode = ArrayBufferCreationMode::kExternalized);
|
|
|
|
/**
|
|
* Returns true if ArrayBuffer is externalized, that is, does not
|
|
* own its memory block.
|
|
*/
|
|
bool IsExternal() const;
|
|
|
|
/**
|
|
* Returns true if this ArrayBuffer may be neutered.
|
|
*/
|
|
bool IsNeuterable() const;
|
|
|
|
/**
|
|
* Neuters this ArrayBuffer and all its views (typed arrays).
|
|
* Neutering sets the byte length of the buffer and all typed arrays to zero,
|
|
* preventing JavaScript from ever accessing underlying backing store.
|
|
* ArrayBuffer should have been externalized and must be neuterable.
|
|
*/
|
|
void Neuter();
|
|
|
|
/**
|
|
* Make this ArrayBuffer external. The pointer to underlying memory block
|
|
* and byte length are returned as |Contents| structure. After ArrayBuffer
|
|
* had been etxrenalized, it does no longer owns the memory block. The caller
|
|
* should take steps to free memory when it is no longer needed.
|
|
*
|
|
* The memory block is guaranteed to be allocated with |Allocator::Allocate|
|
|
* that has been set via Isolate::CreateParams.
|
|
*/
|
|
Contents Externalize();
|
|
|
|
/**
|
|
* Get a pointer to the ArrayBuffer's underlying memory block without
|
|
* externalizing it. If the ArrayBuffer is not externalized, this pointer
|
|
* will become invalid as soon as the ArrayBuffer became garbage collected.
|
|
*
|
|
* The embedder should make sure to hold a strong reference to the
|
|
* ArrayBuffer while accessing this pointer.
|
|
*
|
|
* The memory block is guaranteed to be allocated with |Allocator::Allocate|.
|
|
*/
|
|
Contents GetContents();
|
|
|
|
V8_INLINE static ArrayBuffer* Cast(Value* obj);
|
|
|
|
static const int kInternalFieldCount = V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT;
|
|
|
|
private:
|
|
ArrayBuffer();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
#ifndef V8_ARRAY_BUFFER_VIEW_INTERNAL_FIELD_COUNT
|
|
// The number of required internal fields can be defined by embedder.
|
|
#define V8_ARRAY_BUFFER_VIEW_INTERNAL_FIELD_COUNT 2
|
|
#endif
|
|
|
|
|
|
/**
|
|
* A base class for an instance of one of "views" over ArrayBuffer,
|
|
* including TypedArrays and DataView (ES6 draft 15.13).
|
|
*
|
|
* This API is experimental and may change significantly.
|
|
*/
|
|
class V8_EXPORT ArrayBufferView : public Object {
|
|
public:
|
|
/**
|
|
* Returns underlying ArrayBuffer.
|
|
*/
|
|
Local<ArrayBuffer> Buffer();
|
|
/**
|
|
* Byte offset in |Buffer|.
|
|
*/
|
|
size_t ByteOffset();
|
|
/**
|
|
* Size of a view in bytes.
|
|
*/
|
|
size_t ByteLength();
|
|
|
|
/**
|
|
* Copy the contents of the ArrayBufferView's buffer to an embedder defined
|
|
* memory without additional overhead that calling ArrayBufferView::Buffer
|
|
* might incur.
|
|
*
|
|
* Will write at most min(|byte_length|, ByteLength) bytes starting at
|
|
* ByteOffset of the underling buffer to the memory starting at |dest|.
|
|
* Returns the number of bytes actually written.
|
|
*/
|
|
size_t CopyContents(void* dest, size_t byte_length);
|
|
|
|
/**
|
|
* Returns true if ArrayBufferView's backing ArrayBuffer has already been
|
|
* allocated.
|
|
*/
|
|
bool HasBuffer() const;
|
|
|
|
V8_INLINE static ArrayBufferView* Cast(Value* obj);
|
|
|
|
static const int kInternalFieldCount =
|
|
V8_ARRAY_BUFFER_VIEW_INTERNAL_FIELD_COUNT;
|
|
|
|
private:
|
|
ArrayBufferView();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A base class for an instance of TypedArray series of constructors
|
|
* (ES6 draft 15.13.6).
|
|
* This API is experimental and may change significantly.
|
|
*/
|
|
class V8_EXPORT TypedArray : public ArrayBufferView {
|
|
public:
|
|
/**
|
|
* Number of elements in this typed array
|
|
* (e.g. for Int16Array, |ByteLength|/2).
|
|
*/
|
|
size_t Length();
|
|
|
|
V8_INLINE static TypedArray* Cast(Value* obj);
|
|
|
|
private:
|
|
TypedArray();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of Uint8Array constructor (ES6 draft 15.13.6).
|
|
* This API is experimental and may change significantly.
|
|
*/
|
|
class V8_EXPORT Uint8Array : public TypedArray {
|
|
public:
|
|
static Local<Uint8Array> New(Local<ArrayBuffer> array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
static Local<Uint8Array> New(Local<SharedArrayBuffer> shared_array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
V8_INLINE static Uint8Array* Cast(Value* obj);
|
|
|
|
private:
|
|
Uint8Array();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of Uint8ClampedArray constructor (ES6 draft 15.13.6).
|
|
* This API is experimental and may change significantly.
|
|
*/
|
|
class V8_EXPORT Uint8ClampedArray : public TypedArray {
|
|
public:
|
|
static Local<Uint8ClampedArray> New(Local<ArrayBuffer> array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
static Local<Uint8ClampedArray> New(
|
|
Local<SharedArrayBuffer> shared_array_buffer, size_t byte_offset,
|
|
size_t length);
|
|
V8_INLINE static Uint8ClampedArray* Cast(Value* obj);
|
|
|
|
private:
|
|
Uint8ClampedArray();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
/**
|
|
* An instance of Int8Array constructor (ES6 draft 15.13.6).
|
|
* This API is experimental and may change significantly.
|
|
*/
|
|
class V8_EXPORT Int8Array : public TypedArray {
|
|
public:
|
|
static Local<Int8Array> New(Local<ArrayBuffer> array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
static Local<Int8Array> New(Local<SharedArrayBuffer> shared_array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
V8_INLINE static Int8Array* Cast(Value* obj);
|
|
|
|
private:
|
|
Int8Array();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of Uint16Array constructor (ES6 draft 15.13.6).
|
|
* This API is experimental and may change significantly.
|
|
*/
|
|
class V8_EXPORT Uint16Array : public TypedArray {
|
|
public:
|
|
static Local<Uint16Array> New(Local<ArrayBuffer> array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
static Local<Uint16Array> New(Local<SharedArrayBuffer> shared_array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
V8_INLINE static Uint16Array* Cast(Value* obj);
|
|
|
|
private:
|
|
Uint16Array();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of Int16Array constructor (ES6 draft 15.13.6).
|
|
* This API is experimental and may change significantly.
|
|
*/
|
|
class V8_EXPORT Int16Array : public TypedArray {
|
|
public:
|
|
static Local<Int16Array> New(Local<ArrayBuffer> array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
static Local<Int16Array> New(Local<SharedArrayBuffer> shared_array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
V8_INLINE static Int16Array* Cast(Value* obj);
|
|
|
|
private:
|
|
Int16Array();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of Uint32Array constructor (ES6 draft 15.13.6).
|
|
* This API is experimental and may change significantly.
|
|
*/
|
|
class V8_EXPORT Uint32Array : public TypedArray {
|
|
public:
|
|
static Local<Uint32Array> New(Local<ArrayBuffer> array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
static Local<Uint32Array> New(Local<SharedArrayBuffer> shared_array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
V8_INLINE static Uint32Array* Cast(Value* obj);
|
|
|
|
private:
|
|
Uint32Array();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of Int32Array constructor (ES6 draft 15.13.6).
|
|
* This API is experimental and may change significantly.
|
|
*/
|
|
class V8_EXPORT Int32Array : public TypedArray {
|
|
public:
|
|
static Local<Int32Array> New(Local<ArrayBuffer> array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
static Local<Int32Array> New(Local<SharedArrayBuffer> shared_array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
V8_INLINE static Int32Array* Cast(Value* obj);
|
|
|
|
private:
|
|
Int32Array();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of Float32Array constructor (ES6 draft 15.13.6).
|
|
* This API is experimental and may change significantly.
|
|
*/
|
|
class V8_EXPORT Float32Array : public TypedArray {
|
|
public:
|
|
static Local<Float32Array> New(Local<ArrayBuffer> array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
static Local<Float32Array> New(Local<SharedArrayBuffer> shared_array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
V8_INLINE static Float32Array* Cast(Value* obj);
|
|
|
|
private:
|
|
Float32Array();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of Float64Array constructor (ES6 draft 15.13.6).
|
|
* This API is experimental and may change significantly.
|
|
*/
|
|
class V8_EXPORT Float64Array : public TypedArray {
|
|
public:
|
|
static Local<Float64Array> New(Local<ArrayBuffer> array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
static Local<Float64Array> New(Local<SharedArrayBuffer> shared_array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
V8_INLINE static Float64Array* Cast(Value* obj);
|
|
|
|
private:
|
|
Float64Array();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of DataView constructor (ES6 draft 15.13.7).
|
|
* This API is experimental and may change significantly.
|
|
*/
|
|
class V8_EXPORT DataView : public ArrayBufferView {
|
|
public:
|
|
static Local<DataView> New(Local<ArrayBuffer> array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
static Local<DataView> New(Local<SharedArrayBuffer> shared_array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
V8_INLINE static DataView* Cast(Value* obj);
|
|
|
|
private:
|
|
DataView();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of the built-in SharedArrayBuffer constructor.
|
|
* This API is experimental and may change significantly.
|
|
*/
|
|
class V8_EXPORT SharedArrayBuffer : public Object {
|
|
public:
|
|
/**
|
|
* The contents of an |SharedArrayBuffer|. Externalization of
|
|
* |SharedArrayBuffer| returns an instance of this class, populated, with a
|
|
* pointer to data and byte length.
|
|
*
|
|
* The Data pointer of SharedArrayBuffer::Contents is always allocated with
|
|
* |ArrayBuffer::Allocator::Allocate| by the allocator specified in
|
|
* v8::Isolate::CreateParams::array_buffer_allocator.
|
|
*
|
|
* This API is experimental and may change significantly.
|
|
*/
|
|
class V8_EXPORT Contents { // NOLINT
|
|
public:
|
|
Contents() : data_(NULL), byte_length_(0) {}
|
|
|
|
void* Data() const { return data_; }
|
|
size_t ByteLength() const { return byte_length_; }
|
|
|
|
private:
|
|
void* data_;
|
|
size_t byte_length_;
|
|
|
|
friend class SharedArrayBuffer;
|
|
};
|
|
|
|
|
|
/**
|
|
* Data length in bytes.
|
|
*/
|
|
size_t ByteLength() const;
|
|
|
|
/**
|
|
* Create a new SharedArrayBuffer. Allocate |byte_length| bytes.
|
|
* Allocated memory will be owned by a created SharedArrayBuffer and
|
|
* will be deallocated when it is garbage-collected,
|
|
* unless the object is externalized.
|
|
*/
|
|
static Local<SharedArrayBuffer> New(Isolate* isolate, size_t byte_length);
|
|
|
|
/**
|
|
* Create a new SharedArrayBuffer over an existing memory block. The created
|
|
* array buffer is immediately in externalized state unless otherwise
|
|
* specified. The memory block will not be reclaimed when a created
|
|
* SharedArrayBuffer is garbage-collected.
|
|
*/
|
|
static Local<SharedArrayBuffer> New(
|
|
Isolate* isolate, void* data, size_t byte_length,
|
|
ArrayBufferCreationMode mode = ArrayBufferCreationMode::kExternalized);
|
|
|
|
/**
|
|
* Returns true if SharedArrayBuffer is externalized, that is, does not
|
|
* own its memory block.
|
|
*/
|
|
bool IsExternal() const;
|
|
|
|
/**
|
|
* Make this SharedArrayBuffer external. The pointer to underlying memory
|
|
* block and byte length are returned as |Contents| structure. After
|
|
* SharedArrayBuffer had been etxrenalized, it does no longer owns the memory
|
|
* block. The caller should take steps to free memory when it is no longer
|
|
* needed.
|
|
*
|
|
* The memory block is guaranteed to be allocated with |Allocator::Allocate|
|
|
* by the allocator specified in
|
|
* v8::Isolate::CreateParams::array_buffer_allocator.
|
|
*
|
|
*/
|
|
Contents Externalize();
|
|
|
|
/**
|
|
* Get a pointer to the ArrayBuffer's underlying memory block without
|
|
* externalizing it. If the ArrayBuffer is not externalized, this pointer
|
|
* will become invalid as soon as the ArrayBuffer became garbage collected.
|
|
*
|
|
* The embedder should make sure to hold a strong reference to the
|
|
* ArrayBuffer while accessing this pointer.
|
|
*
|
|
* The memory block is guaranteed to be allocated with |Allocator::Allocate|
|
|
* by the allocator specified in
|
|
* v8::Isolate::CreateParams::array_buffer_allocator.
|
|
*/
|
|
Contents GetContents();
|
|
|
|
V8_INLINE static SharedArrayBuffer* Cast(Value* obj);
|
|
|
|
static const int kInternalFieldCount = V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT;
|
|
|
|
private:
|
|
SharedArrayBuffer();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of the built-in Date constructor (ECMA-262, 15.9).
|
|
*/
|
|
class V8_EXPORT Date : public Object {
|
|
public:
|
|
static V8_DEPRECATE_SOON("Use maybe version.",
|
|
Local<Value> New(Isolate* isolate, double time));
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<Value> New(Local<Context> context,
|
|
double time);
|
|
|
|
/**
|
|
* A specialization of Value::NumberValue that is more efficient
|
|
* because we know the structure of this object.
|
|
*/
|
|
double ValueOf() const;
|
|
|
|
V8_INLINE static Date* Cast(v8::Value* obj);
|
|
|
|
/**
|
|
* Notification that the embedder has changed the time zone,
|
|
* daylight savings time, or other date / time configuration
|
|
* parameters. V8 keeps a cache of various values used for
|
|
* date / time computation. This notification will reset
|
|
* those cached values for the current context so that date /
|
|
* time configuration changes would be reflected in the Date
|
|
* object.
|
|
*
|
|
* This API should not be called more than needed as it will
|
|
* negatively impact the performance of date operations.
|
|
*/
|
|
static void DateTimeConfigurationChangeNotification(Isolate* isolate);
|
|
|
|
private:
|
|
static void CheckCast(v8::Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A Number object (ECMA-262, 4.3.21).
|
|
*/
|
|
class V8_EXPORT NumberObject : public Object {
|
|
public:
|
|
static Local<Value> New(Isolate* isolate, double value);
|
|
|
|
double ValueOf() const;
|
|
|
|
V8_INLINE static NumberObject* Cast(v8::Value* obj);
|
|
|
|
private:
|
|
static void CheckCast(v8::Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A Boolean object (ECMA-262, 4.3.15).
|
|
*/
|
|
class V8_EXPORT BooleanObject : public Object {
|
|
public:
|
|
static Local<Value> New(bool value);
|
|
|
|
bool ValueOf() const;
|
|
|
|
V8_INLINE static BooleanObject* Cast(v8::Value* obj);
|
|
|
|
private:
|
|
static void CheckCast(v8::Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A String object (ECMA-262, 4.3.18).
|
|
*/
|
|
class V8_EXPORT StringObject : public Object {
|
|
public:
|
|
static Local<Value> New(Local<String> value);
|
|
|
|
Local<String> ValueOf() const;
|
|
|
|
V8_INLINE static StringObject* Cast(v8::Value* obj);
|
|
|
|
private:
|
|
static void CheckCast(v8::Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A Symbol object (ECMA-262 edition 6).
|
|
*
|
|
* This is an experimental feature. Use at your own risk.
|
|
*/
|
|
class V8_EXPORT SymbolObject : public Object {
|
|
public:
|
|
static Local<Value> New(Isolate* isolate, Local<Symbol> value);
|
|
|
|
Local<Symbol> ValueOf() const;
|
|
|
|
V8_INLINE static SymbolObject* Cast(v8::Value* obj);
|
|
|
|
private:
|
|
static void CheckCast(v8::Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of the built-in RegExp constructor (ECMA-262, 15.10).
|
|
*/
|
|
class V8_EXPORT RegExp : public Object {
|
|
public:
|
|
/**
|
|
* Regular expression flag bits. They can be or'ed to enable a set
|
|
* of flags.
|
|
*/
|
|
enum Flags {
|
|
kNone = 0,
|
|
kGlobal = 1,
|
|
kIgnoreCase = 2,
|
|
kMultiline = 4
|
|
};
|
|
|
|
/**
|
|
* Creates a regular expression from the given pattern string and
|
|
* the flags bit field. May throw a JavaScript exception as
|
|
* described in ECMA-262, 15.10.4.1.
|
|
*
|
|
* For example,
|
|
* RegExp::New(v8::String::New("foo"),
|
|
* static_cast<RegExp::Flags>(kGlobal | kMultiline))
|
|
* is equivalent to evaluating "/foo/gm".
|
|
*/
|
|
static V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<RegExp> New(Local<String> pattern,
|
|
Flags flags));
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<RegExp> New(Local<Context> context,
|
|
Local<String> pattern,
|
|
Flags flags);
|
|
|
|
/**
|
|
* Returns the value of the source property: a string representing
|
|
* the regular expression.
|
|
*/
|
|
Local<String> GetSource() const;
|
|
|
|
/**
|
|
* Returns the flags bit field.
|
|
*/
|
|
Flags GetFlags() const;
|
|
|
|
V8_INLINE static RegExp* Cast(v8::Value* obj);
|
|
|
|
private:
|
|
static void CheckCast(v8::Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A JavaScript value that wraps a C++ void*. This type of value is mainly used
|
|
* to associate C++ data structures with JavaScript objects.
|
|
*/
|
|
class V8_EXPORT External : public Value {
|
|
public:
|
|
static Local<External> New(Isolate* isolate, void* value);
|
|
V8_INLINE static External* Cast(Value* obj);
|
|
void* Value() const;
|
|
private:
|
|
static void CheckCast(v8::Value* obj);
|
|
};
|
|
|
|
|
|
// --- Templates ---
|
|
|
|
|
|
/**
|
|
* The superclass of object and function templates.
|
|
*/
|
|
class V8_EXPORT Template : public Data {
|
|
public:
|
|
/** Adds a property to each instance created by this template.*/
|
|
void Set(Local<Name> name, Local<Data> value,
|
|
PropertyAttribute attributes = None);
|
|
V8_INLINE void Set(Isolate* isolate, const char* name, Local<Data> value);
|
|
|
|
void SetAccessorProperty(
|
|
Local<Name> name,
|
|
Local<FunctionTemplate> getter = Local<FunctionTemplate>(),
|
|
Local<FunctionTemplate> setter = Local<FunctionTemplate>(),
|
|
PropertyAttribute attribute = None,
|
|
AccessControl settings = DEFAULT);
|
|
|
|
/**
|
|
* Whenever the property with the given name is accessed on objects
|
|
* created from this Template the getter and setter callbacks
|
|
* are called instead of getting and setting the property directly
|
|
* on the JavaScript object.
|
|
*
|
|
* \param name The name of the property for which an accessor is added.
|
|
* \param getter The callback to invoke when getting the property.
|
|
* \param setter The callback to invoke when setting the property.
|
|
* \param data A piece of data that will be passed to the getter and setter
|
|
* callbacks whenever they are invoked.
|
|
* \param settings Access control settings for the accessor. This is a bit
|
|
* field consisting of one of more of
|
|
* DEFAULT = 0, ALL_CAN_READ = 1, or ALL_CAN_WRITE = 2.
|
|
* The default is to not allow cross-context access.
|
|
* ALL_CAN_READ means that all cross-context reads are allowed.
|
|
* ALL_CAN_WRITE means that all cross-context writes are allowed.
|
|
* The combination ALL_CAN_READ | ALL_CAN_WRITE can be used to allow all
|
|
* cross-context access.
|
|
* \param attribute The attributes of the property for which an accessor
|
|
* is added.
|
|
* \param signature The signature describes valid receivers for the accessor
|
|
* and is used to perform implicit instance checks against them. If the
|
|
* receiver is incompatible (i.e. is not an instance of the constructor as
|
|
* defined by FunctionTemplate::HasInstance()), an implicit TypeError is
|
|
* thrown and no callback is invoked.
|
|
*/
|
|
void SetNativeDataProperty(
|
|
Local<String> name, AccessorGetterCallback getter,
|
|
AccessorSetterCallback setter = 0,
|
|
// TODO(dcarney): gcc can't handle Local below
|
|
Local<Value> data = Local<Value>(), PropertyAttribute attribute = None,
|
|
Local<AccessorSignature> signature = Local<AccessorSignature>(),
|
|
AccessControl settings = DEFAULT);
|
|
void SetNativeDataProperty(
|
|
Local<Name> name, AccessorNameGetterCallback getter,
|
|
AccessorNameSetterCallback setter = 0,
|
|
// TODO(dcarney): gcc can't handle Local below
|
|
Local<Value> data = Local<Value>(), PropertyAttribute attribute = None,
|
|
Local<AccessorSignature> signature = Local<AccessorSignature>(),
|
|
AccessControl settings = DEFAULT);
|
|
|
|
private:
|
|
Template();
|
|
|
|
friend class ObjectTemplate;
|
|
friend class FunctionTemplate;
|
|
};
|
|
|
|
|
|
/**
|
|
* NamedProperty[Getter|Setter] are used as interceptors on object.
|
|
* See ObjectTemplate::SetNamedPropertyHandler.
|
|
*/
|
|
typedef void (*NamedPropertyGetterCallback)(
|
|
Local<String> property,
|
|
const PropertyCallbackInfo<Value>& info);
|
|
|
|
|
|
/**
|
|
* Returns the value if the setter intercepts the request.
|
|
* Otherwise, returns an empty handle.
|
|
*/
|
|
typedef void (*NamedPropertySetterCallback)(
|
|
Local<String> property,
|
|
Local<Value> value,
|
|
const PropertyCallbackInfo<Value>& info);
|
|
|
|
|
|
/**
|
|
* Returns a non-empty handle if the interceptor intercepts the request.
|
|
* The result is an integer encoding property attributes (like v8::None,
|
|
* v8::DontEnum, etc.)
|
|
*/
|
|
typedef void (*NamedPropertyQueryCallback)(
|
|
Local<String> property,
|
|
const PropertyCallbackInfo<Integer>& info);
|
|
|
|
|
|
/**
|
|
* Returns a non-empty handle if the deleter intercepts the request.
|
|
* The return value is true if the property could be deleted and false
|
|
* otherwise.
|
|
*/
|
|
typedef void (*NamedPropertyDeleterCallback)(
|
|
Local<String> property,
|
|
const PropertyCallbackInfo<Boolean>& info);
|
|
|
|
|
|
/**
|
|
* Returns an array containing the names of the properties the named
|
|
* property getter intercepts.
|
|
*/
|
|
typedef void (*NamedPropertyEnumeratorCallback)(
|
|
const PropertyCallbackInfo<Array>& info);
|
|
|
|
|
|
// TODO(dcarney): Deprecate and remove previous typedefs, and replace
|
|
// GenericNamedPropertyFooCallback with just NamedPropertyFooCallback.
|
|
/**
|
|
* GenericNamedProperty[Getter|Setter] are used as interceptors on object.
|
|
* See ObjectTemplate::SetNamedPropertyHandler.
|
|
*/
|
|
typedef void (*GenericNamedPropertyGetterCallback)(
|
|
Local<Name> property, const PropertyCallbackInfo<Value>& info);
|
|
|
|
|
|
/**
|
|
* Returns the value if the setter intercepts the request.
|
|
* Otherwise, returns an empty handle.
|
|
*/
|
|
typedef void (*GenericNamedPropertySetterCallback)(
|
|
Local<Name> property, Local<Value> value,
|
|
const PropertyCallbackInfo<Value>& info);
|
|
|
|
|
|
/**
|
|
* Returns a non-empty handle if the interceptor intercepts the request.
|
|
* The result is an integer encoding property attributes (like v8::None,
|
|
* v8::DontEnum, etc.)
|
|
*/
|
|
typedef void (*GenericNamedPropertyQueryCallback)(
|
|
Local<Name> property, const PropertyCallbackInfo<Integer>& info);
|
|
|
|
|
|
/**
|
|
* Returns a non-empty handle if the deleter intercepts the request.
|
|
* The return value is true if the property could be deleted and false
|
|
* otherwise.
|
|
*/
|
|
typedef void (*GenericNamedPropertyDeleterCallback)(
|
|
Local<Name> property, const PropertyCallbackInfo<Boolean>& info);
|
|
|
|
|
|
/**
|
|
* Returns an array containing the names of the properties the named
|
|
* property getter intercepts.
|
|
*/
|
|
typedef void (*GenericNamedPropertyEnumeratorCallback)(
|
|
const PropertyCallbackInfo<Array>& info);
|
|
|
|
|
|
/**
|
|
* Returns the value of the property if the getter intercepts the
|
|
* request. Otherwise, returns an empty handle.
|
|
*/
|
|
typedef void (*IndexedPropertyGetterCallback)(
|
|
uint32_t index,
|
|
const PropertyCallbackInfo<Value>& info);
|
|
|
|
|
|
/**
|
|
* Returns the value if the setter intercepts the request.
|
|
* Otherwise, returns an empty handle.
|
|
*/
|
|
typedef void (*IndexedPropertySetterCallback)(
|
|
uint32_t index,
|
|
Local<Value> value,
|
|
const PropertyCallbackInfo<Value>& info);
|
|
|
|
|
|
/**
|
|
* Returns a non-empty handle if the interceptor intercepts the request.
|
|
* The result is an integer encoding property attributes.
|
|
*/
|
|
typedef void (*IndexedPropertyQueryCallback)(
|
|
uint32_t index,
|
|
const PropertyCallbackInfo<Integer>& info);
|
|
|
|
|
|
/**
|
|
* Returns a non-empty handle if the deleter intercepts the request.
|
|
* The return value is true if the property could be deleted and false
|
|
* otherwise.
|
|
*/
|
|
typedef void (*IndexedPropertyDeleterCallback)(
|
|
uint32_t index,
|
|
const PropertyCallbackInfo<Boolean>& info);
|
|
|
|
|
|
/**
|
|
* Returns an array containing the indices of the properties the
|
|
* indexed property getter intercepts.
|
|
*/
|
|
typedef void (*IndexedPropertyEnumeratorCallback)(
|
|
const PropertyCallbackInfo<Array>& info);
|
|
|
|
|
|
/**
|
|
* Access type specification.
|
|
*/
|
|
enum AccessType {
|
|
ACCESS_GET,
|
|
ACCESS_SET,
|
|
ACCESS_HAS,
|
|
ACCESS_DELETE,
|
|
ACCESS_KEYS
|
|
};
|
|
|
|
|
|
/**
|
|
* Returns true if cross-context access should be allowed to the named
|
|
* property with the given key on the host object.
|
|
*/
|
|
typedef bool (*NamedSecurityCallback)(Local<Object> host,
|
|
Local<Value> key,
|
|
AccessType type,
|
|
Local<Value> data);
|
|
|
|
|
|
/**
|
|
* Returns true if cross-context access should be allowed to the indexed
|
|
* property with the given index on the host object.
|
|
*/
|
|
typedef bool (*IndexedSecurityCallback)(Local<Object> host,
|
|
uint32_t index,
|
|
AccessType type,
|
|
Local<Value> data);
|
|
|
|
|
|
/**
|
|
* A FunctionTemplate is used to create functions at runtime. There
|
|
* can only be one function created from a FunctionTemplate in a
|
|
* context. The lifetime of the created function is equal to the
|
|
* lifetime of the context. So in case the embedder needs to create
|
|
* temporary functions that can be collected using Scripts is
|
|
* preferred.
|
|
*
|
|
* Any modification of a FunctionTemplate after first instantiation will trigger
|
|
*a crash.
|
|
*
|
|
* A FunctionTemplate can have properties, these properties are added to the
|
|
* function object when it is created.
|
|
*
|
|
* A FunctionTemplate has a corresponding instance template which is
|
|
* used to create object instances when the function is used as a
|
|
* constructor. Properties added to the instance template are added to
|
|
* each object instance.
|
|
*
|
|
* A FunctionTemplate can have a prototype template. The prototype template
|
|
* is used to create the prototype object of the function.
|
|
*
|
|
* The following example shows how to use a FunctionTemplate:
|
|
*
|
|
* \code
|
|
* v8::Local<v8::FunctionTemplate> t = v8::FunctionTemplate::New();
|
|
* t->Set("func_property", v8::Number::New(1));
|
|
*
|
|
* v8::Local<v8::Template> proto_t = t->PrototypeTemplate();
|
|
* proto_t->Set("proto_method", v8::FunctionTemplate::New(InvokeCallback));
|
|
* proto_t->Set("proto_const", v8::Number::New(2));
|
|
*
|
|
* v8::Local<v8::ObjectTemplate> instance_t = t->InstanceTemplate();
|
|
* instance_t->SetAccessor("instance_accessor", InstanceAccessorCallback);
|
|
* instance_t->SetNamedPropertyHandler(PropertyHandlerCallback, ...);
|
|
* instance_t->Set("instance_property", Number::New(3));
|
|
*
|
|
* v8::Local<v8::Function> function = t->GetFunction();
|
|
* v8::Local<v8::Object> instance = function->NewInstance();
|
|
* \endcode
|
|
*
|
|
* Let's use "function" as the JS variable name of the function object
|
|
* and "instance" for the instance object created above. The function
|
|
* and the instance will have the following properties:
|
|
*
|
|
* \code
|
|
* func_property in function == true;
|
|
* function.func_property == 1;
|
|
*
|
|
* function.prototype.proto_method() invokes 'InvokeCallback'
|
|
* function.prototype.proto_const == 2;
|
|
*
|
|
* instance instanceof function == true;
|
|
* instance.instance_accessor calls 'InstanceAccessorCallback'
|
|
* instance.instance_property == 3;
|
|
* \endcode
|
|
*
|
|
* A FunctionTemplate can inherit from another one by calling the
|
|
* FunctionTemplate::Inherit method. The following graph illustrates
|
|
* the semantics of inheritance:
|
|
*
|
|
* \code
|
|
* FunctionTemplate Parent -> Parent() . prototype -> { }
|
|
* ^ ^
|
|
* | Inherit(Parent) | .__proto__
|
|
* | |
|
|
* FunctionTemplate Child -> Child() . prototype -> { }
|
|
* \endcode
|
|
*
|
|
* A FunctionTemplate 'Child' inherits from 'Parent', the prototype
|
|
* object of the Child() function has __proto__ pointing to the
|
|
* Parent() function's prototype object. An instance of the Child
|
|
* function has all properties on Parent's instance templates.
|
|
*
|
|
* Let Parent be the FunctionTemplate initialized in the previous
|
|
* section and create a Child FunctionTemplate by:
|
|
*
|
|
* \code
|
|
* Local<FunctionTemplate> parent = t;
|
|
* Local<FunctionTemplate> child = FunctionTemplate::New();
|
|
* child->Inherit(parent);
|
|
*
|
|
* Local<Function> child_function = child->GetFunction();
|
|
* Local<Object> child_instance = child_function->NewInstance();
|
|
* \endcode
|
|
*
|
|
* The Child function and Child instance will have the following
|
|
* properties:
|
|
*
|
|
* \code
|
|
* child_func.prototype.__proto__ == function.prototype;
|
|
* child_instance.instance_accessor calls 'InstanceAccessorCallback'
|
|
* child_instance.instance_property == 3;
|
|
* \endcode
|
|
*/
|
|
class V8_EXPORT FunctionTemplate : public Template {
|
|
public:
|
|
/** Creates a function template.*/
|
|
static Local<FunctionTemplate> New(
|
|
Isolate* isolate, FunctionCallback callback = 0,
|
|
Local<Value> data = Local<Value>(),
|
|
Local<Signature> signature = Local<Signature>(), int length = 0);
|
|
|
|
/** Returns the unique function instance in the current execution context.*/
|
|
V8_DEPRECATE_SOON("Use maybe version", Local<Function> GetFunction());
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Function> GetFunction(
|
|
Local<Context> context);
|
|
|
|
/**
|
|
* Set the call-handler callback for a FunctionTemplate. This
|
|
* callback is called whenever the function created from this
|
|
* FunctionTemplate is called.
|
|
*/
|
|
void SetCallHandler(FunctionCallback callback,
|
|
Local<Value> data = Local<Value>());
|
|
|
|
/** Set the predefined length property for the FunctionTemplate. */
|
|
void SetLength(int length);
|
|
|
|
/** Get the InstanceTemplate. */
|
|
Local<ObjectTemplate> InstanceTemplate();
|
|
|
|
/** Causes the function template to inherit from a parent function template.*/
|
|
void Inherit(Local<FunctionTemplate> parent);
|
|
|
|
/**
|
|
* A PrototypeTemplate is the template used to create the prototype object
|
|
* of the function created by this template.
|
|
*/
|
|
Local<ObjectTemplate> PrototypeTemplate();
|
|
|
|
/**
|
|
* Set the class name of the FunctionTemplate. This is used for
|
|
* printing objects created with the function created from the
|
|
* FunctionTemplate as its constructor.
|
|
*/
|
|
void SetClassName(Local<String> name);
|
|
|
|
|
|
/**
|
|
* When set to true, no access check will be performed on the receiver of a
|
|
* function call. Currently defaults to true, but this is subject to change.
|
|
*/
|
|
void SetAcceptAnyReceiver(bool value);
|
|
|
|
/**
|
|
* Determines whether the __proto__ accessor ignores instances of
|
|
* the function template. If instances of the function template are
|
|
* ignored, __proto__ skips all instances and instead returns the
|
|
* next object in the prototype chain.
|
|
*
|
|
* Call with a value of true to make the __proto__ accessor ignore
|
|
* instances of the function template. Call with a value of false
|
|
* to make the __proto__ accessor not ignore instances of the
|
|
* function template. By default, instances of a function template
|
|
* are not ignored.
|
|
*/
|
|
void SetHiddenPrototype(bool value);
|
|
|
|
/**
|
|
* Sets the ReadOnly flag in the attributes of the 'prototype' property
|
|
* of functions created from this FunctionTemplate to true.
|
|
*/
|
|
void ReadOnlyPrototype();
|
|
|
|
/**
|
|
* Removes the prototype property from functions created from this
|
|
* FunctionTemplate.
|
|
*/
|
|
void RemovePrototype();
|
|
|
|
/**
|
|
* Returns true if the given object is an instance of this function
|
|
* template.
|
|
*/
|
|
bool HasInstance(Local<Value> object);
|
|
|
|
private:
|
|
FunctionTemplate();
|
|
friend class Context;
|
|
friend class ObjectTemplate;
|
|
};
|
|
|
|
|
|
enum class PropertyHandlerFlags {
|
|
kNone = 0,
|
|
// See ALL_CAN_READ above.
|
|
kAllCanRead = 1,
|
|
// Will not call into interceptor for properties on the receiver or prototype
|
|
// chain. Currently only valid for named interceptors.
|
|
kNonMasking = 1 << 1,
|
|
// Will not call into interceptor for symbol lookup. Only meaningful for
|
|
// named interceptors.
|
|
kOnlyInterceptStrings = 1 << 2,
|
|
};
|
|
|
|
|
|
struct NamedPropertyHandlerConfiguration {
|
|
NamedPropertyHandlerConfiguration(
|
|
/** Note: getter is required **/
|
|
GenericNamedPropertyGetterCallback getter = 0,
|
|
GenericNamedPropertySetterCallback setter = 0,
|
|
GenericNamedPropertyQueryCallback query = 0,
|
|
GenericNamedPropertyDeleterCallback deleter = 0,
|
|
GenericNamedPropertyEnumeratorCallback enumerator = 0,
|
|
Local<Value> data = Local<Value>(),
|
|
PropertyHandlerFlags flags = PropertyHandlerFlags::kNone)
|
|
: getter(getter),
|
|
setter(setter),
|
|
query(query),
|
|
deleter(deleter),
|
|
enumerator(enumerator),
|
|
data(data),
|
|
flags(flags) {}
|
|
|
|
GenericNamedPropertyGetterCallback getter;
|
|
GenericNamedPropertySetterCallback setter;
|
|
GenericNamedPropertyQueryCallback query;
|
|
GenericNamedPropertyDeleterCallback deleter;
|
|
GenericNamedPropertyEnumeratorCallback enumerator;
|
|
Local<Value> data;
|
|
PropertyHandlerFlags flags;
|
|
};
|
|
|
|
|
|
struct IndexedPropertyHandlerConfiguration {
|
|
IndexedPropertyHandlerConfiguration(
|
|
/** Note: getter is required **/
|
|
IndexedPropertyGetterCallback getter = 0,
|
|
IndexedPropertySetterCallback setter = 0,
|
|
IndexedPropertyQueryCallback query = 0,
|
|
IndexedPropertyDeleterCallback deleter = 0,
|
|
IndexedPropertyEnumeratorCallback enumerator = 0,
|
|
Local<Value> data = Local<Value>(),
|
|
PropertyHandlerFlags flags = PropertyHandlerFlags::kNone)
|
|
: getter(getter),
|
|
setter(setter),
|
|
query(query),
|
|
deleter(deleter),
|
|
enumerator(enumerator),
|
|
data(data),
|
|
flags(flags) {}
|
|
|
|
IndexedPropertyGetterCallback getter;
|
|
IndexedPropertySetterCallback setter;
|
|
IndexedPropertyQueryCallback query;
|
|
IndexedPropertyDeleterCallback deleter;
|
|
IndexedPropertyEnumeratorCallback enumerator;
|
|
Local<Value> data;
|
|
PropertyHandlerFlags flags;
|
|
};
|
|
|
|
|
|
/**
|
|
* An ObjectTemplate is used to create objects at runtime.
|
|
*
|
|
* Properties added to an ObjectTemplate are added to each object
|
|
* created from the ObjectTemplate.
|
|
*/
|
|
class V8_EXPORT ObjectTemplate : public Template {
|
|
public:
|
|
/** Creates an ObjectTemplate. */
|
|
static Local<ObjectTemplate> New(
|
|
Isolate* isolate,
|
|
Local<FunctionTemplate> constructor = Local<FunctionTemplate>());
|
|
static V8_DEPRECATE_SOON("Use isolate version", Local<ObjectTemplate> New());
|
|
|
|
/** Creates a new instance of this template.*/
|
|
V8_DEPRECATE_SOON("Use maybe version", Local<Object> NewInstance());
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Object> NewInstance(Local<Context> context);
|
|
|
|
/**
|
|
* Sets an accessor on the object template.
|
|
*
|
|
* Whenever the property with the given name is accessed on objects
|
|
* created from this ObjectTemplate the getter and setter callbacks
|
|
* are called instead of getting and setting the property directly
|
|
* on the JavaScript object.
|
|
*
|
|
* \param name The name of the property for which an accessor is added.
|
|
* \param getter The callback to invoke when getting the property.
|
|
* \param setter The callback to invoke when setting the property.
|
|
* \param data A piece of data that will be passed to the getter and setter
|
|
* callbacks whenever they are invoked.
|
|
* \param settings Access control settings for the accessor. This is a bit
|
|
* field consisting of one of more of
|
|
* DEFAULT = 0, ALL_CAN_READ = 1, or ALL_CAN_WRITE = 2.
|
|
* The default is to not allow cross-context access.
|
|
* ALL_CAN_READ means that all cross-context reads are allowed.
|
|
* ALL_CAN_WRITE means that all cross-context writes are allowed.
|
|
* The combination ALL_CAN_READ | ALL_CAN_WRITE can be used to allow all
|
|
* cross-context access.
|
|
* \param attribute The attributes of the property for which an accessor
|
|
* is added.
|
|
* \param signature The signature describes valid receivers for the accessor
|
|
* and is used to perform implicit instance checks against them. If the
|
|
* receiver is incompatible (i.e. is not an instance of the constructor as
|
|
* defined by FunctionTemplate::HasInstance()), an implicit TypeError is
|
|
* thrown and no callback is invoked.
|
|
*/
|
|
void SetAccessor(
|
|
Local<String> name, AccessorGetterCallback getter,
|
|
AccessorSetterCallback setter = 0, Local<Value> data = Local<Value>(),
|
|
AccessControl settings = DEFAULT, PropertyAttribute attribute = None,
|
|
Local<AccessorSignature> signature = Local<AccessorSignature>());
|
|
void SetAccessor(
|
|
Local<Name> name, AccessorNameGetterCallback getter,
|
|
AccessorNameSetterCallback setter = 0, Local<Value> data = Local<Value>(),
|
|
AccessControl settings = DEFAULT, PropertyAttribute attribute = None,
|
|
Local<AccessorSignature> signature = Local<AccessorSignature>());
|
|
|
|
/**
|
|
* Sets a named property handler on the object template.
|
|
*
|
|
* Whenever a property whose name is a string is accessed on objects created
|
|
* from this object template, the provided callback is invoked instead of
|
|
* accessing the property directly on the JavaScript object.
|
|
*
|
|
* Note that new code should use the second version that can intercept
|
|
* symbol-named properties as well as string-named properties.
|
|
*
|
|
* \param getter The callback to invoke when getting a property.
|
|
* \param setter The callback to invoke when setting a property.
|
|
* \param query The callback to invoke to check if a property is present,
|
|
* and if present, get its attributes.
|
|
* \param deleter The callback to invoke when deleting a property.
|
|
* \param enumerator The callback to invoke to enumerate all the named
|
|
* properties of an object.
|
|
* \param data A piece of data that will be passed to the callbacks
|
|
* whenever they are invoked.
|
|
*/
|
|
// TODO(dcarney): deprecate
|
|
void SetNamedPropertyHandler(NamedPropertyGetterCallback getter,
|
|
NamedPropertySetterCallback setter = 0,
|
|
NamedPropertyQueryCallback query = 0,
|
|
NamedPropertyDeleterCallback deleter = 0,
|
|
NamedPropertyEnumeratorCallback enumerator = 0,
|
|
Local<Value> data = Local<Value>());
|
|
void SetHandler(const NamedPropertyHandlerConfiguration& configuration);
|
|
|
|
/**
|
|
* Sets an indexed property handler on the object template.
|
|
*
|
|
* Whenever an indexed property is accessed on objects created from
|
|
* this object template, the provided callback is invoked instead of
|
|
* accessing the property directly on the JavaScript object.
|
|
*
|
|
* \param getter The callback to invoke when getting a property.
|
|
* \param setter The callback to invoke when setting a property.
|
|
* \param query The callback to invoke to check if an object has a property.
|
|
* \param deleter The callback to invoke when deleting a property.
|
|
* \param enumerator The callback to invoke to enumerate all the indexed
|
|
* properties of an object.
|
|
* \param data A piece of data that will be passed to the callbacks
|
|
* whenever they are invoked.
|
|
*/
|
|
void SetHandler(const IndexedPropertyHandlerConfiguration& configuration);
|
|
// TODO(dcarney): deprecate
|
|
void SetIndexedPropertyHandler(
|
|
IndexedPropertyGetterCallback getter,
|
|
IndexedPropertySetterCallback setter = 0,
|
|
IndexedPropertyQueryCallback query = 0,
|
|
IndexedPropertyDeleterCallback deleter = 0,
|
|
IndexedPropertyEnumeratorCallback enumerator = 0,
|
|
Local<Value> data = Local<Value>()) {
|
|
SetHandler(IndexedPropertyHandlerConfiguration(getter, setter, query,
|
|
deleter, enumerator, data));
|
|
}
|
|
/**
|
|
* Sets the callback to be used when calling instances created from
|
|
* this template as a function. If no callback is set, instances
|
|
* behave like normal JavaScript objects that cannot be called as a
|
|
* function.
|
|
*/
|
|
void SetCallAsFunctionHandler(FunctionCallback callback,
|
|
Local<Value> data = Local<Value>());
|
|
|
|
/**
|
|
* Mark object instances of the template as undetectable.
|
|
*
|
|
* In many ways, undetectable objects behave as though they are not
|
|
* there. They behave like 'undefined' in conditionals and when
|
|
* printed. However, properties can be accessed and called as on
|
|
* normal objects.
|
|
*/
|
|
void MarkAsUndetectable();
|
|
|
|
/**
|
|
* Sets access check callbacks on the object template and enables
|
|
* access checks.
|
|
*
|
|
* When accessing properties on instances of this object template,
|
|
* the access check callback will be called to determine whether or
|
|
* not to allow cross-context access to the properties.
|
|
*/
|
|
void SetAccessCheckCallbacks(NamedSecurityCallback named_handler,
|
|
IndexedSecurityCallback indexed_handler,
|
|
Local<Value> data = Local<Value>());
|
|
|
|
/**
|
|
* Gets the number of internal fields for objects generated from
|
|
* this template.
|
|
*/
|
|
int InternalFieldCount();
|
|
|
|
/**
|
|
* Sets the number of internal fields for objects generated from
|
|
* this template.
|
|
*/
|
|
void SetInternalFieldCount(int value);
|
|
|
|
private:
|
|
ObjectTemplate();
|
|
static Local<ObjectTemplate> New(internal::Isolate* isolate,
|
|
Local<FunctionTemplate> constructor);
|
|
friend class FunctionTemplate;
|
|
};
|
|
|
|
|
|
/**
|
|
* A Signature specifies which receiver is valid for a function.
|
|
*/
|
|
class V8_EXPORT Signature : public Data {
|
|
public:
|
|
static Local<Signature> New(
|
|
Isolate* isolate,
|
|
Local<FunctionTemplate> receiver = Local<FunctionTemplate>());
|
|
|
|
private:
|
|
Signature();
|
|
};
|
|
|
|
|
|
/**
|
|
* An AccessorSignature specifies which receivers are valid parameters
|
|
* to an accessor callback.
|
|
*/
|
|
class V8_EXPORT AccessorSignature : public Data {
|
|
public:
|
|
static Local<AccessorSignature> New(
|
|
Isolate* isolate,
|
|
Local<FunctionTemplate> receiver = Local<FunctionTemplate>());
|
|
|
|
private:
|
|
AccessorSignature();
|
|
};
|
|
|
|
|
|
/**
|
|
* A utility for determining the type of objects based on the template
|
|
* they were constructed from.
|
|
*/
|
|
class V8_EXPORT TypeSwitch : public Data {
|
|
public:
|
|
static Local<TypeSwitch> New(Local<FunctionTemplate> type);
|
|
static Local<TypeSwitch> New(int argc, Local<FunctionTemplate> types[]);
|
|
int match(Local<Value> value);
|
|
|
|
private:
|
|
TypeSwitch();
|
|
};
|
|
|
|
|
|
// --- Extensions ---
|
|
|
|
class V8_EXPORT ExternalOneByteStringResourceImpl
|
|
: public String::ExternalOneByteStringResource {
|
|
public:
|
|
ExternalOneByteStringResourceImpl() : data_(0), length_(0) {}
|
|
ExternalOneByteStringResourceImpl(const char* data, size_t length)
|
|
: data_(data), length_(length) {}
|
|
const char* data() const { return data_; }
|
|
size_t length() const { return length_; }
|
|
|
|
private:
|
|
const char* data_;
|
|
size_t length_;
|
|
};
|
|
|
|
/**
|
|
* Ignore
|
|
*/
|
|
class V8_EXPORT Extension { // NOLINT
|
|
public:
|
|
// Note that the strings passed into this constructor must live as long
|
|
// as the Extension itself.
|
|
Extension(const char* name,
|
|
const char* source = 0,
|
|
int dep_count = 0,
|
|
const char** deps = 0,
|
|
int source_length = -1);
|
|
virtual ~Extension() { }
|
|
virtual v8::Local<v8::FunctionTemplate> GetNativeFunctionTemplate(
|
|
v8::Isolate* isolate, v8::Local<v8::String> name) {
|
|
return v8::Local<v8::FunctionTemplate>();
|
|
}
|
|
|
|
const char* name() const { return name_; }
|
|
size_t source_length() const { return source_length_; }
|
|
const String::ExternalOneByteStringResource* source() const {
|
|
return &source_; }
|
|
int dependency_count() { return dep_count_; }
|
|
const char** dependencies() { return deps_; }
|
|
void set_auto_enable(bool value) { auto_enable_ = value; }
|
|
bool auto_enable() { return auto_enable_; }
|
|
|
|
private:
|
|
const char* name_;
|
|
size_t source_length_; // expected to initialize before source_
|
|
ExternalOneByteStringResourceImpl source_;
|
|
int dep_count_;
|
|
const char** deps_;
|
|
bool auto_enable_;
|
|
|
|
// Disallow copying and assigning.
|
|
Extension(const Extension&);
|
|
void operator=(const Extension&);
|
|
};
|
|
|
|
|
|
void V8_EXPORT RegisterExtension(Extension* extension);
|
|
|
|
|
|
// --- Statics ---
|
|
|
|
V8_INLINE Local<Primitive> Undefined(Isolate* isolate);
|
|
V8_INLINE Local<Primitive> Null(Isolate* isolate);
|
|
V8_INLINE Local<Boolean> True(Isolate* isolate);
|
|
V8_INLINE Local<Boolean> False(Isolate* isolate);
|
|
|
|
|
|
/**
|
|
* A set of constraints that specifies the limits of the runtime's memory use.
|
|
* You must set the heap size before initializing the VM - the size cannot be
|
|
* adjusted after the VM is initialized.
|
|
*
|
|
* If you are using threads then you should hold the V8::Locker lock while
|
|
* setting the stack limit and you must set a non-default stack limit separately
|
|
* for each thread.
|
|
*/
|
|
class V8_EXPORT ResourceConstraints {
|
|
public:
|
|
ResourceConstraints();
|
|
|
|
/**
|
|
* Configures the constraints with reasonable default values based on the
|
|
* capabilities of the current device the VM is running on.
|
|
*
|
|
* \param physical_memory The total amount of physical memory on the current
|
|
* device, in bytes.
|
|
* \param virtual_memory_limit The amount of virtual memory on the current
|
|
* device, in bytes, or zero, if there is no limit.
|
|
*/
|
|
void ConfigureDefaults(uint64_t physical_memory,
|
|
uint64_t virtual_memory_limit);
|
|
|
|
// Deprecated, will be removed soon.
|
|
V8_DEPRECATED("Use two-args version instead",
|
|
void ConfigureDefaults(uint64_t physical_memory,
|
|
uint64_t virtual_memory_limit,
|
|
uint32_t number_of_processors));
|
|
|
|
int max_semi_space_size() const { return max_semi_space_size_; }
|
|
void set_max_semi_space_size(int value) { max_semi_space_size_ = value; }
|
|
int max_old_space_size() const { return max_old_space_size_; }
|
|
void set_max_old_space_size(int value) { max_old_space_size_ = value; }
|
|
int max_executable_size() const { return max_executable_size_; }
|
|
void set_max_executable_size(int value) { max_executable_size_ = value; }
|
|
uint32_t* stack_limit() const { return stack_limit_; }
|
|
// Sets an address beyond which the VM's stack may not grow.
|
|
void set_stack_limit(uint32_t* value) { stack_limit_ = value; }
|
|
V8_DEPRECATED("Unused, will be removed", int max_available_threads() const) {
|
|
return max_available_threads_;
|
|
}
|
|
// Set the number of threads available to V8, assuming at least 1.
|
|
V8_DEPRECATED("Unused, will be removed",
|
|
void set_max_available_threads(int value)) {
|
|
max_available_threads_ = value;
|
|
}
|
|
size_t code_range_size() const { return code_range_size_; }
|
|
void set_code_range_size(size_t value) {
|
|
code_range_size_ = value;
|
|
}
|
|
|
|
private:
|
|
int max_semi_space_size_;
|
|
int max_old_space_size_;
|
|
int max_executable_size_;
|
|
uint32_t* stack_limit_;
|
|
int max_available_threads_;
|
|
size_t code_range_size_;
|
|
};
|
|
|
|
|
|
// --- Exceptions ---
|
|
|
|
|
|
typedef void (*FatalErrorCallback)(const char* location, const char* message);
|
|
|
|
|
|
typedef void (*MessageCallback)(Local<Message> message, Local<Value> error);
|
|
|
|
// --- Tracing ---
|
|
|
|
typedef void (*LogEventCallback)(const char* name, int event);
|
|
|
|
/**
|
|
* Create new error objects by calling the corresponding error object
|
|
* constructor with the message.
|
|
*/
|
|
class V8_EXPORT Exception {
|
|
public:
|
|
static Local<Value> RangeError(Local<String> message);
|
|
static Local<Value> ReferenceError(Local<String> message);
|
|
static Local<Value> SyntaxError(Local<String> message);
|
|
static Local<Value> TypeError(Local<String> message);
|
|
static Local<Value> Error(Local<String> message);
|
|
|
|
/**
|
|
* Creates an error message for the given exception.
|
|
* Will try to reconstruct the original stack trace from the exception value,
|
|
* or capture the current stack trace if not available.
|
|
*/
|
|
static Local<Message> CreateMessage(Local<Value> exception);
|
|
|
|
/**
|
|
* Returns the original stack trace that was captured at the creation time
|
|
* of a given exception, or an empty handle if not available.
|
|
*/
|
|
static Local<StackTrace> GetStackTrace(Local<Value> exception);
|
|
};
|
|
|
|
|
|
// --- Counters Callbacks ---
|
|
|
|
typedef int* (*CounterLookupCallback)(const char* name);
|
|
|
|
typedef void* (*CreateHistogramCallback)(const char* name,
|
|
int min,
|
|
int max,
|
|
size_t buckets);
|
|
|
|
typedef void (*AddHistogramSampleCallback)(void* histogram, int sample);
|
|
|
|
// --- Memory Allocation Callback ---
|
|
enum ObjectSpace {
|
|
kObjectSpaceNewSpace = 1 << 0,
|
|
kObjectSpaceOldSpace = 1 << 1,
|
|
kObjectSpaceCodeSpace = 1 << 2,
|
|
kObjectSpaceMapSpace = 1 << 3,
|
|
kObjectSpaceLoSpace = 1 << 4,
|
|
kObjectSpaceAll = kObjectSpaceNewSpace | kObjectSpaceOldSpace |
|
|
kObjectSpaceCodeSpace | kObjectSpaceMapSpace |
|
|
kObjectSpaceLoSpace
|
|
};
|
|
|
|
enum AllocationAction {
|
|
kAllocationActionAllocate = 1 << 0,
|
|
kAllocationActionFree = 1 << 1,
|
|
kAllocationActionAll = kAllocationActionAllocate | kAllocationActionFree
|
|
};
|
|
|
|
typedef void (*MemoryAllocationCallback)(ObjectSpace space,
|
|
AllocationAction action,
|
|
int size);
|
|
|
|
// --- Leave Script Callback ---
|
|
typedef void (*CallCompletedCallback)();
|
|
|
|
// --- Promise Reject Callback ---
|
|
enum PromiseRejectEvent {
|
|
kPromiseRejectWithNoHandler = 0,
|
|
kPromiseHandlerAddedAfterReject = 1
|
|
};
|
|
|
|
class PromiseRejectMessage {
|
|
public:
|
|
PromiseRejectMessage(Local<Promise> promise, PromiseRejectEvent event,
|
|
Local<Value> value, Local<StackTrace> stack_trace)
|
|
: promise_(promise),
|
|
event_(event),
|
|
value_(value),
|
|
stack_trace_(stack_trace) {}
|
|
|
|
V8_INLINE Local<Promise> GetPromise() const { return promise_; }
|
|
V8_INLINE PromiseRejectEvent GetEvent() const { return event_; }
|
|
V8_INLINE Local<Value> GetValue() const { return value_; }
|
|
|
|
// DEPRECATED. Use v8::Exception::CreateMessage(GetValue())->GetStackTrace()
|
|
V8_INLINE Local<StackTrace> GetStackTrace() const { return stack_trace_; }
|
|
|
|
private:
|
|
Local<Promise> promise_;
|
|
PromiseRejectEvent event_;
|
|
Local<Value> value_;
|
|
Local<StackTrace> stack_trace_;
|
|
};
|
|
|
|
typedef void (*PromiseRejectCallback)(PromiseRejectMessage message);
|
|
|
|
// --- Microtask Callback ---
|
|
typedef void (*MicrotaskCallback)(void* data);
|
|
|
|
// --- Failed Access Check Callback ---
|
|
typedef void (*FailedAccessCheckCallback)(Local<Object> target,
|
|
AccessType type,
|
|
Local<Value> data);
|
|
|
|
// --- AllowCodeGenerationFromStrings callbacks ---
|
|
|
|
/**
|
|
* Callback to check if code generation from strings is allowed. See
|
|
* Context::AllowCodeGenerationFromStrings.
|
|
*/
|
|
typedef bool (*AllowCodeGenerationFromStringsCallback)(Local<Context> context);
|
|
|
|
// --- Garbage Collection Callbacks ---
|
|
|
|
/**
|
|
* Applications can register callback functions which will be called
|
|
* before and after a garbage collection. Allocations are not
|
|
* allowed in the callback functions, you therefore cannot manipulate
|
|
* objects (set or delete properties for example) since it is possible
|
|
* such operations will result in the allocation of objects.
|
|
*/
|
|
enum GCType {
|
|
kGCTypeScavenge = 1 << 0,
|
|
kGCTypeMarkSweepCompact = 1 << 1,
|
|
kGCTypeAll = kGCTypeScavenge | kGCTypeMarkSweepCompact
|
|
};
|
|
|
|
enum GCCallbackFlags {
|
|
kNoGCCallbackFlags = 0,
|
|
kGCCallbackFlagCompacted = 1 << 0,
|
|
kGCCallbackFlagConstructRetainedObjectInfos = 1 << 1,
|
|
kGCCallbackFlagForced = 1 << 2
|
|
};
|
|
|
|
typedef void (*GCPrologueCallback)(GCType type, GCCallbackFlags flags);
|
|
typedef void (*GCEpilogueCallback)(GCType type, GCCallbackFlags flags);
|
|
|
|
typedef void (*InterruptCallback)(Isolate* isolate, void* data);
|
|
|
|
|
|
/**
|
|
* Collection of V8 heap information.
|
|
*
|
|
* Instances of this class can be passed to v8::V8::HeapStatistics to
|
|
* get heap statistics from V8.
|
|
*/
|
|
class V8_EXPORT HeapStatistics {
|
|
public:
|
|
HeapStatistics();
|
|
size_t total_heap_size() { return total_heap_size_; }
|
|
size_t total_heap_size_executable() { return total_heap_size_executable_; }
|
|
size_t total_physical_size() { return total_physical_size_; }
|
|
size_t total_available_size() { return total_available_size_; }
|
|
size_t used_heap_size() { return used_heap_size_; }
|
|
size_t heap_size_limit() { return heap_size_limit_; }
|
|
|
|
private:
|
|
size_t total_heap_size_;
|
|
size_t total_heap_size_executable_;
|
|
size_t total_physical_size_;
|
|
size_t total_available_size_;
|
|
size_t used_heap_size_;
|
|
size_t heap_size_limit_;
|
|
|
|
friend class V8;
|
|
friend class Isolate;
|
|
};
|
|
|
|
|
|
class V8_EXPORT HeapSpaceStatistics {
|
|
public:
|
|
HeapSpaceStatistics();
|
|
const char* space_name() { return space_name_; }
|
|
size_t space_size() { return space_size_; }
|
|
size_t space_used_size() { return space_used_size_; }
|
|
size_t space_available_size() { return space_available_size_; }
|
|
size_t physical_space_size() { return physical_space_size_; }
|
|
|
|
private:
|
|
const char* space_name_;
|
|
size_t space_size_;
|
|
size_t space_used_size_;
|
|
size_t space_available_size_;
|
|
size_t physical_space_size_;
|
|
|
|
friend class Isolate;
|
|
};
|
|
|
|
|
|
class V8_EXPORT HeapObjectStatistics {
|
|
public:
|
|
HeapObjectStatistics();
|
|
const char* object_type() { return object_type_; }
|
|
const char* object_sub_type() { return object_sub_type_; }
|
|
size_t object_count() { return object_count_; }
|
|
size_t object_size() { return object_size_; }
|
|
|
|
private:
|
|
const char* object_type_;
|
|
const char* object_sub_type_;
|
|
size_t object_count_;
|
|
size_t object_size_;
|
|
|
|
friend class Isolate;
|
|
};
|
|
|
|
|
|
class RetainedObjectInfo;
|
|
|
|
|
|
/**
|
|
* FunctionEntryHook is the type of the profile entry hook called at entry to
|
|
* any generated function when function-level profiling is enabled.
|
|
*
|
|
* \param function the address of the function that's being entered.
|
|
* \param return_addr_location points to a location on stack where the machine
|
|
* return address resides. This can be used to identify the caller of
|
|
* \p function, and/or modified to divert execution when \p function exits.
|
|
*
|
|
* \note the entry hook must not cause garbage collection.
|
|
*/
|
|
typedef void (*FunctionEntryHook)(uintptr_t function,
|
|
uintptr_t return_addr_location);
|
|
|
|
/**
|
|
* A JIT code event is issued each time code is added, moved or removed.
|
|
*
|
|
* \note removal events are not currently issued.
|
|
*/
|
|
struct JitCodeEvent {
|
|
enum EventType {
|
|
CODE_ADDED,
|
|
CODE_MOVED,
|
|
CODE_REMOVED,
|
|
CODE_ADD_LINE_POS_INFO,
|
|
CODE_START_LINE_INFO_RECORDING,
|
|
CODE_END_LINE_INFO_RECORDING
|
|
};
|
|
// Definition of the code position type. The "POSITION" type means the place
|
|
// in the source code which are of interest when making stack traces to
|
|
// pin-point the source location of a stack frame as close as possible.
|
|
// The "STATEMENT_POSITION" means the place at the beginning of each
|
|
// statement, and is used to indicate possible break locations.
|
|
enum PositionType { POSITION, STATEMENT_POSITION };
|
|
|
|
// Type of event.
|
|
EventType type;
|
|
// Start of the instructions.
|
|
void* code_start;
|
|
// Size of the instructions.
|
|
size_t code_len;
|
|
// Script info for CODE_ADDED event.
|
|
Local<UnboundScript> script;
|
|
// User-defined data for *_LINE_INFO_* event. It's used to hold the source
|
|
// code line information which is returned from the
|
|
// CODE_START_LINE_INFO_RECORDING event. And it's passed to subsequent
|
|
// CODE_ADD_LINE_POS_INFO and CODE_END_LINE_INFO_RECORDING events.
|
|
void* user_data;
|
|
|
|
struct name_t {
|
|
// Name of the object associated with the code, note that the string is not
|
|
// zero-terminated.
|
|
const char* str;
|
|
// Number of chars in str.
|
|
size_t len;
|
|
};
|
|
|
|
struct line_info_t {
|
|
// PC offset
|
|
size_t offset;
|
|
// Code postion
|
|
size_t pos;
|
|
// The position type.
|
|
PositionType position_type;
|
|
};
|
|
|
|
union {
|
|
// Only valid for CODE_ADDED.
|
|
struct name_t name;
|
|
|
|
// Only valid for CODE_ADD_LINE_POS_INFO
|
|
struct line_info_t line_info;
|
|
|
|
// New location of instructions. Only valid for CODE_MOVED.
|
|
void* new_code_start;
|
|
};
|
|
};
|
|
|
|
/**
|
|
* Option flags passed to the SetJitCodeEventHandler function.
|
|
*/
|
|
enum JitCodeEventOptions {
|
|
kJitCodeEventDefault = 0,
|
|
// Generate callbacks for already existent code.
|
|
kJitCodeEventEnumExisting = 1
|
|
};
|
|
|
|
|
|
/**
|
|
* Callback function passed to SetJitCodeEventHandler.
|
|
*
|
|
* \param event code add, move or removal event.
|
|
*/
|
|
typedef void (*JitCodeEventHandler)(const JitCodeEvent* event);
|
|
|
|
|
|
/**
|
|
* Interface for iterating through all external resources in the heap.
|
|
*/
|
|
class V8_EXPORT ExternalResourceVisitor { // NOLINT
|
|
public:
|
|
virtual ~ExternalResourceVisitor() {}
|
|
virtual void VisitExternalString(Local<String> string) {}
|
|
};
|
|
|
|
|
|
/**
|
|
* Interface for iterating through all the persistent handles in the heap.
|
|
*/
|
|
class V8_EXPORT PersistentHandleVisitor { // NOLINT
|
|
public:
|
|
virtual ~PersistentHandleVisitor() {}
|
|
virtual void VisitPersistentHandle(Persistent<Value>* value,
|
|
uint16_t class_id) {}
|
|
};
|
|
|
|
|
|
/**
|
|
* Isolate represents an isolated instance of the V8 engine. V8 isolates have
|
|
* completely separate states. Objects from one isolate must not be used in
|
|
* other isolates. The embedder can create multiple isolates and use them in
|
|
* parallel in multiple threads. An isolate can be entered by at most one
|
|
* thread at any given time. The Locker/Unlocker API must be used to
|
|
* synchronize.
|
|
*/
|
|
class V8_EXPORT Isolate {
|
|
public:
|
|
/**
|
|
* Initial configuration parameters for a new Isolate.
|
|
*/
|
|
struct CreateParams {
|
|
CreateParams()
|
|
: entry_hook(NULL),
|
|
code_event_handler(NULL),
|
|
snapshot_blob(NULL),
|
|
counter_lookup_callback(NULL),
|
|
create_histogram_callback(NULL),
|
|
add_histogram_sample_callback(NULL),
|
|
array_buffer_allocator(NULL) {}
|
|
|
|
/**
|
|
* The optional entry_hook allows the host application to provide the
|
|
* address of a function that's invoked on entry to every V8-generated
|
|
* function. Note that entry_hook is invoked at the very start of each
|
|
* generated function. Furthermore, if an entry_hook is given, V8 will
|
|
* always run without a context snapshot.
|
|
*/
|
|
FunctionEntryHook entry_hook;
|
|
|
|
/**
|
|
* Allows the host application to provide the address of a function that is
|
|
* notified each time code is added, moved or removed.
|
|
*/
|
|
JitCodeEventHandler code_event_handler;
|
|
|
|
/**
|
|
* ResourceConstraints to use for the new Isolate.
|
|
*/
|
|
ResourceConstraints constraints;
|
|
|
|
/**
|
|
* Explicitly specify a startup snapshot blob. The embedder owns the blob.
|
|
*/
|
|
StartupData* snapshot_blob;
|
|
|
|
|
|
/**
|
|
* Enables the host application to provide a mechanism for recording
|
|
* statistics counters.
|
|
*/
|
|
CounterLookupCallback counter_lookup_callback;
|
|
|
|
/**
|
|
* Enables the host application to provide a mechanism for recording
|
|
* histograms. The CreateHistogram function returns a
|
|
* histogram which will later be passed to the AddHistogramSample
|
|
* function.
|
|
*/
|
|
CreateHistogramCallback create_histogram_callback;
|
|
AddHistogramSampleCallback add_histogram_sample_callback;
|
|
|
|
/**
|
|
* The ArrayBuffer::Allocator to use for allocating and freeing the backing
|
|
* store of ArrayBuffers.
|
|
*/
|
|
ArrayBuffer::Allocator* array_buffer_allocator;
|
|
};
|
|
|
|
|
|
/**
|
|
* Stack-allocated class which sets the isolate for all operations
|
|
* executed within a local scope.
|
|
*/
|
|
class V8_EXPORT Scope {
|
|
public:
|
|
explicit Scope(Isolate* isolate) : isolate_(isolate) {
|
|
isolate->Enter();
|
|
}
|
|
|
|
~Scope() { isolate_->Exit(); }
|
|
|
|
private:
|
|
Isolate* const isolate_;
|
|
|
|
// Prevent copying of Scope objects.
|
|
Scope(const Scope&);
|
|
Scope& operator=(const Scope&);
|
|
};
|
|
|
|
|
|
/**
|
|
* Assert that no Javascript code is invoked.
|
|
*/
|
|
class V8_EXPORT DisallowJavascriptExecutionScope {
|
|
public:
|
|
enum OnFailure { CRASH_ON_FAILURE, THROW_ON_FAILURE };
|
|
|
|
DisallowJavascriptExecutionScope(Isolate* isolate, OnFailure on_failure);
|
|
~DisallowJavascriptExecutionScope();
|
|
|
|
private:
|
|
bool on_failure_;
|
|
void* internal_;
|
|
|
|
// Prevent copying of Scope objects.
|
|
DisallowJavascriptExecutionScope(const DisallowJavascriptExecutionScope&);
|
|
DisallowJavascriptExecutionScope& operator=(
|
|
const DisallowJavascriptExecutionScope&);
|
|
};
|
|
|
|
|
|
/**
|
|
* Introduce exception to DisallowJavascriptExecutionScope.
|
|
*/
|
|
class V8_EXPORT AllowJavascriptExecutionScope {
|
|
public:
|
|
explicit AllowJavascriptExecutionScope(Isolate* isolate);
|
|
~AllowJavascriptExecutionScope();
|
|
|
|
private:
|
|
void* internal_throws_;
|
|
void* internal_assert_;
|
|
|
|
// Prevent copying of Scope objects.
|
|
AllowJavascriptExecutionScope(const AllowJavascriptExecutionScope&);
|
|
AllowJavascriptExecutionScope& operator=(
|
|
const AllowJavascriptExecutionScope&);
|
|
};
|
|
|
|
/**
|
|
* Do not run microtasks while this scope is active, even if microtasks are
|
|
* automatically executed otherwise.
|
|
*/
|
|
class V8_EXPORT SuppressMicrotaskExecutionScope {
|
|
public:
|
|
explicit SuppressMicrotaskExecutionScope(Isolate* isolate);
|
|
~SuppressMicrotaskExecutionScope();
|
|
|
|
private:
|
|
internal::Isolate* isolate_;
|
|
|
|
// Prevent copying of Scope objects.
|
|
SuppressMicrotaskExecutionScope(const SuppressMicrotaskExecutionScope&);
|
|
SuppressMicrotaskExecutionScope& operator=(
|
|
const SuppressMicrotaskExecutionScope&);
|
|
};
|
|
|
|
/**
|
|
* Types of garbage collections that can be requested via
|
|
* RequestGarbageCollectionForTesting.
|
|
*/
|
|
enum GarbageCollectionType {
|
|
kFullGarbageCollection,
|
|
kMinorGarbageCollection
|
|
};
|
|
|
|
/**
|
|
* Features reported via the SetUseCounterCallback callback. Do not change
|
|
* assigned numbers of existing items; add new features to the end of this
|
|
* list.
|
|
*/
|
|
enum UseCounterFeature {
|
|
kUseAsm = 0,
|
|
kBreakIterator = 1,
|
|
kLegacyConst = 2,
|
|
kMarkDequeOverflow = 3,
|
|
kStoreBufferOverflow = 4,
|
|
kSlotsBufferOverflow = 5,
|
|
kObjectObserve = 6,
|
|
kForcedGC = 7,
|
|
kUseCounterFeatureCount // This enum value must be last.
|
|
};
|
|
|
|
typedef void (*UseCounterCallback)(Isolate* isolate,
|
|
UseCounterFeature feature);
|
|
|
|
|
|
/**
|
|
* Creates a new isolate. Does not change the currently entered
|
|
* isolate.
|
|
*
|
|
* When an isolate is no longer used its resources should be freed
|
|
* by calling Dispose(). Using the delete operator is not allowed.
|
|
*
|
|
* V8::Initialize() must have run prior to this.
|
|
*/
|
|
static Isolate* New(const CreateParams& params);
|
|
|
|
static V8_DEPRECATED("Always pass CreateParams", Isolate* New());
|
|
|
|
/**
|
|
* Returns the entered isolate for the current thread or NULL in
|
|
* case there is no current isolate.
|
|
*
|
|
* This method must not be invoked before V8::Initialize() was invoked.
|
|
*/
|
|
static Isolate* GetCurrent();
|
|
|
|
/**
|
|
* Custom callback used by embedders to help V8 determine if it should abort
|
|
* when it throws and no internal handler is predicted to catch the
|
|
* exception. If --abort-on-uncaught-exception is used on the command line,
|
|
* then V8 will abort if either:
|
|
* - no custom callback is set.
|
|
* - the custom callback set returns true.
|
|
* Otherwise, the custom callback will not be called and V8 will not abort.
|
|
*/
|
|
typedef bool (*AbortOnUncaughtExceptionCallback)(Isolate*);
|
|
void SetAbortOnUncaughtExceptionCallback(
|
|
AbortOnUncaughtExceptionCallback callback);
|
|
|
|
/**
|
|
* Methods below this point require holding a lock (using Locker) in
|
|
* a multi-threaded environment.
|
|
*/
|
|
|
|
/**
|
|
* Sets this isolate as the entered one for the current thread.
|
|
* Saves the previously entered one (if any), so that it can be
|
|
* restored when exiting. Re-entering an isolate is allowed.
|
|
*/
|
|
void Enter();
|
|
|
|
/**
|
|
* Exits this isolate by restoring the previously entered one in the
|
|
* current thread. The isolate may still stay the same, if it was
|
|
* entered more than once.
|
|
*
|
|
* Requires: this == Isolate::GetCurrent().
|
|
*/
|
|
void Exit();
|
|
|
|
/**
|
|
* Disposes the isolate. The isolate must not be entered by any
|
|
* thread to be disposable.
|
|
*/
|
|
void Dispose();
|
|
|
|
/**
|
|
* Associate embedder-specific data with the isolate. |slot| has to be
|
|
* between 0 and GetNumberOfDataSlots() - 1.
|
|
*/
|
|
V8_INLINE void SetData(uint32_t slot, void* data);
|
|
|
|
/**
|
|
* Retrieve embedder-specific data from the isolate.
|
|
* Returns NULL if SetData has never been called for the given |slot|.
|
|
*/
|
|
V8_INLINE void* GetData(uint32_t slot);
|
|
|
|
/**
|
|
* Returns the maximum number of available embedder data slots. Valid slots
|
|
* are in the range of 0 - GetNumberOfDataSlots() - 1.
|
|
*/
|
|
V8_INLINE static uint32_t GetNumberOfDataSlots();
|
|
|
|
/**
|
|
* Get statistics about the heap memory usage.
|
|
*/
|
|
void GetHeapStatistics(HeapStatistics* heap_statistics);
|
|
|
|
/**
|
|
* Returns the number of spaces in the heap.
|
|
*/
|
|
size_t NumberOfHeapSpaces();
|
|
|
|
/**
|
|
* Get the memory usage of a space in the heap.
|
|
*
|
|
* \param space_statistics The HeapSpaceStatistics object to fill in
|
|
* statistics.
|
|
* \param index The index of the space to get statistics from, which ranges
|
|
* from 0 to NumberOfHeapSpaces() - 1.
|
|
* \returns true on success.
|
|
*/
|
|
bool GetHeapSpaceStatistics(HeapSpaceStatistics* space_statistics,
|
|
size_t index);
|
|
|
|
/**
|
|
* Returns the number of types of objects tracked in the heap at GC.
|
|
*/
|
|
size_t NumberOfTrackedHeapObjectTypes();
|
|
|
|
/**
|
|
* Get statistics about objects in the heap.
|
|
*
|
|
* \param object_statistics The HeapObjectStatistics object to fill in
|
|
* statistics of objects of given type, which were live in the previous GC.
|
|
* \param type_index The index of the type of object to fill details about,
|
|
* which ranges from 0 to NumberOfTrackedHeapObjectTypes() - 1.
|
|
* \returns true on success.
|
|
*/
|
|
bool GetHeapObjectStatisticsAtLastGC(HeapObjectStatistics* object_statistics,
|
|
size_t type_index);
|
|
|
|
/**
|
|
* Get a call stack sample from the isolate.
|
|
* \param state Execution state.
|
|
* \param frames Caller allocated buffer to store stack frames.
|
|
* \param frames_limit Maximum number of frames to capture. The buffer must
|
|
* be large enough to hold the number of frames.
|
|
* \param sample_info The sample info is filled up by the function
|
|
* provides number of actual captured stack frames and
|
|
* the current VM state.
|
|
* \note GetStackSample should only be called when the JS thread is paused or
|
|
* interrupted. Otherwise the behavior is undefined.
|
|
*/
|
|
void GetStackSample(const RegisterState& state, void** frames,
|
|
size_t frames_limit, SampleInfo* sample_info);
|
|
|
|
/**
|
|
* Adjusts the amount of registered external memory. Used to give V8 an
|
|
* indication of the amount of externally allocated memory that is kept alive
|
|
* by JavaScript objects. V8 uses this to decide when to perform global
|
|
* garbage collections. Registering externally allocated memory will trigger
|
|
* global garbage collections more often than it would otherwise in an attempt
|
|
* to garbage collect the JavaScript objects that keep the externally
|
|
* allocated memory alive.
|
|
*
|
|
* \param change_in_bytes the change in externally allocated memory that is
|
|
* kept alive by JavaScript objects.
|
|
* \returns the adjusted value.
|
|
*/
|
|
V8_INLINE int64_t
|
|
AdjustAmountOfExternalAllocatedMemory(int64_t change_in_bytes);
|
|
|
|
/**
|
|
* Returns heap profiler for this isolate. Will return NULL until the isolate
|
|
* is initialized.
|
|
*/
|
|
HeapProfiler* GetHeapProfiler();
|
|
|
|
/**
|
|
* Returns CPU profiler for this isolate. Will return NULL unless the isolate
|
|
* is initialized. It is the embedder's responsibility to stop all CPU
|
|
* profiling activities if it has started any.
|
|
*/
|
|
CpuProfiler* GetCpuProfiler();
|
|
|
|
/** Returns true if this isolate has a current context. */
|
|
bool InContext();
|
|
|
|
/** Returns the context that is on the top of the stack. */
|
|
Local<Context> GetCurrentContext();
|
|
|
|
/**
|
|
* Returns the context of the calling JavaScript code. That is the
|
|
* context of the top-most JavaScript frame. If there are no
|
|
* JavaScript frames an empty handle is returned.
|
|
*/
|
|
Local<Context> GetCallingContext();
|
|
|
|
/** Returns the last entered context. */
|
|
Local<Context> GetEnteredContext();
|
|
|
|
/**
|
|
* Schedules an exception to be thrown when returning to JavaScript. When an
|
|
* exception has been scheduled it is illegal to invoke any JavaScript
|
|
* operation; the caller must return immediately and only after the exception
|
|
* has been handled does it become legal to invoke JavaScript operations.
|
|
*/
|
|
Local<Value> ThrowException(Local<Value> exception);
|
|
|
|
/**
|
|
* Allows the host application to group objects together. If one
|
|
* object in the group is alive, all objects in the group are alive.
|
|
* After each garbage collection, object groups are removed. It is
|
|
* intended to be used in the before-garbage-collection callback
|
|
* function, for instance to simulate DOM tree connections among JS
|
|
* wrapper objects. Object groups for all dependent handles need to
|
|
* be provided for kGCTypeMarkSweepCompact collections, for all other
|
|
* garbage collection types it is sufficient to provide object groups
|
|
* for partially dependent handles only.
|
|
*/
|
|
template<typename T> void SetObjectGroupId(const Persistent<T>& object,
|
|
UniqueId id);
|
|
|
|
/**
|
|
* Allows the host application to declare implicit references from an object
|
|
* group to an object. If the objects of the object group are alive, the child
|
|
* object is alive too. After each garbage collection, all implicit references
|
|
* are removed. It is intended to be used in the before-garbage-collection
|
|
* callback function.
|
|
*/
|
|
template<typename T> void SetReferenceFromGroup(UniqueId id,
|
|
const Persistent<T>& child);
|
|
|
|
/**
|
|
* Allows the host application to declare implicit references from an object
|
|
* to another object. If the parent object is alive, the child object is alive
|
|
* too. After each garbage collection, all implicit references are removed. It
|
|
* is intended to be used in the before-garbage-collection callback function.
|
|
*/
|
|
template<typename T, typename S>
|
|
void SetReference(const Persistent<T>& parent, const Persistent<S>& child);
|
|
|
|
typedef void (*GCPrologueCallback)(Isolate* isolate,
|
|
GCType type,
|
|
GCCallbackFlags flags);
|
|
typedef void (*GCEpilogueCallback)(Isolate* isolate,
|
|
GCType type,
|
|
GCCallbackFlags flags);
|
|
|
|
/**
|
|
* Enables the host application to receive a notification before a
|
|
* garbage collection. Allocations are allowed in the callback function,
|
|
* but the callback is not re-entrant: if the allocation inside it will
|
|
* trigger the garbage collection, the callback won't be called again.
|
|
* It is possible to specify the GCType filter for your callback. But it is
|
|
* not possible to register the same callback function two times with
|
|
* different GCType filters.
|
|
*/
|
|
void AddGCPrologueCallback(
|
|
GCPrologueCallback callback, GCType gc_type_filter = kGCTypeAll);
|
|
|
|
/**
|
|
* This function removes callback which was installed by
|
|
* AddGCPrologueCallback function.
|
|
*/
|
|
void RemoveGCPrologueCallback(GCPrologueCallback callback);
|
|
|
|
/**
|
|
* Enables the host application to receive a notification after a
|
|
* garbage collection. Allocations are allowed in the callback function,
|
|
* but the callback is not re-entrant: if the allocation inside it will
|
|
* trigger the garbage collection, the callback won't be called again.
|
|
* It is possible to specify the GCType filter for your callback. But it is
|
|
* not possible to register the same callback function two times with
|
|
* different GCType filters.
|
|
*/
|
|
void AddGCEpilogueCallback(
|
|
GCEpilogueCallback callback, GCType gc_type_filter = kGCTypeAll);
|
|
|
|
/**
|
|
* This function removes callback which was installed by
|
|
* AddGCEpilogueCallback function.
|
|
*/
|
|
void RemoveGCEpilogueCallback(GCEpilogueCallback callback);
|
|
|
|
|
|
/**
|
|
* Forcefully terminate the current thread of JavaScript execution
|
|
* in the given isolate.
|
|
*
|
|
* This method can be used by any thread even if that thread has not
|
|
* acquired the V8 lock with a Locker object.
|
|
*/
|
|
void TerminateExecution();
|
|
|
|
/**
|
|
* Is V8 terminating JavaScript execution.
|
|
*
|
|
* Returns true if JavaScript execution is currently terminating
|
|
* because of a call to TerminateExecution. In that case there are
|
|
* still JavaScript frames on the stack and the termination
|
|
* exception is still active.
|
|
*/
|
|
bool IsExecutionTerminating();
|
|
|
|
/**
|
|
* Resume execution capability in the given isolate, whose execution
|
|
* was previously forcefully terminated using TerminateExecution().
|
|
*
|
|
* When execution is forcefully terminated using TerminateExecution(),
|
|
* the isolate can not resume execution until all JavaScript frames
|
|
* have propagated the uncatchable exception which is generated. This
|
|
* method allows the program embedding the engine to handle the
|
|
* termination event and resume execution capability, even if
|
|
* JavaScript frames remain on the stack.
|
|
*
|
|
* This method can be used by any thread even if that thread has not
|
|
* acquired the V8 lock with a Locker object.
|
|
*/
|
|
void CancelTerminateExecution();
|
|
|
|
/**
|
|
* Request V8 to interrupt long running JavaScript code and invoke
|
|
* the given |callback| passing the given |data| to it. After |callback|
|
|
* returns control will be returned to the JavaScript code.
|
|
* There may be a number of interrupt requests in flight.
|
|
* Can be called from another thread without acquiring a |Locker|.
|
|
* Registered |callback| must not reenter interrupted Isolate.
|
|
*/
|
|
void RequestInterrupt(InterruptCallback callback, void* data);
|
|
|
|
/**
|
|
* Request garbage collection in this Isolate. It is only valid to call this
|
|
* function if --expose_gc was specified.
|
|
*
|
|
* This should only be used for testing purposes and not to enforce a garbage
|
|
* collection schedule. It has strong negative impact on the garbage
|
|
* collection performance. Use IdleNotificationDeadline() or
|
|
* LowMemoryNotification() instead to influence the garbage collection
|
|
* schedule.
|
|
*/
|
|
void RequestGarbageCollectionForTesting(GarbageCollectionType type);
|
|
|
|
/**
|
|
* Set the callback to invoke for logging event.
|
|
*/
|
|
void SetEventLogger(LogEventCallback that);
|
|
|
|
/**
|
|
* Adds a callback to notify the host application when a script finished
|
|
* running. If a script re-enters the runtime during executing, the
|
|
* CallCompletedCallback is only invoked when the outer-most script
|
|
* execution ends. Executing scripts inside the callback do not trigger
|
|
* further callbacks.
|
|
*/
|
|
void AddCallCompletedCallback(CallCompletedCallback callback);
|
|
|
|
/**
|
|
* Removes callback that was installed by AddCallCompletedCallback.
|
|
*/
|
|
void RemoveCallCompletedCallback(CallCompletedCallback callback);
|
|
|
|
|
|
/**
|
|
* Set callback to notify about promise reject with no handler, or
|
|
* revocation of such a previous notification once the handler is added.
|
|
*/
|
|
void SetPromiseRejectCallback(PromiseRejectCallback callback);
|
|
|
|
/**
|
|
* Experimental: Runs the Microtask Work Queue until empty
|
|
* Any exceptions thrown by microtask callbacks are swallowed.
|
|
*/
|
|
void RunMicrotasks();
|
|
|
|
/**
|
|
* Experimental: Enqueues the callback to the Microtask Work Queue
|
|
*/
|
|
void EnqueueMicrotask(Local<Function> microtask);
|
|
|
|
/**
|
|
* Experimental: Enqueues the callback to the Microtask Work Queue
|
|
*/
|
|
void EnqueueMicrotask(MicrotaskCallback microtask, void* data = NULL);
|
|
|
|
/**
|
|
* Experimental: Controls whether the Microtask Work Queue is automatically
|
|
* run when the script call depth decrements to zero.
|
|
*/
|
|
void SetAutorunMicrotasks(bool autorun);
|
|
|
|
/**
|
|
* Experimental: Returns whether the Microtask Work Queue is automatically
|
|
* run when the script call depth decrements to zero.
|
|
*/
|
|
bool WillAutorunMicrotasks() const;
|
|
|
|
/**
|
|
* Sets a callback for counting the number of times a feature of V8 is used.
|
|
*/
|
|
void SetUseCounterCallback(UseCounterCallback callback);
|
|
|
|
/**
|
|
* Enables the host application to provide a mechanism for recording
|
|
* statistics counters.
|
|
*/
|
|
void SetCounterFunction(CounterLookupCallback);
|
|
|
|
/**
|
|
* Enables the host application to provide a mechanism for recording
|
|
* histograms. The CreateHistogram function returns a
|
|
* histogram which will later be passed to the AddHistogramSample
|
|
* function.
|
|
*/
|
|
void SetCreateHistogramFunction(CreateHistogramCallback);
|
|
void SetAddHistogramSampleFunction(AddHistogramSampleCallback);
|
|
|
|
/**
|
|
* Optional notification that the embedder is idle.
|
|
* V8 uses the notification to perform garbage collection.
|
|
* This call can be used repeatedly if the embedder remains idle.
|
|
* Returns true if the embedder should stop calling IdleNotificationDeadline
|
|
* until real work has been done. This indicates that V8 has done
|
|
* as much cleanup as it will be able to do.
|
|
*
|
|
* The deadline_in_seconds argument specifies the deadline V8 has to finish
|
|
* garbage collection work. deadline_in_seconds is compared with
|
|
* MonotonicallyIncreasingTime() and should be based on the same timebase as
|
|
* that function. There is no guarantee that the actual work will be done
|
|
* within the time limit.
|
|
*/
|
|
bool IdleNotificationDeadline(double deadline_in_seconds);
|
|
|
|
V8_DEPRECATE_SOON("use IdleNotificationDeadline()",
|
|
bool IdleNotification(int idle_time_in_ms));
|
|
|
|
/**
|
|
* Optional notification that the system is running low on memory.
|
|
* V8 uses these notifications to attempt to free memory.
|
|
*/
|
|
void LowMemoryNotification();
|
|
|
|
/**
|
|
* Optional notification that a context has been disposed. V8 uses
|
|
* these notifications to guide the GC heuristic. Returns the number
|
|
* of context disposals - including this one - since the last time
|
|
* V8 had a chance to clean up.
|
|
*
|
|
* The optional parameter |dependant_context| specifies whether the disposed
|
|
* context was depending on state from other contexts or not.
|
|
*/
|
|
int ContextDisposedNotification(bool dependant_context = true);
|
|
|
|
/**
|
|
* Allows the host application to provide the address of a function that is
|
|
* notified each time code is added, moved or removed.
|
|
*
|
|
* \param options options for the JIT code event handler.
|
|
* \param event_handler the JIT code event handler, which will be invoked
|
|
* each time code is added, moved or removed.
|
|
* \note \p event_handler won't get notified of existent code.
|
|
* \note since code removal notifications are not currently issued, the
|
|
* \p event_handler may get notifications of code that overlaps earlier
|
|
* code notifications. This happens when code areas are reused, and the
|
|
* earlier overlapping code areas should therefore be discarded.
|
|
* \note the events passed to \p event_handler and the strings they point to
|
|
* are not guaranteed to live past each call. The \p event_handler must
|
|
* copy strings and other parameters it needs to keep around.
|
|
* \note the set of events declared in JitCodeEvent::EventType is expected to
|
|
* grow over time, and the JitCodeEvent structure is expected to accrue
|
|
* new members. The \p event_handler function must ignore event codes
|
|
* it does not recognize to maintain future compatibility.
|
|
* \note Use Isolate::CreateParams to get events for code executed during
|
|
* Isolate setup.
|
|
*/
|
|
void SetJitCodeEventHandler(JitCodeEventOptions options,
|
|
JitCodeEventHandler event_handler);
|
|
|
|
/**
|
|
* Modifies the stack limit for this Isolate.
|
|
*
|
|
* \param stack_limit An address beyond which the Vm's stack may not grow.
|
|
*
|
|
* \note If you are using threads then you should hold the V8::Locker lock
|
|
* while setting the stack limit and you must set a non-default stack
|
|
* limit separately for each thread.
|
|
*/
|
|
void SetStackLimit(uintptr_t stack_limit);
|
|
|
|
/**
|
|
* Returns a memory range that can potentially contain jitted code.
|
|
*
|
|
* On Win64, embedders are advised to install function table callbacks for
|
|
* these ranges, as default SEH won't be able to unwind through jitted code.
|
|
*
|
|
* The first page of the code range is reserved for the embedder and is
|
|
* committed, writable, and executable.
|
|
*
|
|
* Might be empty on other platforms.
|
|
*
|
|
* https://code.google.com/p/v8/issues/detail?id=3598
|
|
*/
|
|
void GetCodeRange(void** start, size_t* length_in_bytes);
|
|
|
|
/** Set the callback to invoke in case of fatal errors. */
|
|
void SetFatalErrorHandler(FatalErrorCallback that);
|
|
|
|
/**
|
|
* Set the callback to invoke to check if code generation from
|
|
* strings should be allowed.
|
|
*/
|
|
void SetAllowCodeGenerationFromStringsCallback(
|
|
AllowCodeGenerationFromStringsCallback callback);
|
|
|
|
/**
|
|
* Check if V8 is dead and therefore unusable. This is the case after
|
|
* fatal errors such as out-of-memory situations.
|
|
*/
|
|
bool IsDead();
|
|
|
|
/**
|
|
* Adds a message listener.
|
|
*
|
|
* The same message listener can be added more than once and in that
|
|
* case it will be called more than once for each message.
|
|
*
|
|
* If data is specified, it will be passed to the callback when it is called.
|
|
* Otherwise, the exception object will be passed to the callback instead.
|
|
*/
|
|
bool AddMessageListener(MessageCallback that,
|
|
Local<Value> data = Local<Value>());
|
|
|
|
/**
|
|
* Remove all message listeners from the specified callback function.
|
|
*/
|
|
void RemoveMessageListeners(MessageCallback that);
|
|
|
|
/** Callback function for reporting failed access checks.*/
|
|
void SetFailedAccessCheckCallbackFunction(FailedAccessCheckCallback);
|
|
|
|
/**
|
|
* Tells V8 to capture current stack trace when uncaught exception occurs
|
|
* and report it to the message listeners. The option is off by default.
|
|
*/
|
|
void SetCaptureStackTraceForUncaughtExceptions(
|
|
bool capture, int frame_limit = 10,
|
|
StackTrace::StackTraceOptions options = StackTrace::kOverview);
|
|
|
|
/**
|
|
* Enables the host application to provide a mechanism to be notified
|
|
* and perform custom logging when V8 Allocates Executable Memory.
|
|
*/
|
|
void AddMemoryAllocationCallback(MemoryAllocationCallback callback,
|
|
ObjectSpace space, AllocationAction action);
|
|
|
|
/**
|
|
* Removes callback that was installed by AddMemoryAllocationCallback.
|
|
*/
|
|
void RemoveMemoryAllocationCallback(MemoryAllocationCallback callback);
|
|
|
|
/**
|
|
* Iterates through all external resources referenced from current isolate
|
|
* heap. GC is not invoked prior to iterating, therefore there is no
|
|
* guarantee that visited objects are still alive.
|
|
*/
|
|
void VisitExternalResources(ExternalResourceVisitor* visitor);
|
|
|
|
/**
|
|
* Iterates through all the persistent handles in the current isolate's heap
|
|
* that have class_ids.
|
|
*/
|
|
void VisitHandlesWithClassIds(PersistentHandleVisitor* visitor);
|
|
|
|
/**
|
|
* Iterates through all the persistent handles in the current isolate's heap
|
|
* that have class_ids and are candidates to be marked as partially dependent
|
|
* handles. This will visit handles to young objects created since the last
|
|
* garbage collection but is free to visit an arbitrary superset of these
|
|
* objects.
|
|
*/
|
|
void VisitHandlesForPartialDependence(PersistentHandleVisitor* visitor);
|
|
|
|
private:
|
|
template <class K, class V, class Traits>
|
|
friend class PersistentValueMapBase;
|
|
|
|
Isolate();
|
|
Isolate(const Isolate&);
|
|
~Isolate();
|
|
Isolate& operator=(const Isolate&);
|
|
void* operator new(size_t size);
|
|
void operator delete(void*, size_t);
|
|
|
|
void SetObjectGroupId(internal::Object** object, UniqueId id);
|
|
void SetReferenceFromGroup(UniqueId id, internal::Object** object);
|
|
void SetReference(internal::Object** parent, internal::Object** child);
|
|
void CollectAllGarbage(const char* gc_reason);
|
|
};
|
|
|
|
class V8_EXPORT StartupData {
|
|
public:
|
|
const char* data;
|
|
int raw_size;
|
|
};
|
|
|
|
|
|
/**
|
|
* EntropySource is used as a callback function when v8 needs a source
|
|
* of entropy.
|
|
*/
|
|
typedef bool (*EntropySource)(unsigned char* buffer, size_t length);
|
|
|
|
|
|
/**
|
|
* ReturnAddressLocationResolver is used as a callback function when v8 is
|
|
* resolving the location of a return address on the stack. Profilers that
|
|
* change the return address on the stack can use this to resolve the stack
|
|
* location to whereever the profiler stashed the original return address.
|
|
*
|
|
* \param return_addr_location points to a location on stack where a machine
|
|
* return address resides.
|
|
* \returns either return_addr_location, or else a pointer to the profiler's
|
|
* copy of the original return address.
|
|
*
|
|
* \note the resolver function must not cause garbage collection.
|
|
*/
|
|
typedef uintptr_t (*ReturnAddressLocationResolver)(
|
|
uintptr_t return_addr_location);
|
|
|
|
|
|
/**
|
|
* Container class for static utility functions.
|
|
*/
|
|
class V8_EXPORT V8 {
|
|
public:
|
|
/** Set the callback to invoke in case of fatal errors. */
|
|
V8_INLINE static V8_DEPRECATE_SOON(
|
|
"Use isolate version",
|
|
void SetFatalErrorHandler(FatalErrorCallback that));
|
|
|
|
/**
|
|
* Set the callback to invoke to check if code generation from
|
|
* strings should be allowed.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATE_SOON(
|
|
"Use isolate version", void SetAllowCodeGenerationFromStringsCallback(
|
|
AllowCodeGenerationFromStringsCallback that));
|
|
|
|
/**
|
|
* Set allocator to use for ArrayBuffer memory.
|
|
* The allocator should be set only once. The allocator should be set
|
|
* before any code tha uses ArrayBuffers is executed.
|
|
* This allocator is used in all isolates.
|
|
*/
|
|
static V8_DEPRECATE_SOON(
|
|
"Use isolate version",
|
|
void SetArrayBufferAllocator(ArrayBuffer::Allocator* allocator));
|
|
|
|
/**
|
|
* Check if V8 is dead and therefore unusable. This is the case after
|
|
* fatal errors such as out-of-memory situations.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATE_SOON("no alternative", bool IsDead());
|
|
|
|
/**
|
|
* Hand startup data to V8, in case the embedder has chosen to build
|
|
* V8 with external startup data.
|
|
*
|
|
* Note:
|
|
* - By default the startup data is linked into the V8 library, in which
|
|
* case this function is not meaningful.
|
|
* - If this needs to be called, it needs to be called before V8
|
|
* tries to make use of its built-ins.
|
|
* - To avoid unnecessary copies of data, V8 will point directly into the
|
|
* given data blob, so pretty please keep it around until V8 exit.
|
|
* - Compression of the startup blob might be useful, but needs to
|
|
* handled entirely on the embedders' side.
|
|
* - The call will abort if the data is invalid.
|
|
*/
|
|
static void SetNativesDataBlob(StartupData* startup_blob);
|
|
static void SetSnapshotDataBlob(StartupData* startup_blob);
|
|
|
|
/**
|
|
* Create a new isolate and context for the purpose of capturing a snapshot
|
|
* Returns { NULL, 0 } on failure.
|
|
* The caller owns the data array in the return value.
|
|
*/
|
|
static StartupData CreateSnapshotDataBlob(const char* custom_source = NULL);
|
|
|
|
/**
|
|
* Adds a message listener.
|
|
*
|
|
* The same message listener can be added more than once and in that
|
|
* case it will be called more than once for each message.
|
|
*
|
|
* If data is specified, it will be passed to the callback when it is called.
|
|
* Otherwise, the exception object will be passed to the callback instead.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATE_SOON(
|
|
"Use isolate version",
|
|
bool AddMessageListener(MessageCallback that,
|
|
Local<Value> data = Local<Value>()));
|
|
|
|
/**
|
|
* Remove all message listeners from the specified callback function.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATE_SOON(
|
|
"Use isolate version", void RemoveMessageListeners(MessageCallback that));
|
|
|
|
/**
|
|
* Tells V8 to capture current stack trace when uncaught exception occurs
|
|
* and report it to the message listeners. The option is off by default.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATE_SOON(
|
|
"Use isolate version",
|
|
void SetCaptureStackTraceForUncaughtExceptions(
|
|
bool capture, int frame_limit = 10,
|
|
StackTrace::StackTraceOptions options = StackTrace::kOverview));
|
|
|
|
/**
|
|
* Sets V8 flags from a string.
|
|
*/
|
|
static void SetFlagsFromString(const char* str, int length);
|
|
|
|
/**
|
|
* Sets V8 flags from the command line.
|
|
*/
|
|
static void SetFlagsFromCommandLine(int* argc,
|
|
char** argv,
|
|
bool remove_flags);
|
|
|
|
/** Get the version string. */
|
|
static const char* GetVersion();
|
|
|
|
/** Callback function for reporting failed access checks.*/
|
|
V8_INLINE static V8_DEPRECATE_SOON(
|
|
"Use isolate version",
|
|
void SetFailedAccessCheckCallbackFunction(FailedAccessCheckCallback));
|
|
|
|
/**
|
|
* Enables the host application to receive a notification before a
|
|
* garbage collection. Allocations are not allowed in the
|
|
* callback function, you therefore cannot manipulate objects (set
|
|
* or delete properties for example) since it is possible such
|
|
* operations will result in the allocation of objects. It is possible
|
|
* to specify the GCType filter for your callback. But it is not possible to
|
|
* register the same callback function two times with different
|
|
* GCType filters.
|
|
*/
|
|
static V8_DEPRECATE_SOON(
|
|
"Use isolate version",
|
|
void AddGCPrologueCallback(GCPrologueCallback callback,
|
|
GCType gc_type_filter = kGCTypeAll));
|
|
|
|
/**
|
|
* This function removes callback which was installed by
|
|
* AddGCPrologueCallback function.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATE_SOON(
|
|
"Use isolate version",
|
|
void RemoveGCPrologueCallback(GCPrologueCallback callback));
|
|
|
|
/**
|
|
* Enables the host application to receive a notification after a
|
|
* garbage collection. Allocations are not allowed in the
|
|
* callback function, you therefore cannot manipulate objects (set
|
|
* or delete properties for example) since it is possible such
|
|
* operations will result in the allocation of objects. It is possible
|
|
* to specify the GCType filter for your callback. But it is not possible to
|
|
* register the same callback function two times with different
|
|
* GCType filters.
|
|
*/
|
|
static V8_DEPRECATE_SOON(
|
|
"Use isolate version",
|
|
void AddGCEpilogueCallback(GCEpilogueCallback callback,
|
|
GCType gc_type_filter = kGCTypeAll));
|
|
|
|
/**
|
|
* This function removes callback which was installed by
|
|
* AddGCEpilogueCallback function.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATE_SOON(
|
|
"Use isolate version",
|
|
void RemoveGCEpilogueCallback(GCEpilogueCallback callback));
|
|
|
|
/**
|
|
* Enables the host application to provide a mechanism to be notified
|
|
* and perform custom logging when V8 Allocates Executable Memory.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATE_SOON(
|
|
"Use isolate version",
|
|
void AddMemoryAllocationCallback(MemoryAllocationCallback callback,
|
|
ObjectSpace space,
|
|
AllocationAction action));
|
|
|
|
/**
|
|
* Removes callback that was installed by AddMemoryAllocationCallback.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATE_SOON(
|
|
"Use isolate version",
|
|
void RemoveMemoryAllocationCallback(MemoryAllocationCallback callback));
|
|
|
|
/**
|
|
* Initializes V8. This function needs to be called before the first Isolate
|
|
* is created. It always returns true.
|
|
*/
|
|
static bool Initialize();
|
|
|
|
/**
|
|
* Allows the host application to provide a callback which can be used
|
|
* as a source of entropy for random number generators.
|
|
*/
|
|
static void SetEntropySource(EntropySource source);
|
|
|
|
/**
|
|
* Allows the host application to provide a callback that allows v8 to
|
|
* cooperate with a profiler that rewrites return addresses on stack.
|
|
*/
|
|
static void SetReturnAddressLocationResolver(
|
|
ReturnAddressLocationResolver return_address_resolver);
|
|
|
|
/**
|
|
* Forcefully terminate the current thread of JavaScript execution
|
|
* in the given isolate.
|
|
*
|
|
* This method can be used by any thread even if that thread has not
|
|
* acquired the V8 lock with a Locker object.
|
|
*
|
|
* \param isolate The isolate in which to terminate the current JS execution.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATE_SOON("Use isolate version",
|
|
void TerminateExecution(Isolate* isolate));
|
|
|
|
/**
|
|
* Is V8 terminating JavaScript execution.
|
|
*
|
|
* Returns true if JavaScript execution is currently terminating
|
|
* because of a call to TerminateExecution. In that case there are
|
|
* still JavaScript frames on the stack and the termination
|
|
* exception is still active.
|
|
*
|
|
* \param isolate The isolate in which to check.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATE_SOON(
|
|
"Use isolate version",
|
|
bool IsExecutionTerminating(Isolate* isolate = NULL));
|
|
|
|
/**
|
|
* Resume execution capability in the given isolate, whose execution
|
|
* was previously forcefully terminated using TerminateExecution().
|
|
*
|
|
* When execution is forcefully terminated using TerminateExecution(),
|
|
* the isolate can not resume execution until all JavaScript frames
|
|
* have propagated the uncatchable exception which is generated. This
|
|
* method allows the program embedding the engine to handle the
|
|
* termination event and resume execution capability, even if
|
|
* JavaScript frames remain on the stack.
|
|
*
|
|
* This method can be used by any thread even if that thread has not
|
|
* acquired the V8 lock with a Locker object.
|
|
*
|
|
* \param isolate The isolate in which to resume execution capability.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATE_SOON(
|
|
"Use isolate version", void CancelTerminateExecution(Isolate* isolate));
|
|
|
|
/**
|
|
* Releases any resources used by v8 and stops any utility threads
|
|
* that may be running. Note that disposing v8 is permanent, it
|
|
* cannot be reinitialized.
|
|
*
|
|
* It should generally not be necessary to dispose v8 before exiting
|
|
* a process, this should happen automatically. It is only necessary
|
|
* to use if the process needs the resources taken up by v8.
|
|
*/
|
|
static bool Dispose();
|
|
|
|
/**
|
|
* Iterates through all external resources referenced from current isolate
|
|
* heap. GC is not invoked prior to iterating, therefore there is no
|
|
* guarantee that visited objects are still alive.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATE_SOON(
|
|
"Use isoalte version",
|
|
void VisitExternalResources(ExternalResourceVisitor* visitor));
|
|
|
|
/**
|
|
* Iterates through all the persistent handles in the current isolate's heap
|
|
* that have class_ids.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATE_SOON(
|
|
"Use isolate version",
|
|
void VisitHandlesWithClassIds(PersistentHandleVisitor* visitor));
|
|
|
|
/**
|
|
* Iterates through all the persistent handles in isolate's heap that have
|
|
* class_ids.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATE_SOON(
|
|
"Use isolate version",
|
|
void VisitHandlesWithClassIds(Isolate* isolate,
|
|
PersistentHandleVisitor* visitor));
|
|
|
|
/**
|
|
* Iterates through all the persistent handles in the current isolate's heap
|
|
* that have class_ids and are candidates to be marked as partially dependent
|
|
* handles. This will visit handles to young objects created since the last
|
|
* garbage collection but is free to visit an arbitrary superset of these
|
|
* objects.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATE_SOON(
|
|
"Use isolate version",
|
|
void VisitHandlesForPartialDependence(Isolate* isolate,
|
|
PersistentHandleVisitor* visitor));
|
|
|
|
/**
|
|
* Initialize the ICU library bundled with V8. The embedder should only
|
|
* invoke this method when using the bundled ICU. Returns true on success.
|
|
*
|
|
* If V8 was compiled with the ICU data in an external file, the location
|
|
* of the data file has to be provided.
|
|
*/
|
|
static bool InitializeICU(const char* icu_data_file = NULL);
|
|
|
|
/**
|
|
* Initialize the external startup data. The embedder only needs to
|
|
* invoke this method when external startup data was enabled in a build.
|
|
*
|
|
* If V8 was compiled with the startup data in an external file, then
|
|
* V8 needs to be given those external files during startup. There are
|
|
* three ways to do this:
|
|
* - InitializeExternalStartupData(const char*)
|
|
* This will look in the given directory for files "natives_blob.bin"
|
|
* and "snapshot_blob.bin" - which is what the default build calls them.
|
|
* - InitializeExternalStartupData(const char*, const char*)
|
|
* As above, but will directly use the two given file names.
|
|
* - Call SetNativesDataBlob, SetNativesDataBlob.
|
|
* This will read the blobs from the given data structures and will
|
|
* not perform any file IO.
|
|
*/
|
|
static void InitializeExternalStartupData(const char* directory_path);
|
|
static void InitializeExternalStartupData(const char* natives_blob,
|
|
const char* snapshot_blob);
|
|
/**
|
|
* Sets the v8::Platform to use. This should be invoked before V8 is
|
|
* initialized.
|
|
*/
|
|
static void InitializePlatform(Platform* platform);
|
|
|
|
/**
|
|
* Clears all references to the v8::Platform. This should be invoked after
|
|
* V8 was disposed.
|
|
*/
|
|
static void ShutdownPlatform();
|
|
|
|
private:
|
|
V8();
|
|
|
|
static internal::Object** GlobalizeReference(internal::Isolate* isolate,
|
|
internal::Object** handle);
|
|
static internal::Object** CopyPersistent(internal::Object** handle);
|
|
static void DisposeGlobal(internal::Object** global_handle);
|
|
typedef WeakCallbackData<Value, void>::Callback WeakCallback;
|
|
static void MakeWeak(internal::Object** global_handle, void* data,
|
|
WeakCallback weak_callback);
|
|
static void MakeWeak(internal::Object** global_handle, void* data,
|
|
WeakCallbackInfo<void>::Callback weak_callback,
|
|
WeakCallbackType type);
|
|
static void MakeWeak(internal::Object** global_handle, void* data,
|
|
// Must be 0 or -1.
|
|
int internal_field_index1,
|
|
// Must be 1 or -1.
|
|
int internal_field_index2,
|
|
WeakCallbackInfo<void>::Callback weak_callback);
|
|
static void* ClearWeak(internal::Object** global_handle);
|
|
static void Eternalize(Isolate* isolate,
|
|
Value* handle,
|
|
int* index);
|
|
static Local<Value> GetEternal(Isolate* isolate, int index);
|
|
|
|
static void FromJustIsNothing();
|
|
static void ToLocalEmpty();
|
|
static void InternalFieldOutOfBounds(int index);
|
|
template <class T> friend class Local;
|
|
template <class T>
|
|
friend class MaybeLocal;
|
|
template <class T>
|
|
friend class Maybe;
|
|
template <class T>
|
|
friend class WeakCallbackInfo;
|
|
template <class T> friend class Eternal;
|
|
template <class T> friend class PersistentBase;
|
|
template <class T, class M> friend class Persistent;
|
|
friend class Context;
|
|
};
|
|
|
|
|
|
/**
|
|
* A simple Maybe type, representing an object which may or may not have a
|
|
* value, see https://hackage.haskell.org/package/base/docs/Data-Maybe.html.
|
|
*
|
|
* If an API method returns a Maybe<>, the API method can potentially fail
|
|
* either because an exception is thrown, or because an exception is pending,
|
|
* e.g. because a previous API call threw an exception that hasn't been caught
|
|
* yet, or because a TerminateExecution exception was thrown. In that case, a
|
|
* "Nothing" value is returned.
|
|
*/
|
|
template <class T>
|
|
class Maybe {
|
|
public:
|
|
V8_INLINE bool IsNothing() const { return !has_value; }
|
|
V8_INLINE bool IsJust() const { return has_value; }
|
|
|
|
// Will crash if the Maybe<> is nothing.
|
|
V8_INLINE T FromJust() const {
|
|
if (V8_UNLIKELY(!IsJust())) V8::FromJustIsNothing();
|
|
return value;
|
|
}
|
|
|
|
V8_INLINE T FromMaybe(const T& default_value) const {
|
|
return has_value ? value : default_value;
|
|
}
|
|
|
|
V8_INLINE bool operator==(const Maybe& other) const {
|
|
return (IsJust() == other.IsJust()) &&
|
|
(!IsJust() || FromJust() == other.FromJust());
|
|
}
|
|
|
|
V8_INLINE bool operator!=(const Maybe& other) const {
|
|
return !operator==(other);
|
|
}
|
|
|
|
private:
|
|
Maybe() : has_value(false) {}
|
|
explicit Maybe(const T& t) : has_value(true), value(t) {}
|
|
|
|
bool has_value;
|
|
T value;
|
|
|
|
template <class U>
|
|
friend Maybe<U> Nothing();
|
|
template <class U>
|
|
friend Maybe<U> Just(const U& u);
|
|
};
|
|
|
|
|
|
template <class T>
|
|
inline Maybe<T> Nothing() {
|
|
return Maybe<T>();
|
|
}
|
|
|
|
|
|
template <class T>
|
|
inline Maybe<T> Just(const T& t) {
|
|
return Maybe<T>(t);
|
|
}
|
|
|
|
|
|
/**
|
|
* An external exception handler.
|
|
*/
|
|
class V8_EXPORT TryCatch {
|
|
public:
|
|
/**
|
|
* Creates a new try/catch block and registers it with v8. Note that
|
|
* all TryCatch blocks should be stack allocated because the memory
|
|
* location itself is compared against JavaScript try/catch blocks.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use isolate version", TryCatch());
|
|
|
|
/**
|
|
* Creates a new try/catch block and registers it with v8. Note that
|
|
* all TryCatch blocks should be stack allocated because the memory
|
|
* location itself is compared against JavaScript try/catch blocks.
|
|
*/
|
|
TryCatch(Isolate* isolate);
|
|
|
|
/**
|
|
* Unregisters and deletes this try/catch block.
|
|
*/
|
|
~TryCatch();
|
|
|
|
/**
|
|
* Returns true if an exception has been caught by this try/catch block.
|
|
*/
|
|
bool HasCaught() const;
|
|
|
|
/**
|
|
* For certain types of exceptions, it makes no sense to continue execution.
|
|
*
|
|
* If CanContinue returns false, the correct action is to perform any C++
|
|
* cleanup needed and then return. If CanContinue returns false and
|
|
* HasTerminated returns true, it is possible to call
|
|
* CancelTerminateExecution in order to continue calling into the engine.
|
|
*/
|
|
bool CanContinue() const;
|
|
|
|
/**
|
|
* Returns true if an exception has been caught due to script execution
|
|
* being terminated.
|
|
*
|
|
* There is no JavaScript representation of an execution termination
|
|
* exception. Such exceptions are thrown when the TerminateExecution
|
|
* methods are called to terminate a long-running script.
|
|
*
|
|
* If such an exception has been thrown, HasTerminated will return true,
|
|
* indicating that it is possible to call CancelTerminateExecution in order
|
|
* to continue calling into the engine.
|
|
*/
|
|
bool HasTerminated() const;
|
|
|
|
/**
|
|
* Throws the exception caught by this TryCatch in a way that avoids
|
|
* it being caught again by this same TryCatch. As with ThrowException
|
|
* it is illegal to execute any JavaScript operations after calling
|
|
* ReThrow; the caller must return immediately to where the exception
|
|
* is caught.
|
|
*/
|
|
Local<Value> ReThrow();
|
|
|
|
/**
|
|
* Returns the exception caught by this try/catch block. If no exception has
|
|
* been caught an empty handle is returned.
|
|
*
|
|
* The returned handle is valid until this TryCatch block has been destroyed.
|
|
*/
|
|
Local<Value> Exception() const;
|
|
|
|
/**
|
|
* Returns the .stack property of the thrown object. If no .stack
|
|
* property is present an empty handle is returned.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version.", Local<Value> StackTrace() const);
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> StackTrace(
|
|
Local<Context> context) const;
|
|
|
|
/**
|
|
* Returns the message associated with this exception. If there is
|
|
* no message associated an empty handle is returned.
|
|
*
|
|
* The returned handle is valid until this TryCatch block has been
|
|
* destroyed.
|
|
*/
|
|
Local<v8::Message> Message() const;
|
|
|
|
/**
|
|
* Clears any exceptions that may have been caught by this try/catch block.
|
|
* After this method has been called, HasCaught() will return false. Cancels
|
|
* the scheduled exception if it is caught and ReThrow() is not called before.
|
|
*
|
|
* It is not necessary to clear a try/catch block before using it again; if
|
|
* another exception is thrown the previously caught exception will just be
|
|
* overwritten. However, it is often a good idea since it makes it easier
|
|
* to determine which operation threw a given exception.
|
|
*/
|
|
void Reset();
|
|
|
|
/**
|
|
* Set verbosity of the external exception handler.
|
|
*
|
|
* By default, exceptions that are caught by an external exception
|
|
* handler are not reported. Call SetVerbose with true on an
|
|
* external exception handler to have exceptions caught by the
|
|
* handler reported as if they were not caught.
|
|
*/
|
|
void SetVerbose(bool value);
|
|
|
|
/**
|
|
* Set whether or not this TryCatch should capture a Message object
|
|
* which holds source information about where the exception
|
|
* occurred. True by default.
|
|
*/
|
|
void SetCaptureMessage(bool value);
|
|
|
|
/**
|
|
* There are cases when the raw address of C++ TryCatch object cannot be
|
|
* used for comparisons with addresses into the JS stack. The cases are:
|
|
* 1) ARM, ARM64 and MIPS simulators which have separate JS stack.
|
|
* 2) Address sanitizer allocates local C++ object in the heap when
|
|
* UseAfterReturn mode is enabled.
|
|
* This method returns address that can be used for comparisons with
|
|
* addresses into the JS stack. When neither simulator nor ASAN's
|
|
* UseAfterReturn is enabled, then the address returned will be the address
|
|
* of the C++ try catch handler itself.
|
|
*/
|
|
static void* JSStackComparableAddress(v8::TryCatch* handler) {
|
|
if (handler == NULL) return NULL;
|
|
return handler->js_stack_comparable_address_;
|
|
}
|
|
|
|
private:
|
|
void ResetInternal();
|
|
|
|
// Make it hard to create heap-allocated TryCatch blocks.
|
|
TryCatch(const TryCatch&);
|
|
void operator=(const TryCatch&);
|
|
void* operator new(size_t size);
|
|
void operator delete(void*, size_t);
|
|
|
|
v8::internal::Isolate* isolate_;
|
|
v8::TryCatch* next_;
|
|
void* exception_;
|
|
void* message_obj_;
|
|
void* js_stack_comparable_address_;
|
|
bool is_verbose_ : 1;
|
|
bool can_continue_ : 1;
|
|
bool capture_message_ : 1;
|
|
bool rethrow_ : 1;
|
|
bool has_terminated_ : 1;
|
|
|
|
friend class v8::internal::Isolate;
|
|
};
|
|
|
|
|
|
// --- Context ---
|
|
|
|
|
|
/**
|
|
* A container for extension names.
|
|
*/
|
|
class V8_EXPORT ExtensionConfiguration {
|
|
public:
|
|
ExtensionConfiguration() : name_count_(0), names_(NULL) { }
|
|
ExtensionConfiguration(int name_count, const char* names[])
|
|
: name_count_(name_count), names_(names) { }
|
|
|
|
const char** begin() const { return &names_[0]; }
|
|
const char** end() const { return &names_[name_count_]; }
|
|
|
|
private:
|
|
const int name_count_;
|
|
const char** names_;
|
|
};
|
|
|
|
|
|
/**
|
|
* A sandboxed execution context with its own set of built-in objects
|
|
* and functions.
|
|
*/
|
|
class V8_EXPORT Context {
|
|
public:
|
|
/**
|
|
* Returns the global proxy object.
|
|
*
|
|
* Global proxy object is a thin wrapper whose prototype points to actual
|
|
* context's global object with the properties like Object, etc. This is done
|
|
* that way for security reasons (for more details see
|
|
* https://wiki.mozilla.org/Gecko:SplitWindow).
|
|
*
|
|
* Please note that changes to global proxy object prototype most probably
|
|
* would break VM---v8 expects only global object as a prototype of global
|
|
* proxy object.
|
|
*/
|
|
Local<Object> Global();
|
|
|
|
/**
|
|
* Detaches the global object from its context before
|
|
* the global object can be reused to create a new context.
|
|
*/
|
|
void DetachGlobal();
|
|
|
|
/**
|
|
* Creates a new context and returns a handle to the newly allocated
|
|
* context.
|
|
*
|
|
* \param isolate The isolate in which to create the context.
|
|
*
|
|
* \param extensions An optional extension configuration containing
|
|
* the extensions to be installed in the newly created context.
|
|
*
|
|
* \param global_template An optional object template from which the
|
|
* global object for the newly created context will be created.
|
|
*
|
|
* \param global_object An optional global object to be reused for
|
|
* the newly created context. This global object must have been
|
|
* created by a previous call to Context::New with the same global
|
|
* template. The state of the global object will be completely reset
|
|
* and only object identify will remain.
|
|
*/
|
|
static Local<Context> New(
|
|
Isolate* isolate, ExtensionConfiguration* extensions = NULL,
|
|
Local<ObjectTemplate> global_template = Local<ObjectTemplate>(),
|
|
Local<Value> global_object = Local<Value>());
|
|
|
|
/**
|
|
* Sets the security token for the context. To access an object in
|
|
* another context, the security tokens must match.
|
|
*/
|
|
void SetSecurityToken(Local<Value> token);
|
|
|
|
/** Restores the security token to the default value. */
|
|
void UseDefaultSecurityToken();
|
|
|
|
/** Returns the security token of this context.*/
|
|
Local<Value> GetSecurityToken();
|
|
|
|
/**
|
|
* Enter this context. After entering a context, all code compiled
|
|
* and run is compiled and run in this context. If another context
|
|
* is already entered, this old context is saved so it can be
|
|
* restored when the new context is exited.
|
|
*/
|
|
void Enter();
|
|
|
|
/**
|
|
* Exit this context. Exiting the current context restores the
|
|
* context that was in place when entering the current context.
|
|
*/
|
|
void Exit();
|
|
|
|
/** Returns an isolate associated with a current context. */
|
|
v8::Isolate* GetIsolate();
|
|
|
|
/**
|
|
* The field at kDebugIdIndex is reserved for V8 debugger implementation.
|
|
* The value is propagated to the scripts compiled in given Context and
|
|
* can be used for filtering scripts.
|
|
*/
|
|
enum EmbedderDataFields { kDebugIdIndex = 0 };
|
|
|
|
/**
|
|
* Gets the embedder data with the given index, which must have been set by a
|
|
* previous call to SetEmbedderData with the same index. Note that index 0
|
|
* currently has a special meaning for Chrome's debugger.
|
|
*/
|
|
V8_INLINE Local<Value> GetEmbedderData(int index);
|
|
|
|
/**
|
|
* Gets the exports object used by V8 extras. Extra natives get a reference
|
|
* to this object and can use it to export functionality.
|
|
*/
|
|
Local<Object> GetExtrasExportsObject();
|
|
|
|
/**
|
|
* Sets the embedder data with the given index, growing the data as
|
|
* needed. Note that index 0 currently has a special meaning for Chrome's
|
|
* debugger.
|
|
*/
|
|
void SetEmbedderData(int index, Local<Value> value);
|
|
|
|
/**
|
|
* Gets a 2-byte-aligned native pointer from the embedder data with the given
|
|
* index, which must have bees set by a previous call to
|
|
* SetAlignedPointerInEmbedderData with the same index. Note that index 0
|
|
* currently has a special meaning for Chrome's debugger.
|
|
*/
|
|
V8_INLINE void* GetAlignedPointerFromEmbedderData(int index);
|
|
|
|
/**
|
|
* Sets a 2-byte-aligned native pointer in the embedder data with the given
|
|
* index, growing the data as needed. Note that index 0 currently has a
|
|
* special meaning for Chrome's debugger.
|
|
*/
|
|
void SetAlignedPointerInEmbedderData(int index, void* value);
|
|
|
|
/**
|
|
* Control whether code generation from strings is allowed. Calling
|
|
* this method with false will disable 'eval' and the 'Function'
|
|
* constructor for code running in this context. If 'eval' or the
|
|
* 'Function' constructor are used an exception will be thrown.
|
|
*
|
|
* If code generation from strings is not allowed the
|
|
* V8::AllowCodeGenerationFromStrings callback will be invoked if
|
|
* set before blocking the call to 'eval' or the 'Function'
|
|
* constructor. If that callback returns true, the call will be
|
|
* allowed, otherwise an exception will be thrown. If no callback is
|
|
* set an exception will be thrown.
|
|
*/
|
|
void AllowCodeGenerationFromStrings(bool allow);
|
|
|
|
/**
|
|
* Returns true if code generation from strings is allowed for the context.
|
|
* For more details see AllowCodeGenerationFromStrings(bool) documentation.
|
|
*/
|
|
bool IsCodeGenerationFromStringsAllowed();
|
|
|
|
/**
|
|
* Sets the error description for the exception that is thrown when
|
|
* code generation from strings is not allowed and 'eval' or the 'Function'
|
|
* constructor are called.
|
|
*/
|
|
void SetErrorMessageForCodeGenerationFromStrings(Local<String> message);
|
|
|
|
/**
|
|
* Stack-allocated class which sets the execution context for all
|
|
* operations executed within a local scope.
|
|
*/
|
|
class Scope {
|
|
public:
|
|
explicit V8_INLINE Scope(Local<Context> context) : context_(context) {
|
|
context_->Enter();
|
|
}
|
|
V8_INLINE ~Scope() { context_->Exit(); }
|
|
|
|
private:
|
|
Local<Context> context_;
|
|
};
|
|
|
|
private:
|
|
friend class Value;
|
|
friend class Script;
|
|
friend class Object;
|
|
friend class Function;
|
|
|
|
Local<Value> SlowGetEmbedderData(int index);
|
|
void* SlowGetAlignedPointerFromEmbedderData(int index);
|
|
};
|
|
|
|
|
|
/**
|
|
* Multiple threads in V8 are allowed, but only one thread at a time is allowed
|
|
* to use any given V8 isolate, see the comments in the Isolate class. The
|
|
* definition of 'using a V8 isolate' includes accessing handles or holding onto
|
|
* object pointers obtained from V8 handles while in the particular V8 isolate.
|
|
* It is up to the user of V8 to ensure, perhaps with locking, that this
|
|
* constraint is not violated. In addition to any other synchronization
|
|
* mechanism that may be used, the v8::Locker and v8::Unlocker classes must be
|
|
* used to signal thead switches to V8.
|
|
*
|
|
* v8::Locker is a scoped lock object. While it's active, i.e. between its
|
|
* construction and destruction, the current thread is allowed to use the locked
|
|
* isolate. V8 guarantees that an isolate can be locked by at most one thread at
|
|
* any time. In other words, the scope of a v8::Locker is a critical section.
|
|
*
|
|
* Sample usage:
|
|
* \code
|
|
* ...
|
|
* {
|
|
* v8::Locker locker(isolate);
|
|
* v8::Isolate::Scope isolate_scope(isolate);
|
|
* ...
|
|
* // Code using V8 and isolate goes here.
|
|
* ...
|
|
* } // Destructor called here
|
|
* \endcode
|
|
*
|
|
* If you wish to stop using V8 in a thread A you can do this either by
|
|
* destroying the v8::Locker object as above or by constructing a v8::Unlocker
|
|
* object:
|
|
*
|
|
* \code
|
|
* {
|
|
* isolate->Exit();
|
|
* v8::Unlocker unlocker(isolate);
|
|
* ...
|
|
* // Code not using V8 goes here while V8 can run in another thread.
|
|
* ...
|
|
* } // Destructor called here.
|
|
* isolate->Enter();
|
|
* \endcode
|
|
*
|
|
* The Unlocker object is intended for use in a long-running callback from V8,
|
|
* where you want to release the V8 lock for other threads to use.
|
|
*
|
|
* The v8::Locker is a recursive lock, i.e. you can lock more than once in a
|
|
* given thread. This can be useful if you have code that can be called either
|
|
* from code that holds the lock or from code that does not. The Unlocker is
|
|
* not recursive so you can not have several Unlockers on the stack at once, and
|
|
* you can not use an Unlocker in a thread that is not inside a Locker's scope.
|
|
*
|
|
* An unlocker will unlock several lockers if it has to and reinstate the
|
|
* correct depth of locking on its destruction, e.g.:
|
|
*
|
|
* \code
|
|
* // V8 not locked.
|
|
* {
|
|
* v8::Locker locker(isolate);
|
|
* Isolate::Scope isolate_scope(isolate);
|
|
* // V8 locked.
|
|
* {
|
|
* v8::Locker another_locker(isolate);
|
|
* // V8 still locked (2 levels).
|
|
* {
|
|
* isolate->Exit();
|
|
* v8::Unlocker unlocker(isolate);
|
|
* // V8 not locked.
|
|
* }
|
|
* isolate->Enter();
|
|
* // V8 locked again (2 levels).
|
|
* }
|
|
* // V8 still locked (1 level).
|
|
* }
|
|
* // V8 Now no longer locked.
|
|
* \endcode
|
|
*/
|
|
class V8_EXPORT Unlocker {
|
|
public:
|
|
/**
|
|
* Initialize Unlocker for a given Isolate.
|
|
*/
|
|
V8_INLINE explicit Unlocker(Isolate* isolate) { Initialize(isolate); }
|
|
|
|
~Unlocker();
|
|
private:
|
|
void Initialize(Isolate* isolate);
|
|
|
|
internal::Isolate* isolate_;
|
|
};
|
|
|
|
|
|
class V8_EXPORT Locker {
|
|
public:
|
|
/**
|
|
* Initialize Locker for a given Isolate.
|
|
*/
|
|
V8_INLINE explicit Locker(Isolate* isolate) { Initialize(isolate); }
|
|
|
|
~Locker();
|
|
|
|
/**
|
|
* Returns whether or not the locker for a given isolate, is locked by the
|
|
* current thread.
|
|
*/
|
|
static bool IsLocked(Isolate* isolate);
|
|
|
|
/**
|
|
* Returns whether v8::Locker is being used by this V8 instance.
|
|
*/
|
|
static bool IsActive();
|
|
|
|
private:
|
|
void Initialize(Isolate* isolate);
|
|
|
|
bool has_lock_;
|
|
bool top_level_;
|
|
internal::Isolate* isolate_;
|
|
|
|
// Disallow copying and assigning.
|
|
Locker(const Locker&);
|
|
void operator=(const Locker&);
|
|
};
|
|
|
|
|
|
// --- Implementation ---
|
|
|
|
|
|
namespace internal {
|
|
|
|
const int kApiPointerSize = sizeof(void*); // NOLINT
|
|
const int kApiIntSize = sizeof(int); // NOLINT
|
|
const int kApiInt64Size = sizeof(int64_t); // NOLINT
|
|
|
|
// Tag information for HeapObject.
|
|
const int kHeapObjectTag = 1;
|
|
const int kHeapObjectTagSize = 2;
|
|
const intptr_t kHeapObjectTagMask = (1 << kHeapObjectTagSize) - 1;
|
|
|
|
// Tag information for Smi.
|
|
const int kSmiTag = 0;
|
|
const int kSmiTagSize = 1;
|
|
const intptr_t kSmiTagMask = (1 << kSmiTagSize) - 1;
|
|
|
|
template <size_t ptr_size> struct SmiTagging;
|
|
|
|
template<int kSmiShiftSize>
|
|
V8_INLINE internal::Object* IntToSmi(int value) {
|
|
int smi_shift_bits = kSmiTagSize + kSmiShiftSize;
|
|
uintptr_t tagged_value =
|
|
(static_cast<uintptr_t>(value) << smi_shift_bits) | kSmiTag;
|
|
return reinterpret_cast<internal::Object*>(tagged_value);
|
|
}
|
|
|
|
// Smi constants for 32-bit systems.
|
|
template <> struct SmiTagging<4> {
|
|
enum { kSmiShiftSize = 0, kSmiValueSize = 31 };
|
|
static int SmiShiftSize() { return kSmiShiftSize; }
|
|
static int SmiValueSize() { return kSmiValueSize; }
|
|
V8_INLINE static int SmiToInt(const internal::Object* value) {
|
|
int shift_bits = kSmiTagSize + kSmiShiftSize;
|
|
// Throw away top 32 bits and shift down (requires >> to be sign extending).
|
|
return static_cast<int>(reinterpret_cast<intptr_t>(value)) >> shift_bits;
|
|
}
|
|
V8_INLINE static internal::Object* IntToSmi(int value) {
|
|
return internal::IntToSmi<kSmiShiftSize>(value);
|
|
}
|
|
V8_INLINE static bool IsValidSmi(intptr_t value) {
|
|
// To be representable as an tagged small integer, the two
|
|
// most-significant bits of 'value' must be either 00 or 11 due to
|
|
// sign-extension. To check this we add 01 to the two
|
|
// most-significant bits, and check if the most-significant bit is 0
|
|
//
|
|
// CAUTION: The original code below:
|
|
// bool result = ((value + 0x40000000) & 0x80000000) == 0;
|
|
// may lead to incorrect results according to the C language spec, and
|
|
// in fact doesn't work correctly with gcc4.1.1 in some cases: The
|
|
// compiler may produce undefined results in case of signed integer
|
|
// overflow. The computation must be done w/ unsigned ints.
|
|
return static_cast<uintptr_t>(value + 0x40000000U) < 0x80000000U;
|
|
}
|
|
};
|
|
|
|
// Smi constants for 64-bit systems.
|
|
template <> struct SmiTagging<8> {
|
|
enum { kSmiShiftSize = 31, kSmiValueSize = 32 };
|
|
static int SmiShiftSize() { return kSmiShiftSize; }
|
|
static int SmiValueSize() { return kSmiValueSize; }
|
|
V8_INLINE static int SmiToInt(const internal::Object* value) {
|
|
int shift_bits = kSmiTagSize + kSmiShiftSize;
|
|
// Shift down and throw away top 32 bits.
|
|
return static_cast<int>(reinterpret_cast<intptr_t>(value) >> shift_bits);
|
|
}
|
|
V8_INLINE static internal::Object* IntToSmi(int value) {
|
|
return internal::IntToSmi<kSmiShiftSize>(value);
|
|
}
|
|
V8_INLINE static bool IsValidSmi(intptr_t value) {
|
|
// To be representable as a long smi, the value must be a 32-bit integer.
|
|
return (value == static_cast<int32_t>(value));
|
|
}
|
|
};
|
|
|
|
typedef SmiTagging<kApiPointerSize> PlatformSmiTagging;
|
|
const int kSmiShiftSize = PlatformSmiTagging::kSmiShiftSize;
|
|
const int kSmiValueSize = PlatformSmiTagging::kSmiValueSize;
|
|
V8_INLINE static bool SmiValuesAre31Bits() { return kSmiValueSize == 31; }
|
|
V8_INLINE static bool SmiValuesAre32Bits() { return kSmiValueSize == 32; }
|
|
|
|
/**
|
|
* This class exports constants and functionality from within v8 that
|
|
* is necessary to implement inline functions in the v8 api. Don't
|
|
* depend on functions and constants defined here.
|
|
*/
|
|
class Internals {
|
|
public:
|
|
// These values match non-compiler-dependent values defined within
|
|
// the implementation of v8.
|
|
static const int kHeapObjectMapOffset = 0;
|
|
static const int kMapInstanceTypeAndBitFieldOffset =
|
|
1 * kApiPointerSize + kApiIntSize;
|
|
static const int kStringResourceOffset = 3 * kApiPointerSize;
|
|
|
|
static const int kOddballKindOffset = 3 * kApiPointerSize;
|
|
static const int kForeignAddressOffset = kApiPointerSize;
|
|
static const int kJSObjectHeaderSize = 3 * kApiPointerSize;
|
|
static const int kFixedArrayHeaderSize = 2 * kApiPointerSize;
|
|
static const int kContextHeaderSize = 2 * kApiPointerSize;
|
|
static const int kContextEmbedderDataIndex = 81;
|
|
static const int kFullStringRepresentationMask = 0x07;
|
|
static const int kStringEncodingMask = 0x4;
|
|
static const int kExternalTwoByteRepresentationTag = 0x02;
|
|
static const int kExternalOneByteRepresentationTag = 0x06;
|
|
|
|
static const int kIsolateEmbedderDataOffset = 0 * kApiPointerSize;
|
|
static const int kAmountOfExternalAllocatedMemoryOffset =
|
|
4 * kApiPointerSize;
|
|
static const int kAmountOfExternalAllocatedMemoryAtLastGlobalGCOffset =
|
|
kAmountOfExternalAllocatedMemoryOffset + kApiInt64Size;
|
|
static const int kIsolateRootsOffset =
|
|
kAmountOfExternalAllocatedMemoryAtLastGlobalGCOffset + kApiInt64Size +
|
|
kApiPointerSize;
|
|
static const int kUndefinedValueRootIndex = 5;
|
|
static const int kNullValueRootIndex = 7;
|
|
static const int kTrueValueRootIndex = 8;
|
|
static const int kFalseValueRootIndex = 9;
|
|
static const int kEmptyStringRootIndex = 10;
|
|
|
|
// The external allocation limit should be below 256 MB on all architectures
|
|
// to avoid that resource-constrained embedders run low on memory.
|
|
static const int kExternalAllocationLimit = 192 * 1024 * 1024;
|
|
|
|
static const int kNodeClassIdOffset = 1 * kApiPointerSize;
|
|
static const int kNodeFlagsOffset = 1 * kApiPointerSize + 3;
|
|
static const int kNodeStateMask = 0x7;
|
|
static const int kNodeStateIsWeakValue = 2;
|
|
static const int kNodeStateIsPendingValue = 3;
|
|
static const int kNodeStateIsNearDeathValue = 4;
|
|
static const int kNodeIsIndependentShift = 3;
|
|
static const int kNodeIsPartiallyDependentShift = 4;
|
|
|
|
static const int kJSObjectType = 0xbe;
|
|
static const int kFirstNonstringType = 0x80;
|
|
static const int kOddballType = 0x83;
|
|
static const int kForeignType = 0x87;
|
|
|
|
static const int kUndefinedOddballKind = 5;
|
|
static const int kNullOddballKind = 3;
|
|
|
|
static const uint32_t kNumIsolateDataSlots = 4;
|
|
|
|
V8_EXPORT static void CheckInitializedImpl(v8::Isolate* isolate);
|
|
V8_INLINE static void CheckInitialized(v8::Isolate* isolate) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckInitializedImpl(isolate);
|
|
#endif
|
|
}
|
|
|
|
V8_INLINE static bool HasHeapObjectTag(const internal::Object* value) {
|
|
return ((reinterpret_cast<intptr_t>(value) & kHeapObjectTagMask) ==
|
|
kHeapObjectTag);
|
|
}
|
|
|
|
V8_INLINE static int SmiValue(const internal::Object* value) {
|
|
return PlatformSmiTagging::SmiToInt(value);
|
|
}
|
|
|
|
V8_INLINE static internal::Object* IntToSmi(int value) {
|
|
return PlatformSmiTagging::IntToSmi(value);
|
|
}
|
|
|
|
V8_INLINE static bool IsValidSmi(intptr_t value) {
|
|
return PlatformSmiTagging::IsValidSmi(value);
|
|
}
|
|
|
|
V8_INLINE static int GetInstanceType(const internal::Object* obj) {
|
|
typedef internal::Object O;
|
|
O* map = ReadField<O*>(obj, kHeapObjectMapOffset);
|
|
// Map::InstanceType is defined so that it will always be loaded into
|
|
// the LS 8 bits of one 16-bit word, regardless of endianess.
|
|
return ReadField<uint16_t>(map, kMapInstanceTypeAndBitFieldOffset) & 0xff;
|
|
}
|
|
|
|
V8_INLINE static int GetOddballKind(const internal::Object* obj) {
|
|
typedef internal::Object O;
|
|
return SmiValue(ReadField<O*>(obj, kOddballKindOffset));
|
|
}
|
|
|
|
V8_INLINE static bool IsExternalTwoByteString(int instance_type) {
|
|
int representation = (instance_type & kFullStringRepresentationMask);
|
|
return representation == kExternalTwoByteRepresentationTag;
|
|
}
|
|
|
|
V8_INLINE static uint8_t GetNodeFlag(internal::Object** obj, int shift) {
|
|
uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + kNodeFlagsOffset;
|
|
return *addr & static_cast<uint8_t>(1U << shift);
|
|
}
|
|
|
|
V8_INLINE static void UpdateNodeFlag(internal::Object** obj,
|
|
bool value, int shift) {
|
|
uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + kNodeFlagsOffset;
|
|
uint8_t mask = static_cast<uint8_t>(1U << shift);
|
|
*addr = static_cast<uint8_t>((*addr & ~mask) | (value << shift));
|
|
}
|
|
|
|
V8_INLINE static uint8_t GetNodeState(internal::Object** obj) {
|
|
uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + kNodeFlagsOffset;
|
|
return *addr & kNodeStateMask;
|
|
}
|
|
|
|
V8_INLINE static void UpdateNodeState(internal::Object** obj,
|
|
uint8_t value) {
|
|
uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + kNodeFlagsOffset;
|
|
*addr = static_cast<uint8_t>((*addr & ~kNodeStateMask) | value);
|
|
}
|
|
|
|
V8_INLINE static void SetEmbedderData(v8::Isolate* isolate,
|
|
uint32_t slot,
|
|
void* data) {
|
|
uint8_t *addr = reinterpret_cast<uint8_t *>(isolate) +
|
|
kIsolateEmbedderDataOffset + slot * kApiPointerSize;
|
|
*reinterpret_cast<void**>(addr) = data;
|
|
}
|
|
|
|
V8_INLINE static void* GetEmbedderData(const v8::Isolate* isolate,
|
|
uint32_t slot) {
|
|
const uint8_t* addr = reinterpret_cast<const uint8_t*>(isolate) +
|
|
kIsolateEmbedderDataOffset + slot * kApiPointerSize;
|
|
return *reinterpret_cast<void* const*>(addr);
|
|
}
|
|
|
|
V8_INLINE static internal::Object** GetRoot(v8::Isolate* isolate,
|
|
int index) {
|
|
uint8_t* addr = reinterpret_cast<uint8_t*>(isolate) + kIsolateRootsOffset;
|
|
return reinterpret_cast<internal::Object**>(addr + index * kApiPointerSize);
|
|
}
|
|
|
|
template <typename T>
|
|
V8_INLINE static T ReadField(const internal::Object* ptr, int offset) {
|
|
const uint8_t* addr =
|
|
reinterpret_cast<const uint8_t*>(ptr) + offset - kHeapObjectTag;
|
|
return *reinterpret_cast<const T*>(addr);
|
|
}
|
|
|
|
template <typename T>
|
|
V8_INLINE static T ReadEmbedderData(const v8::Context* context, int index) {
|
|
typedef internal::Object O;
|
|
typedef internal::Internals I;
|
|
O* ctx = *reinterpret_cast<O* const*>(context);
|
|
int embedder_data_offset = I::kContextHeaderSize +
|
|
(internal::kApiPointerSize * I::kContextEmbedderDataIndex);
|
|
O* embedder_data = I::ReadField<O*>(ctx, embedder_data_offset);
|
|
int value_offset =
|
|
I::kFixedArrayHeaderSize + (internal::kApiPointerSize * index);
|
|
return I::ReadField<T>(embedder_data, value_offset);
|
|
}
|
|
};
|
|
|
|
} // namespace internal
|
|
|
|
|
|
template <class T>
|
|
Local<T> Local<T>::New(Isolate* isolate, Local<T> that) {
|
|
return New(isolate, that.val_);
|
|
}
|
|
|
|
template <class T>
|
|
Local<T> Local<T>::New(Isolate* isolate, const PersistentBase<T>& that) {
|
|
return New(isolate, that.val_);
|
|
}
|
|
|
|
|
|
template <class T>
|
|
Local<T> Local<T>::New(Isolate* isolate, T* that) {
|
|
if (that == NULL) return Local<T>();
|
|
T* that_ptr = that;
|
|
internal::Object** p = reinterpret_cast<internal::Object**>(that_ptr);
|
|
return Local<T>(reinterpret_cast<T*>(HandleScope::CreateHandle(
|
|
reinterpret_cast<internal::Isolate*>(isolate), *p)));
|
|
}
|
|
|
|
|
|
template<class T>
|
|
template<class S>
|
|
void Eternal<T>::Set(Isolate* isolate, Local<S> handle) {
|
|
TYPE_CHECK(T, S);
|
|
V8::Eternalize(isolate, reinterpret_cast<Value*>(*handle), &this->index_);
|
|
}
|
|
|
|
|
|
template<class T>
|
|
Local<T> Eternal<T>::Get(Isolate* isolate) {
|
|
return Local<T>(reinterpret_cast<T*>(*V8::GetEternal(isolate, index_)));
|
|
}
|
|
|
|
|
|
template <class T>
|
|
Local<T> MaybeLocal<T>::ToLocalChecked() {
|
|
if (V8_UNLIKELY(val_ == nullptr)) V8::ToLocalEmpty();
|
|
return Local<T>(val_);
|
|
}
|
|
|
|
|
|
template <class T>
|
|
void* WeakCallbackInfo<T>::GetInternalField(int index) const {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
if (index < 0 || index >= kInternalFieldsInWeakCallback) {
|
|
V8::InternalFieldOutOfBounds(index);
|
|
}
|
|
#endif
|
|
return internal_fields_[index];
|
|
}
|
|
|
|
|
|
template <class T>
|
|
T* PersistentBase<T>::New(Isolate* isolate, T* that) {
|
|
if (that == NULL) return NULL;
|
|
internal::Object** p = reinterpret_cast<internal::Object**>(that);
|
|
return reinterpret_cast<T*>(
|
|
V8::GlobalizeReference(reinterpret_cast<internal::Isolate*>(isolate),
|
|
p));
|
|
}
|
|
|
|
|
|
template <class T, class M>
|
|
template <class S, class M2>
|
|
void Persistent<T, M>::Copy(const Persistent<S, M2>& that) {
|
|
TYPE_CHECK(T, S);
|
|
this->Reset();
|
|
if (that.IsEmpty()) return;
|
|
internal::Object** p = reinterpret_cast<internal::Object**>(that.val_);
|
|
this->val_ = reinterpret_cast<T*>(V8::CopyPersistent(p));
|
|
M::Copy(that, this);
|
|
}
|
|
|
|
|
|
template <class T>
|
|
bool PersistentBase<T>::IsIndependent() const {
|
|
typedef internal::Internals I;
|
|
if (this->IsEmpty()) return false;
|
|
return I::GetNodeFlag(reinterpret_cast<internal::Object**>(this->val_),
|
|
I::kNodeIsIndependentShift);
|
|
}
|
|
|
|
|
|
template <class T>
|
|
bool PersistentBase<T>::IsNearDeath() const {
|
|
typedef internal::Internals I;
|
|
if (this->IsEmpty()) return false;
|
|
uint8_t node_state =
|
|
I::GetNodeState(reinterpret_cast<internal::Object**>(this->val_));
|
|
return node_state == I::kNodeStateIsNearDeathValue ||
|
|
node_state == I::kNodeStateIsPendingValue;
|
|
}
|
|
|
|
|
|
template <class T>
|
|
bool PersistentBase<T>::IsWeak() const {
|
|
typedef internal::Internals I;
|
|
if (this->IsEmpty()) return false;
|
|
return I::GetNodeState(reinterpret_cast<internal::Object**>(this->val_)) ==
|
|
I::kNodeStateIsWeakValue;
|
|
}
|
|
|
|
|
|
template <class T>
|
|
void PersistentBase<T>::Reset() {
|
|
if (this->IsEmpty()) return;
|
|
V8::DisposeGlobal(reinterpret_cast<internal::Object**>(this->val_));
|
|
val_ = 0;
|
|
}
|
|
|
|
|
|
template <class T>
|
|
template <class S>
|
|
void PersistentBase<T>::Reset(Isolate* isolate, const Local<S>& other) {
|
|
TYPE_CHECK(T, S);
|
|
Reset();
|
|
if (other.IsEmpty()) return;
|
|
this->val_ = New(isolate, other.val_);
|
|
}
|
|
|
|
|
|
template <class T>
|
|
template <class S>
|
|
void PersistentBase<T>::Reset(Isolate* isolate,
|
|
const PersistentBase<S>& other) {
|
|
TYPE_CHECK(T, S);
|
|
Reset();
|
|
if (other.IsEmpty()) return;
|
|
this->val_ = New(isolate, other.val_);
|
|
}
|
|
|
|
|
|
template <class T>
|
|
template <typename S, typename P>
|
|
void PersistentBase<T>::SetWeak(
|
|
P* parameter,
|
|
typename WeakCallbackData<S, P>::Callback callback) {
|
|
TYPE_CHECK(S, T);
|
|
typedef typename WeakCallbackData<Value, void>::Callback Callback;
|
|
V8::MakeWeak(reinterpret_cast<internal::Object**>(this->val_), parameter,
|
|
reinterpret_cast<Callback>(callback));
|
|
}
|
|
|
|
|
|
template <class T>
|
|
template <typename P>
|
|
void PersistentBase<T>::SetWeak(
|
|
P* parameter,
|
|
typename WeakCallbackData<T, P>::Callback callback) {
|
|
SetWeak<T, P>(parameter, callback);
|
|
}
|
|
|
|
|
|
template <class T>
|
|
template <typename P>
|
|
void PersistentBase<T>::SetPhantom(
|
|
P* parameter, typename WeakCallbackInfo<P>::Callback callback,
|
|
int internal_field_index1, int internal_field_index2) {
|
|
typedef typename WeakCallbackInfo<void>::Callback Callback;
|
|
V8::MakeWeak(reinterpret_cast<internal::Object**>(this->val_), parameter,
|
|
internal_field_index1, internal_field_index2,
|
|
reinterpret_cast<Callback>(callback));
|
|
}
|
|
|
|
|
|
template <class T>
|
|
template <typename P>
|
|
V8_INLINE void PersistentBase<T>::SetWeak(
|
|
P* parameter, typename WeakCallbackInfo<P>::Callback callback,
|
|
WeakCallbackType type) {
|
|
typedef typename WeakCallbackInfo<void>::Callback Callback;
|
|
V8::MakeWeak(reinterpret_cast<internal::Object**>(this->val_), parameter,
|
|
reinterpret_cast<Callback>(callback), type);
|
|
}
|
|
|
|
|
|
template <class T>
|
|
template <typename P>
|
|
P* PersistentBase<T>::ClearWeak() {
|
|
return reinterpret_cast<P*>(
|
|
V8::ClearWeak(reinterpret_cast<internal::Object**>(this->val_)));
|
|
}
|
|
|
|
|
|
template <class T>
|
|
void PersistentBase<T>::MarkIndependent() {
|
|
typedef internal::Internals I;
|
|
if (this->IsEmpty()) return;
|
|
I::UpdateNodeFlag(reinterpret_cast<internal::Object**>(this->val_),
|
|
true,
|
|
I::kNodeIsIndependentShift);
|
|
}
|
|
|
|
|
|
template <class T>
|
|
void PersistentBase<T>::MarkPartiallyDependent() {
|
|
typedef internal::Internals I;
|
|
if (this->IsEmpty()) return;
|
|
I::UpdateNodeFlag(reinterpret_cast<internal::Object**>(this->val_),
|
|
true,
|
|
I::kNodeIsPartiallyDependentShift);
|
|
}
|
|
|
|
|
|
template <class T>
|
|
void PersistentBase<T>::SetWrapperClassId(uint16_t class_id) {
|
|
typedef internal::Internals I;
|
|
if (this->IsEmpty()) return;
|
|
internal::Object** obj = reinterpret_cast<internal::Object**>(this->val_);
|
|
uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + I::kNodeClassIdOffset;
|
|
*reinterpret_cast<uint16_t*>(addr) = class_id;
|
|
}
|
|
|
|
|
|
template <class T>
|
|
uint16_t PersistentBase<T>::WrapperClassId() const {
|
|
typedef internal::Internals I;
|
|
if (this->IsEmpty()) return 0;
|
|
internal::Object** obj = reinterpret_cast<internal::Object**>(this->val_);
|
|
uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + I::kNodeClassIdOffset;
|
|
return *reinterpret_cast<uint16_t*>(addr);
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
ReturnValue<T>::ReturnValue(internal::Object** slot) : value_(slot) {}
|
|
|
|
template<typename T>
|
|
template<typename S>
|
|
void ReturnValue<T>::Set(const Persistent<S>& handle) {
|
|
TYPE_CHECK(T, S);
|
|
if (V8_UNLIKELY(handle.IsEmpty())) {
|
|
*value_ = GetDefaultValue();
|
|
} else {
|
|
*value_ = *reinterpret_cast<internal::Object**>(*handle);
|
|
}
|
|
}
|
|
|
|
template <typename T>
|
|
template <typename S>
|
|
void ReturnValue<T>::Set(const Global<S>& handle) {
|
|
TYPE_CHECK(T, S);
|
|
if (V8_UNLIKELY(handle.IsEmpty())) {
|
|
*value_ = GetDefaultValue();
|
|
} else {
|
|
*value_ = *reinterpret_cast<internal::Object**>(*handle);
|
|
}
|
|
}
|
|
|
|
template <typename T>
|
|
template <typename S>
|
|
void ReturnValue<T>::Set(const Local<S> handle) {
|
|
TYPE_CHECK(T, S);
|
|
if (V8_UNLIKELY(handle.IsEmpty())) {
|
|
*value_ = GetDefaultValue();
|
|
} else {
|
|
*value_ = *reinterpret_cast<internal::Object**>(*handle);
|
|
}
|
|
}
|
|
|
|
template<typename T>
|
|
void ReturnValue<T>::Set(double i) {
|
|
TYPE_CHECK(T, Number);
|
|
Set(Number::New(GetIsolate(), i));
|
|
}
|
|
|
|
template<typename T>
|
|
void ReturnValue<T>::Set(int32_t i) {
|
|
TYPE_CHECK(T, Integer);
|
|
typedef internal::Internals I;
|
|
if (V8_LIKELY(I::IsValidSmi(i))) {
|
|
*value_ = I::IntToSmi(i);
|
|
return;
|
|
}
|
|
Set(Integer::New(GetIsolate(), i));
|
|
}
|
|
|
|
template<typename T>
|
|
void ReturnValue<T>::Set(uint32_t i) {
|
|
TYPE_CHECK(T, Integer);
|
|
// Can't simply use INT32_MAX here for whatever reason.
|
|
bool fits_into_int32_t = (i & (1U << 31)) == 0;
|
|
if (V8_LIKELY(fits_into_int32_t)) {
|
|
Set(static_cast<int32_t>(i));
|
|
return;
|
|
}
|
|
Set(Integer::NewFromUnsigned(GetIsolate(), i));
|
|
}
|
|
|
|
template<typename T>
|
|
void ReturnValue<T>::Set(bool value) {
|
|
TYPE_CHECK(T, Boolean);
|
|
typedef internal::Internals I;
|
|
int root_index;
|
|
if (value) {
|
|
root_index = I::kTrueValueRootIndex;
|
|
} else {
|
|
root_index = I::kFalseValueRootIndex;
|
|
}
|
|
*value_ = *I::GetRoot(GetIsolate(), root_index);
|
|
}
|
|
|
|
template<typename T>
|
|
void ReturnValue<T>::SetNull() {
|
|
TYPE_CHECK(T, Primitive);
|
|
typedef internal::Internals I;
|
|
*value_ = *I::GetRoot(GetIsolate(), I::kNullValueRootIndex);
|
|
}
|
|
|
|
template<typename T>
|
|
void ReturnValue<T>::SetUndefined() {
|
|
TYPE_CHECK(T, Primitive);
|
|
typedef internal::Internals I;
|
|
*value_ = *I::GetRoot(GetIsolate(), I::kUndefinedValueRootIndex);
|
|
}
|
|
|
|
template<typename T>
|
|
void ReturnValue<T>::SetEmptyString() {
|
|
TYPE_CHECK(T, String);
|
|
typedef internal::Internals I;
|
|
*value_ = *I::GetRoot(GetIsolate(), I::kEmptyStringRootIndex);
|
|
}
|
|
|
|
template<typename T>
|
|
Isolate* ReturnValue<T>::GetIsolate() {
|
|
// Isolate is always the pointer below the default value on the stack.
|
|
return *reinterpret_cast<Isolate**>(&value_[-2]);
|
|
}
|
|
|
|
template<typename T>
|
|
template<typename S>
|
|
void ReturnValue<T>::Set(S* whatever) {
|
|
// Uncompilable to prevent inadvertent misuse.
|
|
TYPE_CHECK(S*, Primitive);
|
|
}
|
|
|
|
template<typename T>
|
|
internal::Object* ReturnValue<T>::GetDefaultValue() {
|
|
// Default value is always the pointer below value_ on the stack.
|
|
return value_[-1];
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
FunctionCallbackInfo<T>::FunctionCallbackInfo(internal::Object** implicit_args,
|
|
internal::Object** values,
|
|
int length,
|
|
bool is_construct_call)
|
|
: implicit_args_(implicit_args),
|
|
values_(values),
|
|
length_(length),
|
|
is_construct_call_(is_construct_call) { }
|
|
|
|
|
|
template<typename T>
|
|
Local<Value> FunctionCallbackInfo<T>::operator[](int i) const {
|
|
if (i < 0 || length_ <= i) return Local<Value>(*Undefined(GetIsolate()));
|
|
return Local<Value>(reinterpret_cast<Value*>(values_ - i));
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
Local<Function> FunctionCallbackInfo<T>::Callee() const {
|
|
return Local<Function>(reinterpret_cast<Function*>(
|
|
&implicit_args_[kCalleeIndex]));
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
Local<Object> FunctionCallbackInfo<T>::This() const {
|
|
return Local<Object>(reinterpret_cast<Object*>(values_ + 1));
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
Local<Object> FunctionCallbackInfo<T>::Holder() const {
|
|
return Local<Object>(reinterpret_cast<Object*>(
|
|
&implicit_args_[kHolderIndex]));
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
Local<Value> FunctionCallbackInfo<T>::Data() const {
|
|
return Local<Value>(reinterpret_cast<Value*>(&implicit_args_[kDataIndex]));
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
Isolate* FunctionCallbackInfo<T>::GetIsolate() const {
|
|
return *reinterpret_cast<Isolate**>(&implicit_args_[kIsolateIndex]);
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
ReturnValue<T> FunctionCallbackInfo<T>::GetReturnValue() const {
|
|
return ReturnValue<T>(&implicit_args_[kReturnValueIndex]);
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
bool FunctionCallbackInfo<T>::IsConstructCall() const {
|
|
return is_construct_call_ & 0x1;
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
int FunctionCallbackInfo<T>::Length() const {
|
|
return length_;
|
|
}
|
|
|
|
ScriptOrigin::ScriptOrigin(Local<Value> resource_name,
|
|
Local<Integer> resource_line_offset,
|
|
Local<Integer> resource_column_offset,
|
|
Local<Boolean> resource_is_shared_cross_origin,
|
|
Local<Integer> script_id,
|
|
Local<Boolean> resource_is_embedder_debug_script,
|
|
Local<Value> source_map_url,
|
|
Local<Boolean> resource_is_opaque)
|
|
: resource_name_(resource_name),
|
|
resource_line_offset_(resource_line_offset),
|
|
resource_column_offset_(resource_column_offset),
|
|
options_(!resource_is_embedder_debug_script.IsEmpty() &&
|
|
resource_is_embedder_debug_script->IsTrue(),
|
|
!resource_is_shared_cross_origin.IsEmpty() &&
|
|
resource_is_shared_cross_origin->IsTrue(),
|
|
!resource_is_opaque.IsEmpty() && resource_is_opaque->IsTrue()),
|
|
script_id_(script_id),
|
|
source_map_url_(source_map_url) {}
|
|
|
|
Local<Value> ScriptOrigin::ResourceName() const { return resource_name_; }
|
|
|
|
|
|
Local<Integer> ScriptOrigin::ResourceLineOffset() const {
|
|
return resource_line_offset_;
|
|
}
|
|
|
|
|
|
Local<Integer> ScriptOrigin::ResourceColumnOffset() const {
|
|
return resource_column_offset_;
|
|
}
|
|
|
|
|
|
Local<Integer> ScriptOrigin::ScriptID() const { return script_id_; }
|
|
|
|
|
|
Local<Value> ScriptOrigin::SourceMapUrl() const { return source_map_url_; }
|
|
|
|
|
|
ScriptCompiler::Source::Source(Local<String> string, const ScriptOrigin& origin,
|
|
CachedData* data)
|
|
: source_string(string),
|
|
resource_name(origin.ResourceName()),
|
|
resource_line_offset(origin.ResourceLineOffset()),
|
|
resource_column_offset(origin.ResourceColumnOffset()),
|
|
resource_options(origin.Options()),
|
|
source_map_url(origin.SourceMapUrl()),
|
|
cached_data(data) {}
|
|
|
|
|
|
ScriptCompiler::Source::Source(Local<String> string,
|
|
CachedData* data)
|
|
: source_string(string), cached_data(data) {}
|
|
|
|
|
|
ScriptCompiler::Source::~Source() {
|
|
delete cached_data;
|
|
}
|
|
|
|
|
|
const ScriptCompiler::CachedData* ScriptCompiler::Source::GetCachedData()
|
|
const {
|
|
return cached_data;
|
|
}
|
|
|
|
|
|
Local<Boolean> Boolean::New(Isolate* isolate, bool value) {
|
|
return value ? True(isolate) : False(isolate);
|
|
}
|
|
|
|
|
|
void Template::Set(Isolate* isolate, const char* name, v8::Local<Data> value) {
|
|
Set(v8::String::NewFromUtf8(isolate, name, NewStringType::kNormal)
|
|
.ToLocalChecked(),
|
|
value);
|
|
}
|
|
|
|
|
|
Local<Value> Object::GetInternalField(int index) {
|
|
#ifndef V8_ENABLE_CHECKS
|
|
typedef internal::Object O;
|
|
typedef internal::HeapObject HO;
|
|
typedef internal::Internals I;
|
|
O* obj = *reinterpret_cast<O**>(this);
|
|
// Fast path: If the object is a plain JSObject, which is the common case, we
|
|
// know where to find the internal fields and can return the value directly.
|
|
if (I::GetInstanceType(obj) == I::kJSObjectType) {
|
|
int offset = I::kJSObjectHeaderSize + (internal::kApiPointerSize * index);
|
|
O* value = I::ReadField<O*>(obj, offset);
|
|
O** result = HandleScope::CreateHandle(reinterpret_cast<HO*>(obj), value);
|
|
return Local<Value>(reinterpret_cast<Value*>(result));
|
|
}
|
|
#endif
|
|
return SlowGetInternalField(index);
|
|
}
|
|
|
|
|
|
void* Object::GetAlignedPointerFromInternalField(int index) {
|
|
#ifndef V8_ENABLE_CHECKS
|
|
typedef internal::Object O;
|
|
typedef internal::Internals I;
|
|
O* obj = *reinterpret_cast<O**>(this);
|
|
// Fast path: If the object is a plain JSObject, which is the common case, we
|
|
// know where to find the internal fields and can return the value directly.
|
|
if (V8_LIKELY(I::GetInstanceType(obj) == I::kJSObjectType)) {
|
|
int offset = I::kJSObjectHeaderSize + (internal::kApiPointerSize * index);
|
|
return I::ReadField<void*>(obj, offset);
|
|
}
|
|
#endif
|
|
return SlowGetAlignedPointerFromInternalField(index);
|
|
}
|
|
|
|
|
|
String* String::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<String*>(value);
|
|
}
|
|
|
|
|
|
Local<String> String::Empty(Isolate* isolate) {
|
|
typedef internal::Object* S;
|
|
typedef internal::Internals I;
|
|
I::CheckInitialized(isolate);
|
|
S* slot = I::GetRoot(isolate, I::kEmptyStringRootIndex);
|
|
return Local<String>(reinterpret_cast<String*>(slot));
|
|
}
|
|
|
|
|
|
String::ExternalStringResource* String::GetExternalStringResource() const {
|
|
typedef internal::Object O;
|
|
typedef internal::Internals I;
|
|
O* obj = *reinterpret_cast<O* const*>(this);
|
|
String::ExternalStringResource* result;
|
|
if (I::IsExternalTwoByteString(I::GetInstanceType(obj))) {
|
|
void* value = I::ReadField<void*>(obj, I::kStringResourceOffset);
|
|
result = reinterpret_cast<String::ExternalStringResource*>(value);
|
|
} else {
|
|
result = NULL;
|
|
}
|
|
#ifdef V8_ENABLE_CHECKS
|
|
VerifyExternalStringResource(result);
|
|
#endif
|
|
return result;
|
|
}
|
|
|
|
|
|
String::ExternalStringResourceBase* String::GetExternalStringResourceBase(
|
|
String::Encoding* encoding_out) const {
|
|
typedef internal::Object O;
|
|
typedef internal::Internals I;
|
|
O* obj = *reinterpret_cast<O* const*>(this);
|
|
int type = I::GetInstanceType(obj) & I::kFullStringRepresentationMask;
|
|
*encoding_out = static_cast<Encoding>(type & I::kStringEncodingMask);
|
|
ExternalStringResourceBase* resource = NULL;
|
|
if (type == I::kExternalOneByteRepresentationTag ||
|
|
type == I::kExternalTwoByteRepresentationTag) {
|
|
void* value = I::ReadField<void*>(obj, I::kStringResourceOffset);
|
|
resource = static_cast<ExternalStringResourceBase*>(value);
|
|
}
|
|
#ifdef V8_ENABLE_CHECKS
|
|
VerifyExternalStringResourceBase(resource, *encoding_out);
|
|
#endif
|
|
return resource;
|
|
}
|
|
|
|
|
|
bool Value::IsUndefined() const {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
return FullIsUndefined();
|
|
#else
|
|
return QuickIsUndefined();
|
|
#endif
|
|
}
|
|
|
|
bool Value::QuickIsUndefined() const {
|
|
typedef internal::Object O;
|
|
typedef internal::Internals I;
|
|
O* obj = *reinterpret_cast<O* const*>(this);
|
|
if (!I::HasHeapObjectTag(obj)) return false;
|
|
if (I::GetInstanceType(obj) != I::kOddballType) return false;
|
|
return (I::GetOddballKind(obj) == I::kUndefinedOddballKind);
|
|
}
|
|
|
|
|
|
bool Value::IsNull() const {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
return FullIsNull();
|
|
#else
|
|
return QuickIsNull();
|
|
#endif
|
|
}
|
|
|
|
bool Value::QuickIsNull() const {
|
|
typedef internal::Object O;
|
|
typedef internal::Internals I;
|
|
O* obj = *reinterpret_cast<O* const*>(this);
|
|
if (!I::HasHeapObjectTag(obj)) return false;
|
|
if (I::GetInstanceType(obj) != I::kOddballType) return false;
|
|
return (I::GetOddballKind(obj) == I::kNullOddballKind);
|
|
}
|
|
|
|
|
|
bool Value::IsString() const {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
return FullIsString();
|
|
#else
|
|
return QuickIsString();
|
|
#endif
|
|
}
|
|
|
|
bool Value::QuickIsString() const {
|
|
typedef internal::Object O;
|
|
typedef internal::Internals I;
|
|
O* obj = *reinterpret_cast<O* const*>(this);
|
|
if (!I::HasHeapObjectTag(obj)) return false;
|
|
return (I::GetInstanceType(obj) < I::kFirstNonstringType);
|
|
}
|
|
|
|
|
|
template <class T> Value* Value::Cast(T* value) {
|
|
return static_cast<Value*>(value);
|
|
}
|
|
|
|
|
|
Local<Boolean> Value::ToBoolean() const {
|
|
return ToBoolean(Isolate::GetCurrent()->GetCurrentContext())
|
|
.FromMaybe(Local<Boolean>());
|
|
}
|
|
|
|
|
|
Local<Number> Value::ToNumber() const {
|
|
return ToNumber(Isolate::GetCurrent()->GetCurrentContext())
|
|
.FromMaybe(Local<Number>());
|
|
}
|
|
|
|
|
|
Local<String> Value::ToString() const {
|
|
return ToString(Isolate::GetCurrent()->GetCurrentContext())
|
|
.FromMaybe(Local<String>());
|
|
}
|
|
|
|
|
|
Local<String> Value::ToDetailString() const {
|
|
return ToDetailString(Isolate::GetCurrent()->GetCurrentContext())
|
|
.FromMaybe(Local<String>());
|
|
}
|
|
|
|
|
|
Local<Object> Value::ToObject() const {
|
|
return ToObject(Isolate::GetCurrent()->GetCurrentContext())
|
|
.FromMaybe(Local<Object>());
|
|
}
|
|
|
|
|
|
Local<Integer> Value::ToInteger() const {
|
|
return ToInteger(Isolate::GetCurrent()->GetCurrentContext())
|
|
.FromMaybe(Local<Integer>());
|
|
}
|
|
|
|
|
|
Local<Uint32> Value::ToUint32() const {
|
|
return ToUint32(Isolate::GetCurrent()->GetCurrentContext())
|
|
.FromMaybe(Local<Uint32>());
|
|
}
|
|
|
|
|
|
Local<Int32> Value::ToInt32() const {
|
|
return ToInt32(Isolate::GetCurrent()->GetCurrentContext())
|
|
.FromMaybe(Local<Int32>());
|
|
}
|
|
|
|
|
|
Boolean* Boolean::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Boolean*>(value);
|
|
}
|
|
|
|
|
|
Name* Name::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Name*>(value);
|
|
}
|
|
|
|
|
|
Symbol* Symbol::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Symbol*>(value);
|
|
}
|
|
|
|
|
|
Number* Number::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Number*>(value);
|
|
}
|
|
|
|
|
|
Integer* Integer::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Integer*>(value);
|
|
}
|
|
|
|
|
|
Int32* Int32::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Int32*>(value);
|
|
}
|
|
|
|
|
|
Uint32* Uint32::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Uint32*>(value);
|
|
}
|
|
|
|
|
|
Date* Date::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Date*>(value);
|
|
}
|
|
|
|
|
|
StringObject* StringObject::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<StringObject*>(value);
|
|
}
|
|
|
|
|
|
SymbolObject* SymbolObject::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<SymbolObject*>(value);
|
|
}
|
|
|
|
|
|
NumberObject* NumberObject::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<NumberObject*>(value);
|
|
}
|
|
|
|
|
|
BooleanObject* BooleanObject::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<BooleanObject*>(value);
|
|
}
|
|
|
|
|
|
RegExp* RegExp::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<RegExp*>(value);
|
|
}
|
|
|
|
|
|
Object* Object::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Object*>(value);
|
|
}
|
|
|
|
|
|
Array* Array::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Array*>(value);
|
|
}
|
|
|
|
|
|
Map* Map::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Map*>(value);
|
|
}
|
|
|
|
|
|
Set* Set::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Set*>(value);
|
|
}
|
|
|
|
|
|
Promise* Promise::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Promise*>(value);
|
|
}
|
|
|
|
|
|
Promise::Resolver* Promise::Resolver::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Promise::Resolver*>(value);
|
|
}
|
|
|
|
|
|
ArrayBuffer* ArrayBuffer::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<ArrayBuffer*>(value);
|
|
}
|
|
|
|
|
|
ArrayBufferView* ArrayBufferView::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<ArrayBufferView*>(value);
|
|
}
|
|
|
|
|
|
TypedArray* TypedArray::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<TypedArray*>(value);
|
|
}
|
|
|
|
|
|
Uint8Array* Uint8Array::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Uint8Array*>(value);
|
|
}
|
|
|
|
|
|
Int8Array* Int8Array::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Int8Array*>(value);
|
|
}
|
|
|
|
|
|
Uint16Array* Uint16Array::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Uint16Array*>(value);
|
|
}
|
|
|
|
|
|
Int16Array* Int16Array::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Int16Array*>(value);
|
|
}
|
|
|
|
|
|
Uint32Array* Uint32Array::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Uint32Array*>(value);
|
|
}
|
|
|
|
|
|
Int32Array* Int32Array::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Int32Array*>(value);
|
|
}
|
|
|
|
|
|
Float32Array* Float32Array::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Float32Array*>(value);
|
|
}
|
|
|
|
|
|
Float64Array* Float64Array::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Float64Array*>(value);
|
|
}
|
|
|
|
|
|
Uint8ClampedArray* Uint8ClampedArray::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Uint8ClampedArray*>(value);
|
|
}
|
|
|
|
|
|
DataView* DataView::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<DataView*>(value);
|
|
}
|
|
|
|
|
|
SharedArrayBuffer* SharedArrayBuffer::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<SharedArrayBuffer*>(value);
|
|
}
|
|
|
|
|
|
Function* Function::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Function*>(value);
|
|
}
|
|
|
|
|
|
External* External::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<External*>(value);
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
Isolate* PropertyCallbackInfo<T>::GetIsolate() const {
|
|
return *reinterpret_cast<Isolate**>(&args_[kIsolateIndex]);
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
Local<Value> PropertyCallbackInfo<T>::Data() const {
|
|
return Local<Value>(reinterpret_cast<Value*>(&args_[kDataIndex]));
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
Local<Object> PropertyCallbackInfo<T>::This() const {
|
|
return Local<Object>(reinterpret_cast<Object*>(&args_[kThisIndex]));
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
Local<Object> PropertyCallbackInfo<T>::Holder() const {
|
|
return Local<Object>(reinterpret_cast<Object*>(&args_[kHolderIndex]));
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
ReturnValue<T> PropertyCallbackInfo<T>::GetReturnValue() const {
|
|
return ReturnValue<T>(&args_[kReturnValueIndex]);
|
|
}
|
|
|
|
|
|
Local<Primitive> Undefined(Isolate* isolate) {
|
|
typedef internal::Object* S;
|
|
typedef internal::Internals I;
|
|
I::CheckInitialized(isolate);
|
|
S* slot = I::GetRoot(isolate, I::kUndefinedValueRootIndex);
|
|
return Local<Primitive>(reinterpret_cast<Primitive*>(slot));
|
|
}
|
|
|
|
|
|
Local<Primitive> Null(Isolate* isolate) {
|
|
typedef internal::Object* S;
|
|
typedef internal::Internals I;
|
|
I::CheckInitialized(isolate);
|
|
S* slot = I::GetRoot(isolate, I::kNullValueRootIndex);
|
|
return Local<Primitive>(reinterpret_cast<Primitive*>(slot));
|
|
}
|
|
|
|
|
|
Local<Boolean> True(Isolate* isolate) {
|
|
typedef internal::Object* S;
|
|
typedef internal::Internals I;
|
|
I::CheckInitialized(isolate);
|
|
S* slot = I::GetRoot(isolate, I::kTrueValueRootIndex);
|
|
return Local<Boolean>(reinterpret_cast<Boolean*>(slot));
|
|
}
|
|
|
|
|
|
Local<Boolean> False(Isolate* isolate) {
|
|
typedef internal::Object* S;
|
|
typedef internal::Internals I;
|
|
I::CheckInitialized(isolate);
|
|
S* slot = I::GetRoot(isolate, I::kFalseValueRootIndex);
|
|
return Local<Boolean>(reinterpret_cast<Boolean*>(slot));
|
|
}
|
|
|
|
|
|
void Isolate::SetData(uint32_t slot, void* data) {
|
|
typedef internal::Internals I;
|
|
I::SetEmbedderData(this, slot, data);
|
|
}
|
|
|
|
|
|
void* Isolate::GetData(uint32_t slot) {
|
|
typedef internal::Internals I;
|
|
return I::GetEmbedderData(this, slot);
|
|
}
|
|
|
|
|
|
uint32_t Isolate::GetNumberOfDataSlots() {
|
|
typedef internal::Internals I;
|
|
return I::kNumIsolateDataSlots;
|
|
}
|
|
|
|
|
|
int64_t Isolate::AdjustAmountOfExternalAllocatedMemory(
|
|
int64_t change_in_bytes) {
|
|
typedef internal::Internals I;
|
|
int64_t* amount_of_external_allocated_memory =
|
|
reinterpret_cast<int64_t*>(reinterpret_cast<uint8_t*>(this) +
|
|
I::kAmountOfExternalAllocatedMemoryOffset);
|
|
int64_t* amount_of_external_allocated_memory_at_last_global_gc =
|
|
reinterpret_cast<int64_t*>(
|
|
reinterpret_cast<uint8_t*>(this) +
|
|
I::kAmountOfExternalAllocatedMemoryAtLastGlobalGCOffset);
|
|
int64_t amount = *amount_of_external_allocated_memory + change_in_bytes;
|
|
if (change_in_bytes > 0 &&
|
|
amount - *amount_of_external_allocated_memory_at_last_global_gc >
|
|
I::kExternalAllocationLimit) {
|
|
CollectAllGarbage("external memory allocation limit reached.");
|
|
}
|
|
*amount_of_external_allocated_memory = amount;
|
|
return *amount_of_external_allocated_memory;
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
void Isolate::SetObjectGroupId(const Persistent<T>& object,
|
|
UniqueId id) {
|
|
TYPE_CHECK(Value, T);
|
|
SetObjectGroupId(reinterpret_cast<v8::internal::Object**>(object.val_), id);
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
void Isolate::SetReferenceFromGroup(UniqueId id,
|
|
const Persistent<T>& object) {
|
|
TYPE_CHECK(Value, T);
|
|
SetReferenceFromGroup(id,
|
|
reinterpret_cast<v8::internal::Object**>(object.val_));
|
|
}
|
|
|
|
|
|
template<typename T, typename S>
|
|
void Isolate::SetReference(const Persistent<T>& parent,
|
|
const Persistent<S>& child) {
|
|
TYPE_CHECK(Object, T);
|
|
TYPE_CHECK(Value, S);
|
|
SetReference(reinterpret_cast<v8::internal::Object**>(parent.val_),
|
|
reinterpret_cast<v8::internal::Object**>(child.val_));
|
|
}
|
|
|
|
|
|
Local<Value> Context::GetEmbedderData(int index) {
|
|
#ifndef V8_ENABLE_CHECKS
|
|
typedef internal::Object O;
|
|
typedef internal::HeapObject HO;
|
|
typedef internal::Internals I;
|
|
HO* context = *reinterpret_cast<HO**>(this);
|
|
O** result =
|
|
HandleScope::CreateHandle(context, I::ReadEmbedderData<O*>(this, index));
|
|
return Local<Value>(reinterpret_cast<Value*>(result));
|
|
#else
|
|
return SlowGetEmbedderData(index);
|
|
#endif
|
|
}
|
|
|
|
|
|
void* Context::GetAlignedPointerFromEmbedderData(int index) {
|
|
#ifndef V8_ENABLE_CHECKS
|
|
typedef internal::Internals I;
|
|
return I::ReadEmbedderData<void*>(this, index);
|
|
#else
|
|
return SlowGetAlignedPointerFromEmbedderData(index);
|
|
#endif
|
|
}
|
|
|
|
|
|
void V8::SetAllowCodeGenerationFromStringsCallback(
|
|
AllowCodeGenerationFromStringsCallback callback) {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
isolate->SetAllowCodeGenerationFromStringsCallback(callback);
|
|
}
|
|
|
|
|
|
bool V8::IsDead() {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
return isolate->IsDead();
|
|
}
|
|
|
|
|
|
bool V8::AddMessageListener(MessageCallback that, Local<Value> data) {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
return isolate->AddMessageListener(that, data);
|
|
}
|
|
|
|
|
|
void V8::RemoveMessageListeners(MessageCallback that) {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
isolate->RemoveMessageListeners(that);
|
|
}
|
|
|
|
|
|
void V8::SetFailedAccessCheckCallbackFunction(
|
|
FailedAccessCheckCallback callback) {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
isolate->SetFailedAccessCheckCallbackFunction(callback);
|
|
}
|
|
|
|
|
|
void V8::SetCaptureStackTraceForUncaughtExceptions(
|
|
bool capture, int frame_limit, StackTrace::StackTraceOptions options) {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
isolate->SetCaptureStackTraceForUncaughtExceptions(capture, frame_limit,
|
|
options);
|
|
}
|
|
|
|
|
|
void V8::SetFatalErrorHandler(FatalErrorCallback callback) {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
isolate->SetFatalErrorHandler(callback);
|
|
}
|
|
|
|
|
|
void V8::RemoveGCPrologueCallback(GCPrologueCallback callback) {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
isolate->RemoveGCPrologueCallback(
|
|
reinterpret_cast<v8::Isolate::GCPrologueCallback>(callback));
|
|
}
|
|
|
|
|
|
void V8::RemoveGCEpilogueCallback(GCEpilogueCallback callback) {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
isolate->RemoveGCEpilogueCallback(
|
|
reinterpret_cast<v8::Isolate::GCEpilogueCallback>(callback));
|
|
}
|
|
|
|
|
|
void V8::AddMemoryAllocationCallback(MemoryAllocationCallback callback,
|
|
ObjectSpace space,
|
|
AllocationAction action) {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
isolate->AddMemoryAllocationCallback(callback, space, action);
|
|
}
|
|
|
|
|
|
void V8::RemoveMemoryAllocationCallback(MemoryAllocationCallback callback) {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
isolate->RemoveMemoryAllocationCallback(callback);
|
|
}
|
|
|
|
|
|
void V8::TerminateExecution(Isolate* isolate) { isolate->TerminateExecution(); }
|
|
|
|
|
|
bool V8::IsExecutionTerminating(Isolate* isolate) {
|
|
if (isolate == NULL) {
|
|
isolate = Isolate::GetCurrent();
|
|
}
|
|
return isolate->IsExecutionTerminating();
|
|
}
|
|
|
|
|
|
void V8::CancelTerminateExecution(Isolate* isolate) {
|
|
isolate->CancelTerminateExecution();
|
|
}
|
|
|
|
|
|
void V8::VisitExternalResources(ExternalResourceVisitor* visitor) {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
isolate->VisitExternalResources(visitor);
|
|
}
|
|
|
|
|
|
void V8::VisitHandlesWithClassIds(PersistentHandleVisitor* visitor) {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
isolate->VisitHandlesWithClassIds(visitor);
|
|
}
|
|
|
|
|
|
void V8::VisitHandlesWithClassIds(Isolate* isolate,
|
|
PersistentHandleVisitor* visitor) {
|
|
isolate->VisitHandlesWithClassIds(visitor);
|
|
}
|
|
|
|
|
|
void V8::VisitHandlesForPartialDependence(Isolate* isolate,
|
|
PersistentHandleVisitor* visitor) {
|
|
isolate->VisitHandlesForPartialDependence(visitor);
|
|
}
|
|
|
|
/**
|
|
* \example shell.cc
|
|
* A simple shell that takes a list of expressions on the
|
|
* command-line and executes them.
|
|
*/
|
|
|
|
|
|
/**
|
|
* \example process.cc
|
|
*/
|
|
|
|
|
|
} // namespace v8
|
|
|
|
|
|
#undef TYPE_CHECK
|
|
|
|
|
|
#endif // V8_H_
|